CHEMBL4205046
SMILES | Cc1ccn(C(=O)Nc2ccc(C(=O)N3CCCCc4ccccc43)c(Cl)c2)n1 |
InChIKey | WLSCYTZXIQSDLZ-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 1 |
Rotatable bonds | 2 |
Molecular weight (Da) | 408.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 6.49 | 6.49 | 6.49 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 7.42 | 7.42 | 7.42 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 6.62 | 6.62 | 6.62 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Human | Vasopressin and oxytocin | A | pIC50 | 7.43 | 7.43 | 7.43 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pEC50 | 8.4 | 8.4 | 8.4 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pIC50 | 7.89 | 7.89 | 7.89 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pIC50 | 7.72 | 7.72 | 7.72 | ChEMBL |