compound 23e [PMID: 17929793]
| SMILES | Clc1ccc(cc1)n1cnc2c(c1=O)sc1c2c2NCCOc2cn1 |
| InChIKey | FODONWGPMXPGNC-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 7 |
| Hydrogen bond donors | 1 |
| Rotatable bonds | 1 |
| Molecular weight (Da) | 370.0 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pKi | 8.82 | 8.82 | 8.82 | Guide to Pharmacology |
| mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pKi | 9.4 | 9.4 | 9.4 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 8.54 | 8.54 | 8.54 | Guide to Pharmacology |
| mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pIC50 | 8.54 | 8.54 | 8.54 | ChEMBL |