nelivaptan
SMILES | COc1cc(OC)ccc1S(=O)(=O)N1c2ccc(cc2[C@@](C1=O)(N1C[C@@H](C[C@H]1C(=O)N(C)C)O)c1ccccc1OC)Cl |
InChIKey | NJXZWIIMWNEOGJ-WEWKHQNJSA-N |
Chemical properties
Hydrogen bond acceptors | 9 |
Hydrogen bond donors | 1 |
Rotatable bonds | 8 |
Molecular weight (Da) | 629.2 |
Drug properties
Molecular type | Small molecule |
Physiological/Surrogate | Surrogate |
Approved drug | Yes |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 7.0 | 7.0 | 7.0 | Guide to Pharmacology |
V1B | V1BR | Human | Vasopressin and oxytocin | A | pKi | 8.4 | 8.85 | 9.3 | Guide to Pharmacology |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 6.8 | 7.8 | 8.8 | Guide to Pharmacology |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 6.49 | 6.51 | 6.54 | ChEMBL |
V1A | V1AR | Human | Vasopressin and oxytocin | A | pKi | 7.03 | 7.4 | 7.66 | ChEMBL |
V1B | V1BR | Human | Vasopressin and oxytocin | A | pKi | 7.23 | 8.61 | 9.22 | ChEMBL |
V2 | V2R | Human | Vasopressin and oxytocin | A | pKi | 5.9 | 5.9 | 5.9 | Guide to Pharmacology |
OT | OXYR | Human | Vasopressin and oxytocin | A | pKi | 7.6 | 7.96 | 8.82 | ChEMBL |
V1B | V1BR | Rat | Vasopressin and oxytocin | A | pKi | 9.0 | 9.0 | 9.0 | ChEMBL |
Receptor | Activity | Source | |||||||
---|---|---|---|---|---|---|---|---|---|
GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |