fenobam
| SMILES | O=C(NC1=NC(=O)CN1C)Nc1cccc(c1)Cl |
| InChIKey | DWPQODZAOSWNHB-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 3 |
| Hydrogen bond donors | 2 |
| Rotatable bonds | 1 |
| Molecular weight (Da) | 266.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | Yes |
Sankey plot
Compound is not listed as a drug.
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pKd | 7.5 | 7.5 | 7.5 | Guide to Pharmacology |
| mGlu1 | GRM1 | Human | Metabotropic glutamate | C | pKi | 8.17 | 8.17 | 8.17 | ChEMBL |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKi | 6.5 | 6.5 | 6.5 | ChEMBL |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pKi | 6.79 | 7.35 | 8.17 | ChEMBL |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKd | 7.3 | 7.3 | 7.3 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 7.2 | 7.2 | 7.2 | Guide to Pharmacology |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pIC50 | 6.34 | 6.81 | 7.29 | ChEMBL |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 6.48 | 7.24 | 7.44 | ChEMBL |