Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CHEMBL3315335 | 113371 | None | 0 | Human | Binding | IC50 | = | 4286.00 | 5.37 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cell membranes after 3 hrs by microscintillation counting | ChEMBL | 834.5 | 25 | 11 | 10 | -1.56 | CC(C)C[C@H](NC(=O)CCC1CCCCC1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CN)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL3356083 | 214020 | None | 12 | Human | Binding | IC50 | = | 0.78 | 9.11 | - | 4 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cell membranes after 3 hrs by microscintillation counting | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL3356083 | 214020 | None | 12 | Human | Binding | IC50 | = | 0.78 | 9.11 | - | 4 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cells after 3 hrs by topcount micro scintillation counting method | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1021/acsmedchemlett.8b00105 | |
| CHEMBL4159176 | 162077 | None | 0 | Human | Binding | IC50 | = | 100.10 | 7.00 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cell membranes after 3 hrs by microscintillation counting | ChEMBL | 1140.6 | 33 | 16 | 14 | -2.37 | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N(CCc1ccc(O)cc1)CC(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL4159554 | 162102 | None | 0 | Human | Binding | IC50 | = | 0.75 | 9.12 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cells after 3 hrs by topcount micro scintillation counting method | ChEMBL | 1242.7 | 35 | 16 | 13 | -0.41 | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(=O)NCc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/acsmedchemlett.8b00105 | |
| CHEMBL4160825 | 162177 | None | 0 | Human | Binding | IC50 | = | 0.31 | 9.51 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cell membranes after 3 hrs by microscintillation counting | ChEMBL | 1160.6 | 32 | 16 | 13 | -1.27 | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1cccc2ccccc12)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL4161037 | 162188 | None | 0 | Human | Binding | IC50 | = | 844.40 | 6.07 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cell membranes after 3 hrs by microscintillation counting | ChEMBL | 1152.6 | 33 | 16 | 13 | -2.24 | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL4161095 | 162190 | None | 0 | Human | Binding | IC50 | = | 173.80 | 6.76 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cell membranes after 3 hrs by microscintillation counting | ChEMBL | 1126.6 | 32 | 16 | 14 | -2.41 | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N(CC(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O)Cc1ccc(O)cc1 | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL4161479 | 162214 | None | 0 | Human | Binding | IC50 | = | 28.10 | 7.55 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cells after 3 hrs by topcount micro scintillation counting method | ChEMBL | 1166.6 | 34 | 16 | 13 | -1.85 | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)CC(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1021/acsmedchemlett.8b00105 | |
| CHEMBL4161501 | 162217 | None | 0 | Human | Binding | IC50 | = | 68.60 | 7.16 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cell membranes after 3 hrs by microscintillation counting | ChEMBL | 1156.7 | 30 | 15 | 13 | -1.81 | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N1[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O)C[C@@H]2CCCC[C@@H]21 | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL4161902 | 162243 | None | 0 | Human | Binding | IC50 | = | 0.88 | 9.06 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cell membranes after 3 hrs by microscintillation counting | ChEMBL | 1186.6 | 33 | 15 | 12 | -0.79 | CC(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL4162351 | 162265 | None | 0 | Human | Binding | IC50 | = | 8.80 | 8.06 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cells after 3 hrs by topcount micro scintillation counting method | ChEMBL | 1178.6 | 31 | 16 | 13 | -1.93 | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)NC1(C(=O)N[C@@H](CCCNC(=N)N)C(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O)CCc2ccccc2C1 | https://dx.doi.org/10.1021/acsmedchemlett.8b00105 | |
| CHEMBL4162728 | 162297 | None | 0 | Human | Binding | IC50 | = | 0.09 | 10.04 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cells after 3 hrs by topcount micro scintillation counting method | ChEMBL | 1214.6 | 30 | 15 | 13 | -0.86 | CC(=O)N1Cc2cc(O)ccc2C[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1021/acsmedchemlett.8b00105 | |
