ICI-199441
SMILES | Clc1cc(ccc1Cl)CC(=O)N([C@H](CN1CCCC1)c1ccccc1)C |
InChIKey | AEJOEPSMZCEYJN-HXUWFJFHSA-N |
Chemical properties
Hydrogen bond acceptors | 2 |
Hydrogen bond donors | 0 |
Rotatable bonds | 6 |
Molecular weight (Da) | 390.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
μ | OPRM | Human | Opioid | A | pKi | 7.28 | 7.28 | 7.28 | Guide to Pharmacology |
δ | OPRD | Human | Opioid | A | pKi | 7.62 | 7.62 | 7.62 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 10.27 | 10.35 | 10.4 | ChEMBL |
μ | OPRM | Human | Opioid | A | pKi | 7.28 | 7.28 | 7.28 | ChEMBL |
κ | OPRK | Human | Opioid | A | pKi | 10.4 | 10.4 | 10.4 | Guide to Pharmacology |
UT | UR2R | Human | Urotensin | A | pKi | 5.4 | 5.4 | 5.4 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
κ | OPRK | Guinea pig | Opioid | A | pIC50 | 8.16 | 8.68 | 9.57 | ChEMBL |
δ | OPRD | Human | Opioid | A | pIC50 | 6.22 | 6.22 | 6.22 | ChEMBL |
κ | OPRK | Human | Opioid | A | pEC50 | 9.4 | 9.48 | 9.52 | ChEMBL |
TSH | TSHR | Human | Glycoprotein hormone | A | Potency | 4.5 | 4.5 | 4.5 | ChEMBL |
κ | OPRK | Mouse | Opioid | A | pIC50 | 8.6 | 8.6 | 8.6 | ChEMBL |