Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CHEMBL5315516 | 194743 | None | 0 | Human | Binding | IC50 | = | 251.19 | 6.60 | - | 2 | Antagonist activity at CXCR5 (unknown origin) | ChEMBL | 481.3 | 6 | 1 | 2 | 6.47 | C[N+](C)(Cc1ccc(NC(=O)C2=Cc3cc(-c4ccccc4)ccc3CCC2)cc1)C1CCOCC1 | https://dx.doi.org/10.1021/acs.jmedchem.5b01337 | |
| CXCL13 | 1249 | None | 0 | Human | Binding | pKd | = | - | 7.30 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/22913878 | |
Showing 1 to 2 of 2 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CHEMBL1309871 | 20819 | None | 2 | Human | Functional | IC50 | = | 12695.00 | 4.90 | 1 | 3 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 382.1 | 4 | 2 | 4 | 3.61 | O=C(NNC(=O)c1cc(-c2ccccc2)nn1-c1ccccc1)c1ccccc1 | - | |
| CHEMBL1359342 | 26401 | None | 12 | Human | Functional | IC50 | = | 26323.00 | 4.58 | - | 1 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 411.1 | 4 | 0 | 5 | 5.62 | CN1CCc2nc(SCc3ccc(Cl)cc3)c(C#N)c(-c3cccs3)c2C1 | - | |
| CHEMBL1366012 | 27165 | None | 7 | Human | Functional | IC50 | = | 11136.00 | 4.95 | -1 | 3 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 386.0 | 3 | 3 | 4 | 4.74 | Cc1ccc(O)c(NC(=S)NC(=O)c2ccc(-c3ccc(Cl)cc3)o2)c1 | - | |
| CHEMBL1382003 | 29197 | None | 2 | Human | Functional | IC50 | = | 21895.00 | 4.66 | -1 | 3 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 439.1 | 6 | 0 | 6 | 5.21 | Cc1sc2nc(SCCN(C)C)n(-c3ccccc3)c(=O)c2c1-c1ccc(F)cc1 | - | |
| CHEMBL1382320 | 29233 | None | 9 | Human | Functional | IC50 | = | 7002.00 | 5.16 | 1 | 4 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 443.1 | 6 | 1 | 6 | 2.99 | O=C(CSc1cccc2cccnc12)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 | - | |
| CHEMBL1406895 | 31862 | None | 4 | Human | Functional | IC50 | = | 12964.00 | 4.89 | -1 | 3 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 436.0 | 3 | 1 | 5 | 3.32 | COC(=O)C1=NN(C(=O)c2cccc(Br)c2)C(O)(c2ccc(Cl)cc2)C1 | - | |
| CHEMBL1431608 | 34856 | None | 22 | Human | Functional | IC50 | = | 11706.00 | 4.93 | 1 | 3 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 278.0 | 3 | 0 | 5 | 2.13 | Cc1ccc(S(=O)(=O)c2ccc([N+](=O)[O-])cn2)cc1 | - | |
| CHEMBL1437683 | 35396 | None | 6 | Human | Functional | IC50 | = | 9374.00 | 5.03 | 1 | 3 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 332.0 | 3 | 0 | 5 | 2.84 | O=[N+]([O-])c1ccc(S(=O)(=O)c2cccc(C(F)(F)F)c2)nc1 | - | |
| CHEMBL1443778 | 36076 | None | 8 | Human | Functional | IC50 | = | 9239.00 | 5.03 | -1 | 3 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 334.1 | 1 | 2 | 5 | 1.18 | CN1C(=O)C(=C2CC(c3ccc(Cl)cc3)NN2)C(=O)N(C)C1=O | - | |
| CHEMBL1470485 | 39275 | None | 8 | Human | Functional | IC50 | = | 52701.00 | 4.28 | -8 | 2 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 347.1 | 3 | 1 | 4 | 2.16 | O=C1C2C3C=CC(CO)(O3)C2C(=O)N1c1ccccc1-c1ccccc1 | - | |
| CHEMBL1477528 | 39899 | None | 8 | Human | Functional | IC50 | = | 14171.00 | 4.85 | 1 | 3 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 419.1 | 5 | 1 | 5 | 3.80 | Cc1ccccc1CS(=O)(=O)c1ncc(Cl)c(C(=O)Nc2ccc(F)cc2)n1 | - | |