| CHEMBL4162868 | 162307 | None | 0 | Human | Binding | IC50 | = | 3.90 | 8.41 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cell membranes after 3 hrs by microscintillation counting | ChEMBL | 1182.6 | 34 | 16 | 14 | -2.19 | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N(CCc1ccc(O)cc1)CC(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL4164026 | 162372 | None | 0 | Human | Binding | IC50 | = | 0.97 | 9.01 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cell membranes after 3 hrs by microscintillation counting | ChEMBL | 1144.6 | 32 | 15 | 12 | -0.97 | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc2ccccc2c1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL4164449 | 162400 | None | 0 | Human | Binding | IC50 | = | 3755.00 | 5.42 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cell membranes after 3 hrs by microscintillation counting | ChEMBL | 1152.6 | 33 | 16 | 13 | -2.24 | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL4164680 | 162418 | None | 0 | Human | Binding | IC50 | = | 1167.00 | 5.93 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cell membranes after 3 hrs by microscintillation counting | ChEMBL | 1110.6 | 32 | 16 | 13 | -2.42 | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL4164922 | 162438 | None | 0 | Human | Binding | IC50 | = | 0.36 | 9.44 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cell membranes after 3 hrs by microscintillation counting | ChEMBL | 1196.6 | 33 | 17 | 14 | -1.92 | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c(C)cc(O)cc1C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL4164957 | 162441 | None | 0 | Human | Binding | IC50 | = | 37.00 | 7.43 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cells after 3 hrs by topcount micro scintillation counting method | ChEMBL | 1242.7 | 35 | 16 | 13 | -0.41 | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(=O)NCc1ccccc1 | https://dx.doi.org/10.1021/acsmedchemlett.8b00105 | |
| CHEMBL4164987 | 162443 | None | 0 | Human | Binding | IC50 | = | 3.00 | 8.52 | - | 2 | Displacement of [3H]-NMU-8 from human NMUR1 expressed in HEK293 cells after 3 hrs by topcount micro scintillation counting method | ChEMBL | 1178.6 | 30 | 14 | 13 | -1.67 | CC(=O)N1Cc2cc(O)ccc2C[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N(C)[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1021/acsmedchemlett.8b00105 | |
Showing 1 to 20 of 55 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CHEMBL3315278 | 113368 | None | 0 | Human | Functional | EC50 | = | 9.00 | 8.05 | -1 | 2 | Partial agonist activity at human NMUR1 expressed in CHO cells by calcium mobilization assay | ChEMBL | 932.5 | 28 | 13 | 10 | -1.79 | CC(C)C[C@H](NC(=O)CCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1021/jm500599s | |
| CHEMBL3315349 | 213839 | None | 2 | Human | Functional | EC50 | = | 0.43 | 9.37 | 25 | 2 | Agonist activity at human NMUR1 expressed in CHO cells by calcium mobilization assay | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)Cc1ccccc1)C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1021/jm500599s | |
| CHEMBL3315349 | 213839 | None | 2 | Human | Functional | EC50 | = | 0.14 | 9.85 | 25 | 2 | Agonist activity at human NMUR1 expressed in CHO cells assessed as intracellular calcium flux at by Fluo-4 AM dye based fluorometric imaging method | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)Cc1ccccc1)C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1021/ml500494j | |
| CHEMBL3315349 | 213839 | None | 2 | Human | Functional | EC50 | = | 1.07 | 8.97 | 25 | 2 | Agonist activity at recombinant human NMU1 expressed in HEK293 cells assessed as change in intracellular calcium flux by fluorescence assay | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)Cc1ccccc1)C(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2015.07.020 | |
| CHEMBL3356082 | 214019 | None | 0 | Human | Functional | EC50 | = | 709.40 | 6.15 | -4 | 4 | Agonist activity at human NMUR1 expressed in HEK293 cells assessed as induction of IP3 levels using myo-[2-3H(N)]-inositol after 60 mins by SPA-based topcount assay | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL3356082 | 214019 | None | 0 | Mouse | Functional | EC50 | = | 2411.00 | 5.62 | -15 | 4 | Agonist activity at mouse NMUR1 expressed in HEK293 cells by calcium mobilization assay | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1021/jm500599s | |
| CHEMBL3356083 | 214020 | None | 12 | Human | Functional | EC50 | = | 0.45 | 9.35 | -2 | 4 | Agonist activity at human NMUR1 expressed in CHO cells assessed as increase in intracellular calcium influx after 180 secs by Fluo 4-AM dye based FLIPR assay | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.bmcl.2017.09.019 | |
| CHEMBL3356083 | 214020 | None | 12 | Human | Functional | EC50 | = | 38.90 | 7.41 | -2 | 4 | Agonist activity at human NMUR1 expressed in HEK293 cells assessed as induction of IP3 levels using myo-[2-3H(N)]-inositol after 60 mins by SPA-based topcount assay | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2017.12.035 | |
