AM966
| SMILES | OC(=O)Cc1ccc(cc1)c1ccc(cc1)c1onc(c1NC(=O)O[C@@H](c1ccccc1Cl)C)C |
| InChIKey | WWQTWEWAPUCDDZ-QGZVFWFLSA-N |
Chemical properties
| Hydrogen bond acceptors | 5 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 7 |
| Molecular weight (Da) | 490.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pIC50 | 6.7 | 7.25 | 7.8 | Guide to Pharmacology |
| LPA2 | LPAR2 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.8 | 5.8 | 5.8 | Guide to Pharmacology |
| LPA3 | LPAR3 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.7 | 5.7 | 5.7 | Guide to Pharmacology |
| LPA4 | LPAR4 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.1 | 5.1 | 5.1 | Guide to Pharmacology |
| LPA1 | LPAR1 | Mouse | Lysophospholipid (LPA) | A | pEC50 | 7.7 | 7.7 | 7.7 | Guide to Pharmacology |
| LPA2 | LPAR2 | Mouse | Lysophospholipid (LPA) | A | pIC50 | 4.6 | 4.6 | 4.6 | Guide to Pharmacology |
| LPA1 | LPAR1 | Human | Lysophospholipid (LPA) | A | pIC50 | 7.77 | 7.77 | 7.77 | ChEMBL |
| LPA2 | LPAR2 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.77 | 5.77 | 5.77 | ChEMBL |
| LPA3 | LPAR3 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.8 | 5.8 | 5.8 | ChEMBL |
| LPA3 | LPAR3 | Mouse | Lysophospholipid (LPA) | A | pIC50 | 6.8 | 6.8 | 6.8 | Guide to Pharmacology |