CHEMBL528996
SMILES | Cc1ccn(-c2ccc(C(=O)N3CCC(F)(F)/C(=C\C(=O)NCc4ccccn4)c4ccccc43)c(Cl)c2)n1 |
InChIKey | GRCPGLCEGKJUFI-ULJHMMPZSA-N |
Chemical properties
Hydrogen bond acceptors | 5 |
Hydrogen bond donors | 1 |
Rotatable bonds | 5 |
Molecular weight (Da) | 547.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
V2 | V2R | Rat | Vasopressin and oxytocin | A | pKi | 7.72 | 7.72 | 7.72 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 8.32 | 8.32 | 8.32 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 7.58 | 7.58 | 7.58 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
V2 | V2R | Human | Vasopressin and oxytocin | A | pEC50 | 8.74 | 8.74 | 8.74 | ChEMBL |