methoxymethyl-MTEP
| SMILES | COCc1cncc(c1)C#Cc1csc(n1)C |
| InChIKey | AWDRAHDWMICWJM-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 0 |
| Rotatable bonds | 2 |
| Molecular weight (Da) | 244.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pKd | 7.7 | 7.7 | 7.7 | Guide to Pharmacology |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| mGlu5 | GRM5 | Rat | Metabotropic glutamate | C | pIC50 | 7.5 | 7.5 | 7.5 | Guide to Pharmacology |
| mGlu5 | GRM5 | Human | Metabotropic glutamate | C | pIC50 | 7.33 | 7.74 | 8.15 | ChEMBL |