Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
AZD5069 | 548 | None | 40 | Human | Binding | pIC50 | = | - | 9.10 | 1 | 2 | Measuring displacement of CXCL8 binding to recombinant CXCR2 in HEK cell membrane preparations. | Guide to Pharmacology | 476.1 | 10 | 3 | 8 | 1.53 | C[C@@H](Oc1cc(NS(=O)(=O)N2CCC2)nc(SCc2cccc(F)c2F)n1)[C@@H](O)CO | https://pubmed.ncbi.nlm.nih.gov/25736418 | |
AZD5069 | 548 | None | 40 | Human | Binding | Ki | = | 0.25 | 9.61 | 1 | 2 | Binding affinity to NanoLuc fused Snap CXCR2 (unknown origin) expressed in HEK293 cell membrane assessed as inhibition constant using furimazine as substrate incubated with substrate for 5 mins and measured every 15 secs for 60 mins by luminescence based NanoBRET fluorescent binding assay | ChEMBL | 476.1 | 10 | 3 | 8 | 1.53 | C[C@@H](Oc1cc(NS(=O)(=O)N2CCC2)nc(SCc2cccc(F)c2F)n1)[C@@H](O)CO | https://dx.doi.org/10.1021/acs.jmedchem.3c00849 | |
CHEMBL1162935 | 10414 | None | 0 | Human | Binding | IC50 | = | 17.00 | 7.77 | - | 2 | Displacement of [125I]hCXCL8 from human CXCR2 receptor expressed in BaF3 cells | ChEMBL | 379.2 | 6 | 3 | 6 | 2.61 | C[C@@H](Nc1c(Nc2cccc(C(=O)N(C)C)c2O)c(=O)c1=O)c1ccccc1 | https://dx.doi.org/10.1021/jm0609622 | |
CHEMBL1162935 | 10414 | None | 0 | Human | Binding | Ki | = | 8.71 | 8.06 | - | 2 | Binding affinity to NanoLuc fused Snap CXCR2 (unknown origin) expressed in HEK293 cell membrane assessed as inhibition constant using furimazine as substrate incubated with substrate for 5 mins and measured every 15 secs for 60 mins by luminescence based NanoBRET fluorescent binding assay | ChEMBL | 379.2 | 6 | 3 | 6 | 2.61 | C[C@@H](Nc1c(Nc2cccc(C(=O)N(C)C)c2O)c(=O)c1=O)c1ccccc1 | https://dx.doi.org/10.1021/acs.jmedchem.3c00849 | |
CHEMBL1182441 | 11881 | None | 0 | Human | Binding | IC50 | = | 8.00 | 8.10 | - | 1 | Displacement of [125I]IL8 from human recombinant CXCR2 expressed in CHO cells | ChEMBL | 532.2 | 9 | 3 | 8 | 3.41 | CCCc1ccccc1Nc1c(Nc2ccc(Cl)c(S(=O)(=O)N3CCN(CC)CC3)c2O)c(=O)c1=O | https://dx.doi.org/10.1016/j.bmcl.2006.12.067 | |
CHEMBL1182475 | 11900 | None | 0 | Human | Binding | IC50 | = | 13.00 | 7.89 | - | 1 | Displacement of [125I]IL8 from human recombinant CXCR2 expressed in CHO cells | ChEMBL | 538.0 | 6 | 3 | 8 | 2.31 | CN1CCN(S(=O)(=O)c2c(F)ccc(Nc3c(Nc4ccccc4Br)c(=O)c3=O)c2O)CC1 | https://dx.doi.org/10.1016/j.bmcl.2006.12.067 | |
CHEMBL1182492 | 11906 | None | 0 | Human | Binding | IC50 | = | 44.00 | 7.36 | - | 1 | Displacement of [125I]IL8 from human recombinant CXCR2 expressed in CHO cells | ChEMBL | 420.2 | 5 | 3 | 7 | 2.25 | CN1CCCN(C(=O)c2cccc(Nc3c(Nc4ccccc4)c(=O)c3=O)c2O)CC1 | https://dx.doi.org/10.1016/j.bmcl.2006.12.067 | |
