ACPT-I
SMILES | OC(=O)[C@@H]1C[C@](C[C@@H]1C(=O)O)(N)C(=O)O |
InChIKey | FERIKTBTNCSGJS-KIGHRTHISA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 4 |
Rotatable bonds | 3 |
Molecular weight (Da) | 217.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu6 | GRM6 | Rat | Metabotropic glutamate | C | pIC50 | 4.7 | 4.7 | 4.7 | Guide to Pharmacology |
mGlu8 | GRM8 | Rat | Metabotropic glutamate | C | pEC50 | 5.1 | 5.1 | 5.1 | Guide to Pharmacology |
mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pEC50 | 5.1 | 5.1 | 5.1 | Guide to Pharmacology |
mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pEC50 | 5.14 | 5.45 | 5.76 | ChEMBL |
mGlu2 | GRM2 | Rat | Metabotropic glutamate | C | pIC50 | 4.06 | 4.06 | 4.06 | ChEMBL |
mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pEC50 | 5.14 | 5.36 | 5.77 | ChEMBL |
mGlu6 | GRM6 | Human | Metabotropic glutamate | C | pEC50 | 4.96 | 4.96 | 4.96 | ChEMBL |
mGlu8 | GRM8 | Human | Metabotropic glutamate | C | pEC50 | 5.29 | 5.29 | 5.29 | ChEMBL |
mGlu6 | GRM6 | Rat | Metabotropic glutamate | C | pEC50 | 4.74 | 4.86 | 4.97 | ChEMBL |
mGlu8 | GRM8 | Rat | Metabotropic glutamate | C | pEC50 | 5.0 | 5.14 | 5.29 | ChEMBL |