| CHEMBL1522544 | 44879 | None | 12 | Human | Functional | IC50 | = | 24253.00 | 4.62 | - | 1 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 351.2 | 5 | 0 | 3 | 4.29 | Cc1cccc2c1N(CCCOc1ccc(C(C)(C)C)cc1)C(=O)C2=O | - | |
| CHEMBL1524932 | 45125 | None | 6 | Human | Functional | IC50 | = | 16122.00 | 4.79 | -1 | 4 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 386.2 | 5 | 1 | 7 | 3.76 | COCCCn1c(N)c(-c2nc3ccccc3n2C)c2nc3ccccc3nc21 | - | |
| CHEMBL1557648 | 48676 | None | 4 | Human | Functional | IC50 | = | 17308.00 | 4.76 | -2 | 4 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 299.0 | 3 | 1 | 4 | 3.64 | O=C(Nc1nnc(-c2ccccc2)o1)c1ccc(Cl)cc1 | - | |
| CHEMBL1875956 | 67175 | None | 27 | Human | Functional | IC50 | = | 9456.00 | 5.02 | -1 | 3 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 1130.6 | 14 | 13 | 23 | -1.32 | C/C=C(\C)C(=O)OC1[C@H](OC(C)=O)C2(CO)C(CC1(C)C)C1=CCC3C4(C)CCC(O[C@@H]5O[C@H](C(=O)O)[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)[C@H](O)[C@H]5O[C@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@](C)(CO)C4CCC3(C)[C@]1(C)C[C@H]2O | - | |
| CHEMBL1892026 | 67492 | None | 6 | Human | Functional | IC50 | = | 14634.00 | 4.83 | -3 | 3 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 277.1 | 3 | 2 | 4 | 3.78 | C/C(=N\Nc1ccc2ccccc2n1)c1ccccc1O | - | |
| CHEMBL1904956 | 67655 | None | 3 | Human | Functional | IC50 | = | 25168.00 | 4.60 | -1 | 3 | PUBCHEM_BIOASSAY: SAR analysis counterscreen of small molecule antagonists of the CCR6 receptor using a CXCR5 receptor luminescent beta-arrestin assay. (Class of assay: confirmatory) [Related pubchem assays (depositor defined):AID493098, AID493121, AID493159, AID540334] | ChEMBL | 339.2 | 3 | 1 | 5 | 2.67 | CC(C)(C)c1ccc2c(c1)OC(C(=O)N/N=C\c1ccccn1)CO2 | - | |
| CHEMBL3714900 | 133732 | None | 0 | Human | Functional | IC50 | = | 19600.00 | 4.71 | - | 1 | Antagonist activity against human CXCR5 expressed in RBL cells assessed as inhibition of human CXCL13-induced intracellular Ca2+ level by fluo-4/AM dye based FLIPR assay | ChEMBL | 375.1 | 5 | 2 | 3 | 3.59 | CCOc1ccc2ccccc2c1C(=O)NC1(C(=O)O)Cc2ccccc2C1 | - | |
| CHEMBL3714964 | 133752 | None | 0 | Human | Functional | IC50 | = | 10150.00 | 4.99 | - | 1 | Antagonist activity against human CXCR5 expressed in RBL cells assessed as inhibition of human CXCL13-induced intracellular Ca2+ level by fluo-4/AM dye based FLIPR assay | ChEMBL | 390.2 | 5 | 2 | 4 | 3.15 | Cc1cccc(C(=O)NC2(C(=O)O)Cc3ccc(C#N)cc3C2)c1OC1CCC1 | - | |
| CHEMBL3714985 | 133757 | None | 0 | Human | Functional | IC50 | = | 7800.00 | 5.11 | - | 1 | Antagonist activity against human CXCR5 expressed in RBL cells assessed as inhibition of human CXCL13-induced intracellular Ca2+ level by fluo-4/AM dye based FLIPR assay | ChEMBL | 433.1 | 5 | 2 | 3 | 4.30 | Cc1cccc(C(=O)NC2(C(=O)O)Cc3ccc(C(F)(F)F)cc3C2)c1OC1CCC1 | - | |
Showing 1 to 20 of 76 entries