CHEMBL375324
SMILES | NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CSSCCC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CC(N)=O)C(=O)N1 |
InChIKey | NZPQDNABVFGPNI-POFDKVPJSA-N |
Chemical properties
Hydrogen bond acceptors | 15 |
Hydrogen bond donors | 14 |
Rotatable bonds | 20 |
Molecular weight (Da) | 1096.5 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
V1B | V1BR | Rat | Vasopressin and oxytocin | A | pKi | 9.89 | 9.89 | 9.89 | ChEMBL |
V1A | V1AR | Rat | Vasopressin and oxytocin | A | pKi | 7.89 | 7.89 | 7.89 | ChEMBL |
V2 | V2R | Rat | Vasopressin and oxytocin | A | pKi | 9.7 | 9.7 | 9.7 | ChEMBL |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pKi | 5.45 | 5.45 | 5.45 | ChEMBL |
V1B | V1BR | Human | Vasopressin and oxytocin | A | pKi | 9.43 | 9.43 | 9.43 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 5.96 | 5.96 | 5.96 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 6.88 | 6.88 | 6.88 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 7.27 | 7.27 | 7.27 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |