compound 3 [PMID: 21105727]
SMILES | O/N=C\1/c2ccccc2OC2(C1C2)C(=O)Nc1ccc(cc1)C |
InChIKey | VKCTUZKPBYSTDW-SILNSSARSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 2 |
Rotatable bonds | 2 |
Molecular weight (Da) | 308.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 6.22 | 6.22 | 6.22 | Guide to Pharmacology |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 6.22 | 6.22 | 6.22 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pIC50 | 5.82 | 5.82 | 5.82 | Guide to Pharmacology |
mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pEC50 | 5.1 | 5.1 | 5.1 | Guide to Pharmacology |
mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pEC50 | 5.05 | 5.05 | 5.05 | ChEMBL |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pIC50 | 5.82 | 5.82 | 5.82 | ChEMBL |