L-serine-O-phosphate
SMILES | OC(=O)[C@H](COP(=O)(O)O)N |
InChIKey | BZQFBWGGLXLEPQ-REOHCLBHSA-N |
Chemical properties
Hydrogen bond acceptors | 4 |
Hydrogen bond donors | 4 |
Rotatable bonds | 4 |
Molecular weight (Da) | 185.0 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Endogenous |
Approved drug | Yes |
Database connections
Structure pdb | 7E9H |
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu7 | GRM7 | Human | Metabotropic glutamate | C | pKi | 4.4 | 4.4 | 4.4 | Guide to Pharmacology |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pEC50 | 5.9 | 5.9 | 5.9 | Guide to Pharmacology |
mGlu6 | GRM6 | Human | Metabotropic glutamate | C | pEC50 | 6.4 | 6.4 | 6.4 | Guide to Pharmacology |
mGlu7 | GRM7 | Human | Metabotropic glutamate | C | pEC50 | 4.5 | 4.5 | 4.5 | Guide to Pharmacology |
mGlu8 | GRM8 | Human | Metabotropic glutamate | C | pIC50 | 6.2 | 6.7 | 7.2 | Guide to Pharmacology |
mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pIC50 | 5.4 | 5.8 | 6.2 | Guide to Pharmacology |
mGlu6 | GRM6 | Rat | Metabotropic glutamate | C | pEC50 | 5.57 | 5.57 | 5.57 | ChEMBL |
mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pEC50 | 5.4 | 5.4 | 5.4 | ChEMBL |
mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pEC50 | 5.89 | 5.95 | 6.0 | ChEMBL |
mGlu6 | GRM6 | Human | Metabotropic glutamate | C | pEC50 | 8.19 | 8.19 | 8.19 | Drug Central |
mGlu7 | GRM7 | Human | Metabotropic glutamate | C | pEC50 | 8.35 | 8.35 | 8.35 | Drug Central |
mGlu8 | GRM8 | Human | Metabotropic glutamate | C | pIC50 | 8.14 | 8.14 | 8.14 | Drug Central |
mGlu6 | GRM6 | Rat | Metabotropic glutamate | C | pEC50 | 8.25 | 8.25 | 8.25 | Drug Central |
mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pEC50 | 8.27 | 8.27 | 8.27 | Drug Central |
mGlu4 | GRM4 | Human | Metabotropic glutamate | C | pEC50 | 8.22 | 8.22 | 8.22 | Drug Central |