cromoglicic acid
SMILES | OC(COc1cccc2c1c(=O)cc(o2)C(=O)O)COc1cccc2c1c(=O)cc(o2)C(=O)O |
InChIKey | IMZMKUWMOSJXDT-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 9 |
Hydrogen bond donors | 3 |
Rotatable bonds | 8 |
Molecular weight (Da) | 468.1 |
Drug properties
Molecular type | Small molecule |
Endogenous/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
GPR35 | GPR35 | Human | A orphans | A | pKi | 5.63 | 5.63 | 5.63 | ChEMBL |
GPR35 | GPR35 | Human | A orphans | A | pKi | 8.25 | 8.25 | 8.25 | Drug Central |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
TAS2R7 | TA2R7 | Human | Taste 2 | T | pEC50 | 2.35 | 2.35 | 2.35 | Guide to Pharmacology |
TAS2R20 | T2R20 | Human | Taste 2 | T | pEC50 | 4.35 | 4.35 | 4.35 | Guide to Pharmacology |
GPR35 | GPR35 | Human | A orphans | A | pEC50 | 5.16 | 6.26 | 7.28 | ChEMBL |
GPR35 | GPR35 | Mouse | A orphans | A | pEC50 | 8.27 | 8.27 | 8.27 | Drug Central |
GPR35 | Q33BM1 | Rat | A orphans | A | pEC50 | 8.22 | 8.22 | 8.22 | Drug Central |
GPR35 | GPR35 | Mouse | A orphans | A | pEC50 | 5.32 | 5.32 | 5.32 | ChEMBL |
GPR35 | Q33BM1 | Rat | A orphans | A | pEC50 | 6.01 | 6.01 | 6.01 | ChEMBL |