selexipag
SMILES | O=C(NS(=O)(=O)C)COCCCCN(c1cnc(c(n1)c1ccccc1)c1ccccc1)C(C)C |
InChIKey | QXWZQTURMXZVHJ-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 7 |
Hydrogen bond donors | 1 |
Rotatable bonds | 12 |
Molecular weight (Da) | 496.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Sankey plot
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
IP | PI2R | Human | Prostanoid | A | pKi | 6.59 | 6.59 | 6.59 | Guide to Pharmacology |
IP | PI2R | Rat | Prostanoid | A | pKi | 5.68 | 5.68 | 5.68 | Guide to Pharmacology |
EP2 | PE2R2 | Human | Prostanoid | A | pKi | 8.28 | 8.28 | 8.28 | Drug Central |
EP4 | PE2R4 | Human | Prostanoid | A | pKi | 8.27 | 8.27 | 8.27 | Drug Central |
IP | PI2R | Human | Prostanoid | A | pKi | 8.11 | 8.11 | 8.11 | Drug Central |
IP | PI2R | Rat | Prostanoid | A | pKi | 8.25 | 8.25 | 8.25 | Drug Central |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
DP1 | PD2R | Human | Prostanoid | A | pEC50 | 7.0 | 7.0 | 7.0 | ChEMBL |
DP1 | PD2R | Human | Prostanoid | A | pEC50 | 8.15 | 8.15 | 8.15 | Drug Central |
IP | PI2R | Human | Prostanoid | A | pIC50 | 5.19 | 6.2 | 7.21 | ChEMBL |
IP | PI2R | Human | Prostanoid | A | pEC50 | 8.22 | 8.22 | 8.22 | ChEMBL |
IP | PI2R | Rat | Prostanoid | A | pEC50 | 6.7 | 6.7 | 6.7 | ChEMBL |