CHEMBL1185146 | 12326 | None | 0 | Human | Binding | IC50 | = | 27.00 | 7.57 | - | 1 | Displacement of [125I]IL8 from human recombinant CXCR2 expressed in CHO cells | ChEMBL | 406.2 | 5 | 3 | 7 | 1.86 | CN1CCN(C(=O)c2cccc(Nc3c(Nc4ccccc4)c(=O)c3=O)c2O)CC1 | https://dx.doi.org/10.1016/j.bmcl.2006.12.067 | |
CHEMBL1188250 | 12814 | None | 0 | Human | Binding | IC50 | = | 114.00 | 6.94 | - | 2 | Concentration required to inhibit [125I]IL-8 binding towards C-X-C chemokine receptor type 2 of human expressed in CHO cells | ChEMBL | 369.0 | 3 | 4 | 3 | 3.91 | NCc1c(Cl)ccc(NC(=O)Nc2ccccc2Br)c1O | https://dx.doi.org/10.1016/j.bmcl.2004.06.097 | |
CHEMBL1188821 | 12887 | None | 0 | Human | Binding | IC50 | = | 20.00 | 7.70 | - | 1 | Displacement of [125I]IL8 from human recombinant CXCR2 expressed in CHO cells | ChEMBL | 524.1 | 6 | 3 | 8 | 3.11 | CN1CCCN(S(=O)(=O)c2c(Cl)ccc(Nc3c(Nc4ccccc4Cl)c(=O)c3=O)c2O)CC1 | https://dx.doi.org/10.1016/j.bmcl.2006.12.067 | |
CHEMBL1188997 | 12909 | None | 0 | Human | Binding | IC50 | = | 18.00 | 7.75 | - | 1 | Displacement of [125I]IL8 from human recombinant CXCR2 expressed in CHO cells | ChEMBL | 544.2 | 7 | 3 | 8 | 3.77 | O=c1c(Nc2ccccc2)c(Nc2ccc(Cl)c(S(=O)(=O)N3CCC(N4CCCCC4)CC3)c2O)c1=O | https://dx.doi.org/10.1016/j.bmcl.2006.12.067 | |
CHEMBL1196279 | 13908 | None | 0 | Human | Binding | IC50 | = | 10.00 | 8.00 | - | 1 | Displacement of [125I]IL8 from human recombinant CXCR2 expressed in CHO cells | ChEMBL | 568.0 | 6 | 3 | 8 | 3.22 | CN1CCCN(S(=O)(=O)c2c(Cl)ccc(Nc3c(Nc4ccccc4Br)c(=O)c3=O)c2O)CC1 | https://dx.doi.org/10.1016/j.bmcl.2006.12.067 | |
CHEMBL1417864 | 33212 | None | 12 | Human | Binding | IC50 | = | 7600.00 | 5.12 | - | 1 | Antagonist activity at CXCR2 (unknown origin) expressed in human U2OS cells cp-expressing betaarrestin-2/TEV protease and beta lactamase assessed as effect on beta-arrestin2 recruitment preincubated for 30 mins followed by IL-8 addition and further incubated for 5 hrs subsequently adding CCF4-AM staining and measured after 2 hrs by Tango assay | ChEMBL | 435.1 | 4 | 1 | 4 | 6.20 | CC(=O)c1c(C)oc2c1cc(NS(=O)(=O)c1ccc(C(C)(C)C)cc1)c1ccccc12 | https://dx.doi.org/10.1016/j.ejmech.2019.111853 | |
CHEMBL1437942 | 35431 | None | 19 | Human | Binding | IC50 | = | 2000.00 | 5.70 | - | 1 | Displacement of [125I]GRO-alpha from human recombinant CXCR2 receptor expressed in CHO cells | ChEMBL | 271.1 | 3 | 1 | 5 | 3.04 | Cc1cc2nc(CSc3ccccc3)cc(O)n2n1 | https://dx.doi.org/10.1016/j.bmcl.2013.11.074 | |
CHEMBL183222 | 65607 | None | 0 | Human | Binding | IC50 | = | 12.00 | 7.92 | - | 2 | Concentration required to inhibit [125I]IL-8 binding towards C-X-C chemokine receptor type 2 of human expressed in CHO cells | ChEMBL | 447.0 | 4 | 3 | 4 | 3.70 | CN(C)S(=O)(=O)c1c(Cl)ccc(NC(=O)Nc2ccccc2Br)c1O | https://dx.doi.org/10.1016/j.bmcl.2004.06.097 | |
CHEMBL184147 | 66167 | None | 0 | Human | Binding | IC50 | = | 906.00 | 6.04 | - | 1 | Concentration required to inhibit [125I]IL-8 binding towards C-X-C chemokine receptor type 2 of human expressed in CHO cells | ChEMBL | 340.0 | 2 | 3 | 2 | 4.45 | O=C(Nc1ccc(Cl)cc1O)Nc1ccccc1Br | https://dx.doi.org/10.1016/j.bmcl.2004.06.097 | |
CHEMBL184185 | 66171 | None | 1 | Human | Binding | IC50 | = | 10.00 | 8.00 | - | 2 | Concentration required to inhibit [125I]IL-8 binding towards C-X-C chemokine receptor type 2 of human expressed in CHO cells | ChEMBL | 383.0 | 3 | 4 | 3 | 3.55 | NC(=O)c1c(Cl)ccc(NC(=O)Nc2ccccc2Br)c1O | https://dx.doi.org/10.1016/j.bmcl.2004.06.097 | |
CHEMBL185259 | 66612 | None | 0 | Human | Binding | IC50 | = | 63.00 | 7.20 | - | 2 | Concentration required to inhibit [125I]IL-8 binding towards C-X-C chemokine receptor type 2 of human expressed in CHO cells | ChEMBL | 373.9 | 2 | 3 | 2 | 5.11 | O=C(Nc1ccccc1Br)Nc1ccc(Cl)c(Cl)c1O | https://dx.doi.org/10.1016/j.bmcl.2004.06.097 | |
CHEMBL195433 | 71140 | None | 6 | Human | Binding | IC50 | = | 10000.00 | 5.00 | - | 7 | Inhibition of C-X-C chemokine receptor type 2 | ChEMBL | 486.2 | 7 | 2 | 5 | 5.43 | CC(=O)c1sc(NC(=O)N[C@@H]2CCCC[C@H]2CN2CCC[C@@H](Cc3ccc(F)cc3)C2)nc1C | https://dx.doi.org/10.1021/jm049530m | |
CHEMBL201204 | 73255 | None | 0 | Human | Binding | IC50 | = | 1400.00 | 5.85 | - | 1 | Displacement of [125I]IL8 from human recombinant CXCR2 expressed in HEK293 membranes by SPA | ChEMBL | 453.1 | 9 | 3 | 9 | 4.94 | CC[C@@H](CO)Nc1nc(SCc2cccc(Oc3ccccc3)c2)nc2nc(N)sc12 | https://dx.doi.org/10.1016/j.bmcl.2005.10.091 |
Showing 1 to 20 of 1,020 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
AZD5069 | 548 | None | 40 | Human | Functional | IC50 | = | 3.20 | 8.49 | 77 | 2 | Antagonist activity at CXCR2 (unknown origin) | ChEMBL | 476.1 | 10 | 3 | 8 | 1.53 | C[C@@H](Oc1cc(NS(=O)(=O)N2CCC2)nc(SCc2cccc(F)c2F)n1)[C@@H](O)CO | https://dx.doi.org/10.1016/j.ejmech.2023.115175 | |
CHEMBL1417864 | 33212 | None | 12 | Human | Functional | IC50 | = | 7600.00 | 5.12 | - | 1 | Antagonist activity at CXCL8-activated CXCR2 (unknown origin) overexpressed in human U2OS cells preincubated for 30 mins followed by CXCL8 addition measured after 5 hrs by beta-lactamase reporter gene assay | ChEMBL | 435.1 | 4 | 1 | 4 | 6.20 | CC(=O)c1c(C)oc2c1cc(NS(=O)(=O)c1ccc(C(C)(C)C)cc1)c1ccccc12 | https://dx.doi.org/10.1016/j.ejmech.2023.115175 | |
CHEMBL1437942 | 35431 | None | 19 | Human | Functional | IC50 | = | 10300.00 | 4.99 | - | 1 | Antagonist activity at human recombinant CXCR2 receptor expressed in CHO cells assessed as inhibition of IL8-induced [35S]GTPgammaS binding by SPA method | ChEMBL | 271.1 | 3 | 1 | 5 | 3.04 | Cc1cc2nc(CSc3ccccc3)cc(O)n2n1 | https://dx.doi.org/10.1016/j.bmcl.2013.11.074 | |
