L023103
SMILES | CN(CCCNC(=O)CCc1ccc(cc1)S(=O)(=O)N(c1ccc(cc1)Cl)CC(=O)NNC1=c2ccccc2=NC1=O)C |
InChIKey | BUKWNCANUKACAQ-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 7 |
Hydrogen bond donors | 3 |
Rotatable bonds | 14 |
Molecular weight (Da) | 624.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 9.2 | 9.2 | 9.2 | Guide to Pharmacology |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pKi | 9.2 | 9.2 | 9.2 | Guide to Pharmacology |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pKi | 9.17 | 9.17 | 9.17 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 9.19 | 9.19 | 9.19 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 9.17 | 9.17 | 9.17 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 7.38 | 8.29 | 9.19 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 7.4 | 7.4 | 7.4 | Guide to Pharmacology |
V1B | V1BR | Human | Vasopressin and oxytocin | A | pKi | 5.45 | 5.45 | 5.45 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Human | Vasopressin and oxytocin | A | pIC50 | 7.85 | 7.85 | 7.85 | ChEMBL |