MAP4
| SMILES | OC(=O)[C@](CCP(=O)(O)O)(N)C |
| InChIKey | HONKEGXLWUDTCF-YFKPBYRVSA-N |
Chemical properties
| Hydrogen bond acceptors | 3 |
| Hydrogen bond donors | 4 |
| Rotatable bonds | 4 |
| Molecular weight (Da) | 197.0 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu4 | GRM4 | Rat | Metabotropic glutamate | C | pKi | 4.6 | 4.6 | 4.6 | Guide to Pharmacology |
| mGlu7 | GRM7 | Human | Metabotropic glutamate | C | pKi | 3.8 | 3.8 | 3.8 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu6 | GRM6 | Rat | Metabotropic glutamate | C | pIC50 | 3.5 | 3.5 | 3.5 | Guide to Pharmacology |
| mGlu8 | GRM8 | Rat | Metabotropic glutamate | C | pIC50 | 5.1 | 6.35 | 7.6 | Guide to Pharmacology |