ciproxifan
SMILES | O=C(c1ccc(cc1)OCCCc1[nH]cnc1)C1CC1 |
InChIKey | ACQBHJXEAYTHCY-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 1 |
Rotatable bonds | 7 |
Molecular weight (Da) | 270.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Ligand site mutations | H3 |
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
H1 | HRH1 | Human | Histamine | A | pKi | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
H2 | HRH2 | Human | Histamine | A | pKi | 5.0 | 5.0 | 5.0 | Guide to Pharmacology |
H3 | HRH3 | Human | Histamine | A | pKi | 6.7 | 7.0 | 7.3 | Guide to Pharmacology |
H4 | HRH4 | Human | Histamine | A | pKi | 5.73 | 5.73 | 5.73 | Guide to Pharmacology |
H3 | HRH3 | Rat | Histamine | A | pKi | 8.4 | 8.85 | 9.3 | Guide to Pharmacology |
H3 | HRH3 | Mouse | Histamine | A | pKi | 9.1 | 9.25 | 9.4 | Guide to Pharmacology |
H3 | HRH3 | Rat | Histamine | A | pKi | 8.41 | 9.2 | 9.31 | ChEMBL |
H3 | HRH3 | Human | Histamine | A | pKi | 6.65 | 7.21 | 7.34 | ChEMBL |
α2A | ADA2A | Human | Adrenoceptors | A | pKi | 7.37 | 7.37 | 7.37 | ChEMBL |
α2C | ADA2C | Human | Adrenoceptors | A | pKi | 7.2 | 7.2 | 7.2 | ChEMBL |
H4 | HRH4 | Human | Histamine | A | pKi | 5.73 | 6.05 | 6.21 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |