compound 46 [PMID: 25268943]
SMILES | NC(=N)NCCNC(=O)C1(CCN(CC1)Cc1ccccc1)Nc1ccccc1 |
InChIKey | SCPYAGLHLAAYFP-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 5 |
Rotatable bonds | 8 |
Molecular weight (Da) | 394.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
NPFF1 | NPFF1 | Human | Neuropeptide FF/neuropeptide AF | A | pKi | 7.09 | 7.09 | 7.09 | Guide to Pharmacology |
NPFF2 | NPFF2 | Human | Neuropeptide FF/neuropeptide AF | A | pKi | 5.85 | 5.85 | 5.85 | Guide to Pharmacology |
NPFF1 | NPFF1 | Human | Neuropeptide FF/neuropeptide AF | A | pKi | 7.09 | 7.09 | 7.09 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 6.65 | 6.65 | 6.65 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 6.7 | 6.7 | 6.7 | ChEMBL |
NPFF2 | NPFF2 | Human | Neuropeptide FF/neuropeptide AF | A | pKi | 5.85 | 5.85 | 5.85 | ChEMBL |
δ | OPRD | Human | Opioid | A | pKi | 5.6 | 5.6 | 5.6 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
NPFF1 | NPFF1 | Human | Neuropeptide FF/neuropeptide AF | A | pEC50 | 5.45 | 5.45 | 5.45 | ChEMBL |