ADP
| SMILES | O[C@@H]1[C@@H](COP(=O)(OP(=O)(O)O)O)O[C@H]([C@@H]1O)n1cnc2c1ncnc2N |
| InChIKey | XTWYTFMLZFPYCI-KQYNXXCUSA-N |
Chemical properties
| Hydrogen bond acceptors | 12 |
| Hydrogen bond donors | 6 |
| Rotatable bonds | 6 |
| Molecular weight (Da) | 427.0 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Endogenous |
| Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| P2Y12 | P2Y12 | Human | P2Y | A | pKi | 5.9 | 5.9 | 5.9 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| P2Y1 | P2RY1 | Human | P2Y | A | pIC50 | 6.2 | 6.7 | 7.2 | Guide to Pharmacology |
| P2Y6 | P2RY6 | Human | P2Y | A | pEC50 | 4.5 | 4.5 | 4.5 | Guide to Pharmacology |
| P2Y13 | P2Y13 | Human | P2Y | A | pIC50 | 6.5 | 6.5 | 6.5 | Guide to Pharmacology |
| P2Y1 | P2RY1 | Wild turkey | P2Y | A | pEC50 | 5.1 | 6.05 | 7.0 | ChEMBL |
| P2Y1 | P2RY1 | Human | P2Y | A | pEC50 | 7.62 | 7.7 | 7.85 | ChEMBL |
| P2Y6 | P2RY6 | Human | P2Y | A | pEC50 | 4.19 | 4.19 | 4.19 | ChEMBL |
| P2Y11 | P2Y11 | Human | P2Y | A | pEC50 | 5.77 | 5.77 | 5.77 | ChEMBL |
| P2Y12 | P2Y12 | Rat | P2Y | A | pEC50 | 7.16 | 7.16 | 7.16 | ChEMBL |