CP-195543
| SMILES | O[C@@H]1[C@H](COc2c1ccc(c2)c1cc(ccc1C(=O)O)C(F)(F)F)Cc1ccccc1 |
| InChIKey | NZQDWKCNBOELAI-KSFYIVLOSA-N |
Chemical properties
| Hydrogen bond acceptors | 3 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 4 |
| Molecular weight (Da) | 428.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | Yes |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| BLT1 | LT4R1 | Human | Leukotriene | A | pKi | 8.17 | 8.17 | 8.17 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| BLT2 | LT4R2 | Human | Leukotriene | A | pIC50 | 6.0 | 6.0 | 6.0 | Guide to Pharmacology |
| BLT2 | LT4R2 | Human | Leukotriene | A | pEC50 | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
| BLT1 | LT4R1 | Human | Leukotriene | A | pIC50 | 8.62 | 8.62 | 8.62 | Guide to Pharmacology |