| CHEMBL3356083 | 214020 | None | 12 | Human | Functional | EC50 | = | 38.90 | 7.41 | -2 | 4 | Agonist activity at human NMUR1 expressed in HEK293 cells assessed as IP3 accumulation after 60 mins in presence of myo-[2-3H(N)]inositol by scintillation proximity assay | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1021/acsmedchemlett.8b00105 | |
| CHEMBL3356083 | 214020 | None | 12 | Mouse | Functional | EC50 | = | 9.50 | 8.02 | -2 | 4 | Agonist activity at mouse NMUR1 expressed in HEK293 cells by calcium mobilization assay | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1021/jm500599s | |
| CHEMBL3356083 | 214020 | None | 12 | Mouse | Functional | EC50 | = | 0.81 | 9.09 | -2 | 4 | Agonist activity at mouse NMUR1 expressed in CHO cells assessed as increase in intracellular calcium influx after 180 secs by Fluo 4-AM dye based FLIPR assay | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.bmcl.2017.09.019 | |
| CHEMBL3758417 | 137744 | None | 0 | Human | Functional | EC50 | = | 1348.96 | 5.87 | -1 | 2 | Agonist activity at recombinant human NMU1 expressed in HEK293 cells assessed as change in intracellular calcium flux by fluorescence assay | ChEMBL | 1433.8 | 46 | 20 | 17 | -1.50 | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CCCCCNC(=O)[C@@H](N)CS)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(=O)NCCCCCC(=O)N[C@@H](CS)C(N)=O)C[C@@H]2CCCC[C@@H]21 | https://dx.doi.org/10.1016/j.ejmech.2015.07.020 | |
| CHEMBL3758577 | 214685 | None | 0 | Human | Functional | EC50 | = | 0.56 | 9.25 | -2 | 2 | Agonist activity at recombinant human NMU1 expressed in HEK293 cells assessed as change in intracellular calcium flux by fluorescence assay | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)C(C)(C)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2015.07.020 | |
| CHEMBL3758687 | 214686 | None | 0 | Human | Functional | EC50 | = | 58.88 | 7.23 | -1 | 2 | Agonist activity at recombinant human NMU1 expressed in HEK293 cells assessed as change in intracellular calcium flux by fluorescence assay | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)C(C)(C)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(=O)NC(C)(C)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2015.07.020 | |
| CHEMBL3758845 | 137793 | None | 0 | Human | Functional | EC50 | = | 12589.25 | 4.90 | -1 | 2 | Agonist activity at recombinant human NMU1 expressed in HEK293 cells assessed as change in intracellular calcium flux by fluorescence assay | ChEMBL | 1595.1 | 65 | 16 | 14 | 7.58 | CCCCCCCCCCCCCCCCNC(=O)CN(CCCCCCCCCCCCCCCC)CC(=O)NC(C)(C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2015.07.020 | |
| CHEMBL3759206 | 137831 | None | 0 | Human | Functional | EC50 | = | 12.30 | 7.91 | -1 | 2 | Agonist activity at recombinant human NMU1 expressed in HEK293 cells assessed as change in intracellular calcium flux by fluorescence assay | ChEMBL | 1370.9 | 50 | 17 | 14 | 1.39 | CCCCCCCCCCCCCCCCNC(=O)CNCC(=O)NC(C)(C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2015.07.020 | |
| CHEMBL3759408 | 137858 | None | 0 | Human | Functional | EC50 | = | 162.18 | 6.79 | 1 | 2 | Agonist activity at recombinant human NMU1 expressed in HEK293 cells assessed as change in intracellular calcium flux by fluorescence assay | ChEMBL | 1379.7 | 46 | 20 | 17 | -2.67 | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CCCCCNC(=O)[C@@H](N)CS)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(=O)NCCCCCC(=O)N[C@@H](CS)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2015.07.020 | |
| CHEMBL3759452 | 214691 | None | 0 | Human | Functional | EC50 | = | 0.58 | 9.24 | -1 | 2 | Agonist activity at recombinant human NMU1 expressed in HEK293 cells assessed as change in intracellular calcium flux by fluorescence assay | ChEMBL | - | - | - | - | - | CC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2015.07.020 | |
| CHEMBL3759626 | 137890 | None | 0 | Human | Functional | EC50 | = | 5011.87 | 5.30 | -1 | 2 | Agonist activity at recombinant human NMU1 expressed in HEK293 cells assessed as change in intracellular calcium flux by fluorescence assay | ChEMBL | 1441.7 | 46 | 20 | 17 | -1.71 | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CCCCCNC(=O)[C@@H](N)CS)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1Cc2ccccc2C[C@@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(=O)NCCCCCC(=O)N[C@@H](CS)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2015.07.020 | |
| CHEMBL3759714 | 137898 | None | 0 | Human | Functional | EC50 | = | 141.25 | 6.85 | -1 | 2 | Agonist activity at recombinant human NMU1 expressed in HEK293 cells assessed as change in intracellular calcium flux by fluorescence assay | ChEMBL | 1270.8 | 45 | 15 | 12 | 2.68 | CCCCCCCCCCCCCCCC(=O)NC(C)(C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2015.07.020 | |
Showing 1 to 20 of 131 entries