compound 24 [PMID: 16451050]
SMILES | O=C([C@H]1CCCN1Cc1ccccc1)NCCCN1CCC2(CC1)OCc1c2cccc1 |
InChIKey | MAKMQGKJURAJEN-RUZDIDTESA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 1 |
Rotatable bonds | 7 |
Molecular weight (Da) | 433.3 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Structure pdb | 4EA3 |
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
NOP | OPRX | Human | Opioid | A | pKi | 9.62 | 9.62 | 9.62 | Guide to Pharmacology |
NOP | OPRX | Human | Opioid | A | pKi | 9.62 | 9.62 | 9.62 | ChEMBL |
NOP | OPRX | Mouse | Opioid | A | pKd | 8.24 | 8.24 | 8.24 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
NOP | OPRX | Human | Opioid | A | pIC50 | 9.57 | 9.78 | 10.0 | Guide to Pharmacology |
κ | OPRK | Human | Opioid | A | pIC50 | 5.6 | 5.6 | 5.6 | ChEMBL |
μ | OPRM | Human | Opioid | A | pIC50 | 5.17 | 5.17 | 5.17 | ChEMBL |
NOP | OPRX | Human | Opioid | A | pIC50 | 9.57 | 9.7 | 9.82 | ChEMBL |