UDP
SMILES | O[C@@H]1[C@@H](COP(=O)(OP(=O)(O)O)O)O[C@H]([C@@H]1O)n1ccc(=O)[nH]c1=O |
InChIKey | XCCTYIAWTASOJW-XVFCMESISA-N |
Chemical properties
Hydrogen bond acceptors | 10 |
Hydrogen bond donors | 6 |
Rotatable bonds | 6 |
Molecular weight (Da) | 404.0 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Endogenous |
Approved drug | Yes |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
P2Y6 | P2RY6 | Human | P2Y | A | pEC50 | 6.5 | 6.5 | 6.5 | Guide to Pharmacology |
P2Y14 | P2Y14 | Human | P2Y | A | pEC50 | 7.13 | 7.13 | 7.13 | Guide to Pharmacology |
GPR17 | GPR17 | Human | A orphans | A | pEC50 | 5.97 | 7.38 | 8.8 | Guide to Pharmacology |
P2Y14 | P2Y14 | Rat | P2Y | A | pIC50 | 6.5 | 6.5 | 6.5 | Guide to Pharmacology |
P2Y14 | P2Y14 | Rat | P2Y | A | pEC50 | 6.46 | 6.46 | 6.46 | ChEMBL |
P2Y6 | P2RY6 | Rat | P2Y | A | pEC50 | 6.7 | 6.7 | 6.7 | ChEMBL |
P2Y4 | P2RY4 | Human | P2Y | A | pEC50 | 4.85 | 4.85 | 4.85 | ChEMBL |
P2Y14 | P2Y14 | Human | P2Y | A | pEC50 | 6.8 | 7.15 | 7.54 | ChEMBL |
P2Y6 | P2RY6 | Human | P2Y | A | pEC50 | 6.28 | 7.05 | 7.89 | ChEMBL |
P2Y2 | P2RY2 | Human | P2Y | A | pEC50 | 4.78 | 4.78 | 4.78 | ChEMBL |
GPR17 | GPR17 | Human | A orphans | A | pEC50 | 5.94 | 5.94 | 5.94 | ChEMBL |