morin
SMILES | Oc1ccc(c(c1)O)c1oc2cc(O)cc(c2c(=O)c1O)O |
InChIKey | YXOLAZRVSSWPPT-UHFFFAOYSA-N |
Chemical properties
Hydrogen bond acceptors | 7 |
Hydrogen bond donors | 5 |
Rotatable bonds | 1 |
Molecular weight (Da) | 302.0 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
A2A | AA2AR | Human | Adenosine | A | pKi | 4.8 | 4.8 | 4.8 | Guide to Pharmacology |
A1 | AA1R | Rat | Adenosine | A | pKi | 4.9 | 4.9 | 4.9 | Guide to Pharmacology |
A1 | AA1R | Rat | Adenosine | A | pKi | 4.86 | 4.86 | 4.86 | ChEMBL |
A3 | AA3R | Human | Adenosine | A | pKi | 4.47 | 4.47 | 4.47 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
GPR35 | GPR35 | Human | A orphans | A | pEC50 | 4.95 | 5.42 | 5.88 | ChEMBL |
GPR35 | GPR35 | Human | A orphans | A | pIC50 | 5.8 | 5.8 | 5.8 | ChEMBL |
M1 | ACM1 | Rat | Acetylcholine (muscarinic) | A | Potency | 7.7 | 7.7 | 7.7 | ChEMBL |