(S)-3,4-DCPG
SMILES | N[C@@H](c1ccc(c(c1)C(=O)O)C(=O)O)C(=O)O |
InChIKey | IJVMOGKBEVRBPP-ZETCQYMHSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 4 |
Rotatable bonds | 4 |
Molecular weight (Da) | 239.0 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pEC50 | 5.1 | 5.1 | 5.1 | Guide to Pharmacology |
mGlu6 | GRM6 | Human | Metabotropic glutamate | C | pEC50 | 5.4 | 5.4 | 5.4 | Guide to Pharmacology |
mGlu8 | GRM8 | Human | Metabotropic glutamate | C | pEC50 | 7.5 | 7.5 | 7.5 | Guide to Pharmacology |
mGlu6 | GRM6 | Rat | Metabotropic glutamate | C | pEC50 | 5.44 | 5.44 | 5.44 | ChEMBL |
mGlu8 | GRM8 | Rat | Metabotropic glutamate | C | pEC50 | 7.51 | 7.51 | 7.51 | ChEMBL |
mGlu8 | GRM8 | Human | Metabotropic glutamate | C | pEC50 | 7.36 | 7.5 | 7.64 | ChEMBL |
mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pEC50 | 5.06 | 5.06 | 5.06 | ChEMBL |
mGlu1 | GRM1 | Rat | Metabotropic glutamate | C | pEC50 | 4.5 | 4.5 | 4.5 | ChEMBL |
mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pEC50 | 5.5 | 5.61 | 5.71 | ChEMBL |
mGlu6 | GRM6 | Human | Metabotropic glutamate | C | pEC50 | 5.5 | 5.5 | 5.5 | ChEMBL |