pamoic acid
| SMILES | OC(=O)c1cc2ccccc2c(c1O)Cc1c(O)c(cc2c1cccc2)C(=O)O |
| InChIKey | WLJNZVDCPSBLRP-UHFFFAOYSA-N |
Chemical properties
| Hydrogen bond acceptors | 4 |
| Hydrogen bond donors | 4 |
| Rotatable bonds | 4 |
| Molecular weight (Da) | 388.1 |
Drug properties
| Molecular type | Small molecule |
| Physiological/Surrogate | Surrogate |
| Approved drug | No |
Database connections
Sankey plot
Compound is not listed as a drug.
Bioactivities
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| GPR35 | GPR35 | Human | A orphans | A | pKi | 7.64 | 7.91 | 8.05 | ChEMBL |
| Receptor | Activity | Source | |||||||
|---|---|---|---|---|---|---|---|---|---|
| GTP | Uniprot | Species | Family | Class | Type | Min | Avg | Max | Database |
| GPR35 | GPR35 | Human | A orphans | A | pEC50 | 7.29 | 7.29 | 7.29 | Guide to Pharmacology |
| GPR35 | Q33BM1 | Rat | A orphans | A | pEC50 | 3.0 | 4.0 | 5.0 | Guide to Pharmacology |
| GPR35 | GPR35 | Human | A orphans | A | pEC50 | 5.92 | 7.37 | 8.7 | ChEMBL |