LTB4
SMILES | CCCCC/C=C\C[C@H](/C=C/C=C/C=C\[C@H](CCCC(=O)O)O)O |
InChIKey | VNYSSYRCGWBHLG-AMOLWHMGSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 3 |
Rotatable bonds | 14 |
Molecular weight (Da) | 336.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Endogenous |
Approved drug | Yes |
Database connections
Structure pdb | 7VKT |
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
BLT1 | LT4R1 | Human | Leukotriene | A | pKi | 9.4 | 9.4 | 9.4 | Guide to Pharmacology |
BLT2 | LT4R2 | Human | Leukotriene | A | pKd | 7.64 | 7.64 | 7.64 | Guide to Pharmacology |
BLT1 | LT4R1 | Human | Leukotriene | A | pKi | 8.54 | 9.29 | 9.92 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
BLT2 | LT4R2 | Human | Leukotriene | A | pIC50 | 7.6 | 7.6 | 7.6 | Guide to Pharmacology |
BLT2 | LT4R2 | Human | Leukotriene | A | pEC50 | 6.85 | 6.85 | 6.85 | Guide to Pharmacology |
BLT1 | LT4R1 | Human | Leukotriene | A | pIC50 | 7.5 | 8.31 | 8.72 | ChEMBL |