CHEMBL1788221
SMILES | CN(C)CCNC(=O)C1=C[C@@]2(CC1)CCN(C(=O)c1ccc(NC(=O)c3ccccc3F)cc1)c1ccccc1C2 |
InChIKey | OFQCVYOFPPDYDD-XIFFEERXSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 2 |
Rotatable bonds | 7 |
Molecular weight (Da) | 554.3 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
V1A | V1AR | Rat | Vasopressin and oxytocin | A | pIC50 | 6.36 | 6.36 | 6.36 | ChEMBL |
V2 | V2R | Rat | Vasopressin and oxytocin | A | pIC50 | 6.35 | 6.35 | 6.35 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pIC50 | 6.19 | 6.33 | 6.47 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pIC50 | 7.11 | 7.76 | 8.4 | ChEMBL |