L-368,899
SMILES | O=C([C@H](CCS(=O)(=O)C)N)N[C@H]1C[C@@H]2C([C@]1(CC2)CS(=O)(=O)N1CCN(CC1)c1ccccc1C)(C)C |
InChIKey | MWIASLNTAGRGGA-ZJPWWDJASA-N |
Chemical properties
Hydrogen bond acceptors | 7 |
Hydrogen bond donors | 2 |
Rotatable bonds | 9 |
Molecular weight (Da) | 554.3 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 8.1 | 8.1 | 8.1 | Guide to Pharmacology |
V1A | V1AR | Rat | Vasopressin and oxytocin | A | pKi | 6.96 | 6.96 | 6.96 | ChEMBL |
V2 | V2R | Rat | Vasopressin and oxytocin | A | pKi | 6.7 | 6.7 | 6.7 | ChEMBL |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pKi | 8.44 | 8.44 | 8.44 | ChEMBL |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 7.89 | 7.89 | 7.89 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 6.23 | 6.23 | 6.23 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 6.75 | 6.75 | 6.75 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
V1A | V1AR | Rat | Vasopressin and oxytocin | A | pIC50 | 6.43 | 6.43 | 6.43 | ChEMBL |
V2 | V2R | Rat | Vasopressin and oxytocin | A | pIC50 | 6.24 | 6.24 | 6.24 | ChEMBL |
OT | OXYR | Rat | Vasopressin and oxytocin | A | pIC50 | 8.05 | 8.05 | 8.05 | ChEMBL |