CHEMBL1445650 | 36280 | None | 44 | Human | Functional | IC50 | = | 400.00 | 6.40 | 9 | 4 | Antagonist activity at CXCL8-activated CXCR2 (unknown origin) overexpressed in human U2OS cells preincubated for 30 mins followed by CXCL8 addition measured after 5 hrs by beta-lactamase reporter gene assay | ChEMBL | 328.1 | 4 | 1 | 4 | 3.35 | COc1cc(NS(=O)(=O)c2ccc(C)cc2)c2ncccc2c1 | https://dx.doi.org/10.1016/j.ejmech.2023.115175 | |
CHEMBL211468 | 79640 | None | 0 | Human | Functional | IC50 | = | 26.00 | 7.58 | - | 1 | Inhibition of chemotaxis of CHO cells expressing human CXCR2 | ChEMBL | 351.1 | 3 | 3 | 6 | 1.85 | CN(C)C(=O)c1cccc(/N=c2\c(O)c(O)\c2=N/c2ccccc2)c1O | https://dx.doi.org/10.1016/j.bmcl.2006.04.082 | |
CHEMBL214047 | 80326 | None | 0 | Human | Functional | IC50 | = | 19.10 | 7.72 | - | 1 | Inhibition of chemotaxis of CHO cells expressing human CXCR2 | ChEMBL | 345.2 | 5 | 3 | 6 | 1.70 | CCC(CC)/N=c1\c(O)c(O)\c1=N/c1cccc(C(=O)N(C)C)c1O | https://dx.doi.org/10.1016/j.bmcl.2006.04.082 | |
CHEMBL214162 | 80345 | None | 0 | Human | Functional | IC50 | = | 144.80 | 6.84 | - | 1 | Inhibition of chemotaxis of CHO cells expressing human CXCR2 | ChEMBL | 343.2 | 3 | 3 | 6 | 1.46 | CN(C)C(=O)c1cccc(/N=c2\c(O)c(O)\c2=N/C2CCCC2)c1O | https://dx.doi.org/10.1016/j.bmcl.2006.04.082 | |
CHEMBL216602 | 82143 | None | 0 | Human | Functional | IC50 | = | 2.40 | 8.62 | 218 | 2 | Inhibition of CXCL1-induced human neutrophil chemotaxis | ChEMBL | 383.1 | 6 | 3 | 7 | 2.51 | Cc1ccc([C@@H](C)Nc2c(Nc3cccc(C(=O)N(C)C)c3O)c(=O)c2=O)o1 | https://dx.doi.org/10.1021/jm0609622 | |
CHEMBL231924 | 86765 | None | 0 | Human | Functional | IC50 | = | 1100.00 | 5.96 | 40 | 2 | Antagonist activity at CXCR2 receptor expressed in CHOK1 cells assessed as human IL8-induced calcium mobilization by FLIPR | ChEMBL | 368.0 | 2 | 3 | 7 | 2.54 | O=[N+]([O-])c1cc(O)c2c(c1)S(=O)(=O)N=C(Nc1ccccc1Cl)N2 | https://dx.doi.org/10.1016/j.bmcl.2007.05.011 | |
CHEMBL233346 | 87422 | None | 0 | Human | Functional | IC50 | = | 320.00 | 6.50 | 151 | 2 | Antagonist activity at CXCR2 receptor expressed in CHOK1 cells assessed as human IL8-induced calcium mobilization by FLIPR | ChEMBL | 415.0 | 3 | 3 | 6 | 4.42 | O=S1(=O)N=C(Nc2ccccc2Oc2ccccc2)Nc2c(O)cc(Cl)cc21 | https://dx.doi.org/10.1016/j.bmcl.2007.05.011 | |
CHEMBL234186 | 88005 | None | 0 | Human | Functional | IC50 | = | 520.00 | 6.28 | 109 | 2 | Antagonist activity at CXCR2 receptor expressed in CHOK1 cells assessed as human IL8-induced calcium mobilization by FLIPR | ChEMBL | 357.0 | 1 | 3 | 5 | 3.28 | O=S1(=O)N=C(Nc2ccccc2Cl)Nc2c(O)cc(Cl)cc21 | https://dx.doi.org/10.1016/j.bmcl.2007.05.011 | |
