Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL1407777 | 31994 | None | 8 | Human | Binding | IC50 | = | 10000.00 | 5.00 | - | 2 | Displacement of [125I]SDF-1alpha from CXCR7 (unknown origin) expressed in CHO cells after 1 hr by TopCount scintillation counting analysis | ChEMBL | 392.2 | 2 | 1 | 5 | 3.46 | CCN1CCc2nc3sc(C(=O)N4CCc5ccccc5C4)c(N)c3cc2C1 | https://dx.doi.org/10.1021/jm400307y | |
CHEMBL1430708 | 34755 | None | 2 | Human | Binding | IC50 | = | 2780.00 | 5.56 | - | 1 | Displacement of [125I]SDF-1alpha from CXCR7 (unknown origin) expressed in CHO cells after 1 hr by TopCount scintillation counting analysis | ChEMBL | 476.2 | 10 | 1 | 6 | 4.90 | CCC(C(=O)NCCCN(CC)Cc1ccccc1)n1nc(C)c2sc3ccccc3c2c1=O | https://dx.doi.org/10.1021/jm400307y | |
CHEMBL1570388 | 50153 | None | 5 | Human | Binding | IC50 | = | 2210.00 | 5.66 | - | 1 | Displacement of [125I]SDF-1alpha from CXCR7 (unknown origin) expressed in CHO cells after 1 hr by TopCount scintillation counting analysis | ChEMBL | 419.2 | 7 | 1 | 5 | 4.00 | CN(CCCNC(=O)c1cc2c(=O)n(C)c3ccccc3c2s1)Cc1ccccc1 | https://dx.doi.org/10.1021/jm400307y | |
CHEMBL1729831 | 59902 | None | 6 | Human | Binding | IC50 | = | 1490.00 | 5.83 | - | 1 | Displacement of [125I]SDF-1alpha from CXCR7 (unknown origin) expressed in CHO cells after 1 hr by TopCount scintillation counting analysis | ChEMBL | 420.2 | 6 | 1 | 5 | 3.57 | Cc1cc(OCC(=O)NC2CCN(Cc3ccccc3)CC2)c2c(C)cc(=O)oc2c1 | https://dx.doi.org/10.1021/jm400307y | |
CHEMBL2010828 | 73074 | None | 0 | Human | Binding | Ki | = | 1258.93 | 5.90 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 470.3 | 10 | 0 | 5 | 4.88 | COc1ccc(/C=C(\C)CN(CCC2CCCN2C)C(=O)c2ccc(OC)c(OC)c2)c(F)c1 | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013212 | 73359 | None | 0 | Human | Binding | Ki | = | 398.11 | 6.40 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 468.3 | 11 | 0 | 6 | 3.98 | COc1cc(C(=O)N(CCCN2CCOCC2)C/C(C)=C/c2ccccc2)cc(OC)c1OC | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013213 | 73360 | None | 0 | Human | Binding | Ki | = | 1584.89 | 5.80 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 399.2 | 10 | 1 | 5 | 3.64 | COc1cc(C(=O)N(CCCO)C/C(C)=C/c2ccccc2)cc(OC)c1OC | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013214 | 73361 | None | 0 | Human | Binding | Ki | = | 199.53 | 6.70 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 480.3 | 11 | 0 | 5 | 5.52 | COc1cc(C(=O)N(CCCN2CCCCC2C)C/C(C)=C/c2ccccc2)cc(OC)c1OC | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013215 | 73362 | None | 0 | Human | Binding | Ki | = | 15.85 | 7.80 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 452.3 | 10 | 0 | 5 | 4.74 | COc1cc(C(=O)N(CCC2CCCN2C)C/C(C)=C/c2ccccc2)cc(OC)c1OC | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013216 | 73363 | None | 0 | Human | Binding | Ki | = | 12.59 | 7.90 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 452.3 | 10 | 0 | 5 | 4.74 | COc1cc(C(=O)N(C/C=C(\C)c2ccccc2)CCC2CCCN2C)cc(OC)c1OC | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013217 | 73364 | None | 0 | Human | Binding | Ki | = | 794.33 | 6.10 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 438.3 | 10 | 0 | 5 | 4.35 | COc1cc(C(=O)N(C/C=C/c2ccccc2)CCC2CCCN2C)cc(OC)c1OC | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013218 | 73365 | None | 0 | Human | Binding | Ki | = | 1258.93 | 5.90 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 422.3 | 9 | 0 | 4 | 4.73 | COc1ccc(C(=O)N(CCC2CCCN2C)C/C(C)=C/c2ccccc2)c(OC)c1 | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013219 | 73366 | None | 0 | Human | Binding | Ki | = | 25.12 | 7.60 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 422.3 | 9 | 0 | 4 | 4.73 | COc1ccc(C(=O)N(CCC2CCCN2C)C/C(C)=C/c2ccccc2)cc1OC | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013220 | 73367 | None | 0 | Human | Binding | Ki | = | 794.33 | 6.10 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 406.3 | 8 | 0 | 3 | 5.03 | COc1ccc(C(=O)N(CCC2CCCN2C)C/C(C)=C/c2ccccc2)cc1C | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013221 | 73368 | None | 0 | Human | Binding | Ki | = | 794.33 | 6.10 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 420.2 | 7 | 0 | 4 | 4.49 | C/C(=C\c1ccccc1)CN(CCC1CCCN1C)C(=O)c1ccc2c(c1)OCCO2 | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013221 | 73368 | None | 0 | Human | Binding | Ki | = | 10000.00 | 5.00 | - | 1 | Binding affinity to NanoLuc tagged human wild type ACKR3 expressed in HEK293G cells using furimazine as NanoLuc substrate preincubated for 1 hr in dark in presence of (R)-N-(3-(2-fluorophenyl)-2methylallyl)-3,4,5-trimethoxyN-(2-(1-methylpyrrolidin-2yl)ethyl)benzamide followed by substrate addition and measured after 5 mins by NanoBRET competition binding assay | ChEMBL | 420.2 | 7 | 0 | 4 | 4.49 | C/C(=C\c1ccccc1)CN(CCC1CCCN1C)C(=O)c1ccc2c(c1)OCCO2 | https://dx.doi.org/10.1021/acsmedchemlett.3c00469 | |
CHEMBL2013222 | 73369 | None | 0 | Human | Binding | Ki | = | 31.62 | 7.50 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 488.2 | 10 | 0 | 5 | 5.02 | COc1cc(C(=O)N(CCC2CCCN2C)C/C(C)=C/c2ccc(F)cc2F)cc(OC)c1OC | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013223 | 73370 | None | 0 | Human | Binding | Ki | = | 100.00 | 7.00 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 458.2 | 9 | 0 | 4 | 5.01 | COc1ccc(C(=O)N(CCC2CCCN2C)C/C(C)=C/c2ccc(F)cc2F)cc1OC | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013224 | 73371 | None | 0 | Human | Binding | Ki | = | 50.12 | 7.30 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 470.3 | 10 | 0 | 5 | 4.88 | COc1cc(C(=O)N(CCC2CCCN2C)C/C(C)=C/c2ccc(F)cc2)cc(OC)c1OC | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 | |
CHEMBL2013225 | 73372 | None | 0 | Human | Binding | Ki | = | 79.43 | 7.10 | - | 1 | Displacement of [125I]-CXCL12 from human CXCR7 expressed in HEK293 cells after 3 hrs | ChEMBL | 440.2 | 9 | 0 | 4 | 4.87 | COc1ccc(C(=O)N(CCC2CCCN2C)C/C(C)=C/c2ccc(F)cc2)cc1OC | https://dx.doi.org/10.1016/j.ejmech.2012.02.041 |
Showing 1 to 20 of 922 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |