Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
[Phaa1,D-Tyr(Et)2,Lys6,des-Gly9]AVP | 3089 | None | 0 | Human | Binding | pKi | None | - | 7.50 | -31 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9322919 | |
[Phaa1,D-Tyr(Et)2,Val4,Lys6,Tyr-NH28,des-Gly9]AVP | 3090 | None | 0 | Human | Binding | pKi | None | - | 6.10 | -281 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9322919 | |
[Phaa1,D-Tyr(Me)2,Arg6,Tyr-NH29]AVP | 3091 | None | 0 | Human | Binding | pKi | None | - | 8.00 | -12 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9322919 | |
[Phaa1,D-Tyr2,Val4,Arg6,Arg-NH29]AVP | 3092 | None | 0 | Human | Binding | pKi | None | - | 7.80 | -25 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9322919 | |
[tBaa1,D-Tyr(Et)2,Val4,Lys6,Arg-NH28,des-Gly9]AVP | 3760 | None | 0 | Human | Binding | pKi | None | - | 6.40 | -501 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9322919 | |
[Val4]AVP | 3970 | None | 0 | Human | Binding | pKi | None | - | 9.00 | 3 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/12446593 | |
arginine vasotocin | 466 | None | 0 | Human | Binding | pKi | = | - | 8.00 | -25 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9322919 | |
Atosiban | 218972 | 3H-AVP | 0 | Human | Binding | pKi | = | 657.00 | 6.18 | -11 | 5 | - | PDSP KiDatabase | 993.4 | 18 | 11 | 15 | -3.04 | CCOc1ccc(CC2NC(=O)CCSSCC(C(=O)N3CCCC3C(=O)NC(CCCN)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(C(C)O)NC(=O)C(C(C)CC)NC2=O)cc1 | - | |
Atosiban | 218972 | None | 0 | Human | Binding | pKi | = | 7.36 | 8.13 | -11 | 5 | Binding affinity to human vasopressin V1b receptor | Drug Central | 993.4 | 18 | 11 | 15 | -3.04 | CCOc1ccc(CC2NC(=O)CCSSCC(C(=O)N3CCCC3C(=O)NC(CCCN)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(C(C)O)NC(=O)C(C(C)CC)NC2=O)cc1 | - | |
atosiban | 518 | None | 30 | Human | Binding | Ki | = | 44.00 | 7.36 | -114 | 5 | Binding affinity to human vasopressin V1b receptor | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1016/j.bmcl.2007.11.008 | |
atosiban | 518 | None | 30 | Human | Binding | pKi | None | - | 6.40 | -114 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/12660315 | |
atosiban | 518 | None | 30 | Human | Binding | pKi | None | - | 6.40 | -114 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/14722330 | |
AVP | 218566 | 3H-AVP | 0 | Human | Binding | pKi | = | 0.59 | 9.23 | -1 | 10 | - | PDSP KiDatabase | 1083.4 | 19 | 14 | 16 | -5.40 | NC(=O)CCC1NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccc(O)cc2)NC(=O)C(N)CSSCC(C(=O)N2CCCC2C(=O)NC(CCCN=C(N)N)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC1=O | - | |
AVP | 218566 | None | 0 | Human | Binding | pKi | = | 9.31 | 8.03 | -1 | 10 | Displacement of [3H]-AVP from human vasopressin V1b receptor expressed in CHO cells after 30 mins | Drug Central | 1083.4 | 19 | 14 | 16 | -5.40 | NC(=O)CCC1NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccc(O)cc2)NC(=O)C(N)CSSCC(C(=O)N2CCCC2C(=O)NC(CCCN=C(N)N)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC1=O | - | |
AVP | 218566 | 3H-AVP | 0 | Rat | Binding | pKi | = | 0.23 | 9.64 | 1 | 10 | - | PDSP KiDatabase | 1083.4 | 19 | 14 | 16 | -5.40 | NC(=O)CCC1NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccc(O)cc2)NC(=O)C(N)CSSCC(C(=O)N2CCCC2C(=O)NC(CCCN=C(N)N)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC1=O | - | |
AVP | 218566 | None | 0 | Rat | Binding | pKi | = | 9.54 | 8.02 | 1 | 10 | Displacement of [3H]AVP from rat vasopressin V1b receptor expressed in At-T20 cells | Drug Central | 1083.4 | 19 | 14 | 16 | -5.40 | NC(=O)CCC1NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccc(O)cc2)NC(=O)C(N)CSSCC(C(=O)N2CCCC2C(=O)NC(CCCN=C(N)N)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC1=O | - | |
CHEMBL1161978 | 10319 | None | 0 | Human | Binding | Ki | = | 100.00 | 7.00 | -1122 | 3 | Displacement of [3H]AVP from human vasopressin V1b receptor expressed in CHO cells | ChEMBL | 2057.7 | 46 | 18 | 25 | 6.04 | CC1CC(C)(C)Nc2c1cc1c(c2S(=O)(=O)O)OC2C(=C1c1c(Cl)c(SCC(=O)NCCCCCC(=O)N(C(=O)[C@H]3CCN(C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cc4ccccc4)NC(=O)[C@@H](Cc4ccc(O)cc4)N(C)C(=O)CCc4ccc(O)cc4)C3)[C@@H](CCCCN)C(N)=O)c(Cl)c(Cl)c1C(=O)O)CC1C(=NC(C)(C)CC1C)C2S(=O)(=O)O | https://dx.doi.org/10.1021/jm061404q | |
CHEMBL1223631 | 16030 | None | 0 | Human | Binding | IC50 | = | 22000.00 | 4.66 | - | 1 | Displacement of [3H]AVP from human vasopresin3 receptor expressed in CHO cells | ChEMBL | 475.3 | 9 | 1 | 7 | 2.22 | CN1CCN(CCOc2ccc3nc(-c4ccccc4)n(CC(=O)NCC4CC4)c(=O)c3c2)CC1 | https://dx.doi.org/10.1016/j.bmcl.2010.07.118 | |
CHEMBL1223632 | 16031 | None | 0 | Human | Binding | IC50 | = | 1700.00 | 5.77 | - | 1 | Displacement of [3H]AVP from human vasopresin3 receptor expressed in CHO cells | ChEMBL | 489.3 | 10 | 1 | 7 | 2.61 | CN1CCN(CCCOc2ccc3nc(-c4ccccc4)n(CC(=O)NCC4CC4)c(=O)c3c2)CC1 | https://dx.doi.org/10.1016/j.bmcl.2010.07.118 | |
CHEMBL1223633 | 16032 | None | 0 | Human | Binding | IC50 | = | 4800.00 | 5.32 | - | 1 | Displacement of [3H]AVP from human vasopresin3 receptor expressed in CHO cells | ChEMBL | 503.3 | 11 | 1 | 7 | 3.00 | CN1CCN(CCCCOc2ccc3nc(-c4ccccc4)n(CC(=O)NCC4CC4)c(=O)c3c2)CC1 | https://dx.doi.org/10.1016/j.bmcl.2010.07.118 |
Showing 1 to 20 of 476 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
carbetocin | 797 | None | 33 | Human | Functional | EC50 | = | 27000.00 | 4.57 | -57 | 5 | Agonist activity at human V1b receptor expressed in HEK293FT cells assessed as stimulation of calcium release by Aequorin based assay | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(OC)cc2)NC(=O)CCCSC[C@@H](C(=O)N2CCC[C@H]2C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O | https://dx.doi.org/10.1021/acs.jmedchem.8b00697 | |
CHEMBL1221422 | 15594 | None | 0 | Human | Functional | IC50 | = | 316.23 | 6.50 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 471.2 | 8 | 1 | 7 | 3.21 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2nc(OCCN3CCCCC3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1221425 | 15596 | None | 0 | Human | Functional | IC50 | = | 12.59 | 7.90 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 455.2 | 5 | 1 | 6 | 3.09 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(N3CCCN(C)CC3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222462 | 15718 | None | 0 | Human | Functional | IC50 | = | 199.53 | 6.70 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 478.3 | 10 | 1 | 7 | 3.31 | COc1cccc(-c2cn3cc(OCCCN4CCCCC4)cc3c(=O)n2CC(=O)NC2CC2)c1 | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222463 | 15719 | None | 0 | Human | Functional | IC50 | = | 398.11 | 6.40 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 520.2 | 10 | 1 | 7 | 3.71 | COc1cccc(-c2cn3cc(OCCCN4CCCCC4)cc3c(=O)n2CC(=O)NCC(F)(F)F)c1 | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222464 | 15720 | None | 0 | Human | Functional | IC50 | = | 1000.00 | 6.00 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 499.2 | 10 | 1 | 7 | 3.99 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2nc(OCCCCN3CCCCC3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222546 | 15734 | None | 0 | Human | Functional | IC50 | = | 10.00 | 8.00 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 502.2 | 9 | 1 | 6 | 4.15 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(OCCCN3CCCC(F)C3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222547 | 15735 | None | 0 | Human | Functional | IC50 | = | 6.31 | 8.20 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 538.2 | 9 | 1 | 6 | 4.60 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(OCCCN3CCC(C(F)(F)F)C3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222548 | 15736 | None | 0 | Human | Functional | IC50 | = | 6.31 | 8.20 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 552.2 | 9 | 1 | 6 | 4.99 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(OCCCN3CCC(C(F)(F)F)CC3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222549 | 15737 | None | 0 | Human | Functional | IC50 | = | 63.10 | 7.20 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 525.3 | 9 | 1 | 7 | 3.50 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(OCCCN3CCN4CCC[C@H]4C3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222619 | 15747 | None | 0 | Human | Functional | IC50 | = | 199.53 | 6.70 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 525.3 | 9 | 1 | 7 | 3.50 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(OCCCN3CCN4CCC[C@@H]4C3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222620 | 15748 | None | 0 | Human | Functional | IC50 | = | 199.53 | 6.70 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 442.2 | 6 | 2 | 6 | 3.08 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(OC3CCNCC3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222621 | 15749 | None | 0 | Human | Functional | IC50 | = | 63.10 | 7.20 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 456.2 | 6 | 1 | 6 | 3.42 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(OC3CCN(C)CC3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222622 | 15750 | None | 0 | Human | Functional | IC50 | = | 63.10 | 7.20 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 484.2 | 7 | 1 | 6 | 4.20 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(OC3CCN(C(C)C)CC3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222688 | 15762 | None | 0 | Human | Functional | IC50 | = | 5.01 | 8.30 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 510.2 | 7 | 1 | 6 | 4.73 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(OC3CCN(C4CCCC4)CC3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222689 | 15763 | None | 0 | Human | Functional | IC50 | = | 1258.93 | 5.90 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 470.2 | 7 | 1 | 6 | 3.67 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(OCC3CCN(C)CC3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222690 | 15765 | None | 0 | Human | Functional | IC50 | = | 1258.93 | 5.90 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 484.2 | 8 | 1 | 6 | 4.06 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(OCCC3CCN(C)CC3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222691 | 15766 | None | 0 | Human | Functional | IC50 | = | 630.96 | 6.20 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 484.2 | 8 | 1 | 6 | 4.20 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(OCCC3CCCCN3C)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222759 | 15780 | None | 0 | Human | Functional | IC50 | = | 501.19 | 6.30 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 470.2 | 7 | 1 | 6 | 3.67 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(OCC3CCCN(C)C3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 | |
CHEMBL1222760 | 15781 | None | 0 | Human | Functional | IC50 | = | 251.19 | 6.60 | - | 1 | Antagonist activity at human vasopressin 1b receptor expressed in CHO cells assessed as inhibition of vasopressin-induced intracellular calcium mobilization by FLPR assay | ChEMBL | 441.2 | 5 | 1 | 6 | 2.70 | CC(C)NC(=O)Cn1c(-c2cccc(Cl)c2)cn2cc(N3CCN(C)CC3)cc2c1=O | https://dx.doi.org/10.1016/j.bmcl.2010.07.037 |
Showing 1 to 20 of 248 entries