CHEMBL265858
SMILES | NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CSSCCC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](CC2CCCCC2)C(=O)N[C@@H](CC(N)=O)C(=O)N1 |
InChIKey | ZKYCVZNKBXGNEK-ZTYVOHGWSA-N |
Chemical properties
Hydrogen bond acceptors | 14 |
Hydrogen bond donors | 12 |
Rotatable bonds | 18 |
Molecular weight (Da) | 1093.5 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
V1B | V1BR | Rat | Vasopressin and oxytocin | A | pKi | 8.85 | 8.85 | 8.85 | ChEMBL |
V1A | V1AR | Rat | Vasopressin and oxytocin | A | pKi | 5.64 | 5.64 | 5.64 | ChEMBL |
V2 | V2R | Rat | Vasopressin and oxytocin | A | pKi | 7.9 | 7.9 | 7.9 | ChEMBL |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pKi | 5.84 | 5.84 | 5.84 | ChEMBL |
V1B | V1BR | Human | Vasopressin and oxytocin | A | pKi | 8.92 | 8.92 | 8.92 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 6.62 | 6.62 | 6.62 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 6.12 | 6.12 | 6.12 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 6.82 | 6.82 | 6.82 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |