LY395756
SMILES | C[C@@H]1C[C@@]([C@H]2[C@@H]1[C@@H]2C(=O)O)(N)C(=O)O |
InChIKey | BQVZICWQBFTOJX-QNDZYWSYSA-N |
Chemical properties
Hydrogen bond acceptors | 3 |
Hydrogen bond donors | 3 |
Rotatable bonds | 2 |
Molecular weight (Da) | 199.1 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 6.78 | 6.78 | 6.78 | Guide to Pharmacology |
mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pKi | 6.52 | 6.52 | 6.52 | Guide to Pharmacology |
mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pKi | 6.24 | 6.38 | 6.52 | ChEMBL |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pKi | 6.39 | 6.58 | 6.78 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
mGlu6 | GRM6 | Human | Metabotropic glutamate | C | pEC50 | 5.12 | 5.12 | 5.12 | ChEMBL |
mGlu3 | GRM3 | Human | Metabotropic glutamate | C | pIC50 | 5.47 | 5.66 | 5.98 | ChEMBL |
mGlu2 | GRM2 | Human | Metabotropic glutamate | C | pEC50 | 6.4 | 6.8 | 7.2 | ChEMBL |