compound 10 [PMID: 15482906]
SMILES | Fc1cc(Oc2cccnc2)cc(c1)n1nnc(n1)c1ccccn1 |
InChIKey | IQSMPFFGKFZZMI-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 7 |
Hydrogen bond donors | 0 |
Rotatable bonds | 4 |
Molecular weight (Da) | 334.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pKi | 7.92 | 7.92 | 7.92 | Guide to Pharmacology |
mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 7.92 | 7.92 | 7.92 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 8.17 | 8.17 | 8.17 | Guide to Pharmacology |
mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 8.17 | 8.17 | 8.17 | ChEMBL |