CID2440433
SMILES | O=C(c1cc(ccc1N1CCCC1)S(=O)(=O)N(C)C)N1CCN(CC1)c1cccc(c1C)C |
InChIKey | VRSJAHQGJHDACS-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 5 |
Hydrogen bond donors | 0 |
Rotatable bonds | 5 |
Molecular weight (Da) | 470.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
GPR55 | GPR55 | Human | GPR18, GPR55 and GPR119 | A | pEC50 | 6.57 | 6.58 | 6.6 | Guide to Pharmacology |
GPR55 | GPR55 | Human | GPR18, GPR55 and GPR119 | A | pEC50 | 6.29 | 6.48 | 6.58 | ChEMBL |
CB1 | CNR1 | Human | Cannabinoid | A | pIC50 | 4.66 | 4.66 | 4.66 | ChEMBL |
CB2 | CNR2 | Human | Cannabinoid | A | pIC50 | 4.82 | 4.82 | 4.82 | ChEMBL |