farnesyl monophosphate
| SMILES | C/C(=C/CC/C(=C\COP(=O)(O)O)/C)/CCC=C(C)C |
| InChIKey | ALEWCKXBHSDCCT-FBXUGWQNSA-N |
Chemical properties
| Hydrogen bond acceptors | 2 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 9 |
| Molecular weight (Da) | 302.2 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Endogenous |
| Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| LPA3 | LPAR3 | Human | Lysophospholipid (LPA) | A | pKd | 7.32 | 7.32 | 7.32 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| LPA2 | LPAR2 | Human | Lysophospholipid (LPA) | A | pIC50 | 6.8 | 6.8 | 6.8 | Guide to Pharmacology |
| LPA3 | LPAR3 | Human | Lysophospholipid (LPA) | A | pIC50 | 6.3 | 6.3 | 6.3 | Guide to Pharmacology |
| LPA4 | LPAR4 | Human | Lysophospholipid (LPA) | A | pIC50 | 5.84 | 5.84 | 5.84 | Guide to Pharmacology |
| LPA5 | LPAR5 | Human | Lysophospholipid (LPA) | A | pEC50 | 7.31 | 7.31 | 7.31 | Guide to Pharmacology |