CHEMBL254370 | 94993 | None | 0 | Human | Functional | IC50 | = | 48.00 | 7.32 | 2 | 2 | Inhibition of CXCL1-induced human neutrophil chemotaxis | ChEMBL | 393.2 | 7 | 3 | 6 | 3.00 | CC[C@@H](Nc1c(Nc2cccc(C(=O)N(C)C)c2O)c(=O)c1=O)c1ccccc1 | https://dx.doi.org/10.1021/jm0609622 | |
CHEMBL254773 | 95047 | None | 0 | Human | Functional | IC50 | = | 4.00 | 8.40 | 77 | 2 | Antagonist activity at human cloned CXCR2 by calcium flux FLIPR assay | ChEMBL | 515.0 | 6 | 3 | 3 | 4.97 | O=C(NCCc1c(-c2ccc(F)cc2)[nH]c2ccc(Br)cc12)NS(=O)(=O)c1ccccc1 | https://dx.doi.org/10.1016/j.bmcl.2008.01.127 | |
CHEMBL254773 | 95047 | None | 0 | Rabbit | Functional | IC50 | = | 1700.00 | 5.77 | -77 | 2 | Antagonist activity at rabbit CXCR2 by neutrophil chemotaxis assay | ChEMBL | 515.0 | 6 | 3 | 3 | 4.97 | O=C(NCCc1c(-c2ccc(F)cc2)[nH]c2ccc(Br)cc12)NS(=O)(=O)c1ccccc1 | https://dx.doi.org/10.1016/j.bmcl.2008.01.127 | |
CHEMBL257178 | 95520 | None | 0 | Human | Functional | IC50 | = | 70.00 | 7.16 | 38 | 2 | Antagonist activity at human cloned CXCR2 by calcium flux FLIPR assay | ChEMBL | 453.1 | 6 | 2 | 4 | 4.13 | N#Cc1ccc2[nH]c(-c3ccc(F)cc3)c(CCCC(=O)NS(=O)(=O)C(F)(F)F)c2c1 | https://dx.doi.org/10.1016/j.bmcl.2008.01.127 | |
CHEMBL257178 | 95520 | None | 0 | Rabbit | Functional | IC50 | = | 3000.00 | 5.52 | -38 | 2 | Antagonist activity at rabbit CXCR2 by neutrophil chemotaxis assay | ChEMBL | 453.1 | 6 | 2 | 4 | 4.13 | N#Cc1ccc2[nH]c(-c3ccc(F)cc3)c(CCCC(=O)NS(=O)(=O)C(F)(F)F)c2c1 | https://dx.doi.org/10.1016/j.bmcl.2008.01.127 | |
CHEMBL257829 | 95666 | None | 0 | Human | Functional | IC50 | = | 14.00 | 7.85 | 30 | 2 | Antagonist activity at human cloned CXCR2 by calcium flux FLIPR assay | ChEMBL | 414.1 | 7 | 3 | 4 | 2.75 | CNS(=O)(=O)NC(=O)CCCc1c(-c2ccc(F)cc2)[nH]c2ccc(C#N)cc12 | https://dx.doi.org/10.1016/j.bmcl.2008.01.127 | |
CHEMBL257829 | 95666 | None | 0 | Rabbit | Functional | IC50 | = | 1300.00 | 5.89 | -30 | 2 | Antagonist activity at rabbit CXCR2 by neutrophil chemotaxis assay | ChEMBL | 414.1 | 7 | 3 | 4 | 2.75 | CNS(=O)(=O)NC(=O)CCCc1c(-c2ccc(F)cc2)[nH]c2ccc(C#N)cc12 | https://dx.doi.org/10.1016/j.bmcl.2008.01.127 | |
CHEMBL309253 | 103979 | None | 0 | Human | Functional | IC50 | = | 48.00 | 7.32 | - | 1 | Antagonist activity at CXCR2 in human neutrophils assessed as reduction in GROalpha stimulated intracellular calcium mobilisation by FLIPR assay | ChEMBL | 335.0 | 3 | 1 | 4 | 4.59 | Sc1nc(-c2ccccc2Cl)nn1Cc1cccc(Cl)c1 | https://dx.doi.org/10.1016/j.ejmech.2019.111853 | |
CHEMBL3102879 | 104443 | None | 2 | Human | Functional | IC50 | = | 1500.00 | 5.82 | - | 1 | Antagonist activity at human recombinant CXCR2 receptor expressed in CHO cells assessed as inhibition of IL8-induced [35S]GTPgammaS binding by SPA method | ChEMBL | 308.1 | 3 | 1 | 6 | 2.71 | Cc1nc2nc(CSc3cccc(F)c3F)cc(O)n2n1 | https://dx.doi.org/10.1016/j.bmcl.2013.11.074 |
Showing 1 to 20 of 321 entries