Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
BAY-899 | 171240 | None | 17 | Human | Binding | IC50 | = | 185.00 | 6.73 | - | 4 | Cell-based assay (LH Antagonism) | ChEMBL | 459.2 | 4 | 1 | 5 | 5.12 | O=C(Nc1cnc(Oc2ccc(F)cc2)nc1)N1CCc2ncccc2[C@@H]1c1ccc(F)cc1 | https://dx.doi.org/10.6019/CHEMBL4507317 | |
BAY-899 | 171240 | None | 17 | Human | Binding | IC50 | = | 185.00 | 6.73 | - | 4 | Affinity On-target Cellular interaction (Cell-based assay (LH Antagonism)) EUB0000240b LHCGR | ChEMBL | 459.2 | 4 | 1 | 5 | 5.12 | O=C(Nc1cnc(Oc2ccc(F)cc2)nc1)N1CCc2ncccc2[C@@H]1c1ccc(F)cc1 | https://dx.doi.org/10.6019/CHEMBL5210121 | |
buserelin | 744 | None | 0 | Human | Binding | pKd | = | 8.57 | 8.07 | -57 | 3 | None | Drug Central | - | - | - | - | - | - | - | |
CHEMBL12282 | 16338 | None | 0 | Rat | Binding | Kd | = | 0.48 | 9.32 | -1 | 2 | In vitro binding ability against Luteinizing hormone-releasing hormone release in rat pituitary cells | ChEMBL | 937.5 | 11 | 1 | 14 | 6.78 | CC[C@H]1OC(=O)[C@H](C)[C@@H](OC(=O)N2C(=O)OC[C@@H]2C)[C@H](C)[C@@H](OC2O[C@H](C)C[C@H](N(C)CC3CC3)[C@H]2O)[C@@](C)(OC)C[C@@H](C)C(=O)[C@H](C)[C@H]2N(CCc3ccc(F)c(Cl)c3)C(=O)O[C@]12C | https://dx.doi.org/10.1021/jm030418i | |
CHEMBL211405 | 79562 | None | 27 | Human | Binding | EC50 | = | 220.00 | 6.66 | - | 2 | Agonist activity at LHCGR (unknown origin) | ChEMBL | 402.1 | 4 | 2 | 7 | 4.20 | COc1cccc(-c2nc(SC)nc3sc(C(=O)NC(C)(C)C)c(N)c23)c1 | https://dx.doi.org/10.1039/c1md00145k | |
CHEMBL216617 | 82146 | None | 0 | Rat | Binding | Ki | = | 0.28 | 9.55 | - | 1 | In vitro binding affinity for Luteinizing hormone releasing hormone receptor from rat pituitary cells, expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | 1040.5 | 26 | 10 | 10 | 2.76 | CCNC(=O)C1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccc2ccccc2c1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)CCc1cccc2ccccc12 | https://dx.doi.org/10.1021/jm00130a019 | |
CHEMBL217405 | 82454 | None | 0 | Rat | Binding | Ki | = | 2.19 | 8.66 | - | 1 | Negative logarithm of equilibrium dissociation constant in the rat pituitary luteinizing releasing hormone receptor binding assay | ChEMBL | 1218.7 | 32 | 14 | 13 | -0.16 | CCNC(=O)[C@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCC(=O)N1 | https://dx.doi.org/10.1021/jm00099a017 | |
CHEMBL2369780 | 89400 | None | 0 | Rat | Binding | Ki | = | 123.03 | 6.91 | - | 1 | In vitro binding affinity towards Luteinizing hormone receptor from rat pituitary cells is expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | 959.6 | 27 | 11 | 10 | 1.13 | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)CCCc1c[nH]c2ccccc12 | https://dx.doi.org/10.1021/jm00130a019 | |
CHEMBL2369781 | 89401 | None | 0 | Rat | Binding | Ki | = | 758.58 | 6.12 | - | 1 | In vitro binding affinity towards Luteinizing hormone receptor from rat pituitary cells is expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | 928.5 | 24 | 10 | 10 | 1.09 | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)c1cccc2ccccc12 | https://dx.doi.org/10.1021/jm00130a019 | |
CHEMBL2369783 | 89402 | None | 0 | Rat | Binding | Ki | = | 1621.81 | 5.79 | - | 1 | In vitro binding affinity towards Luteinizing hormone receptor from rat pituitary cells is expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | 907.5 | 26 | 10 | 11 | -0.35 | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)CCc1cccnc1 | https://dx.doi.org/10.1021/jm00130a019 | |
CHEMBL2369784 | 89403 | None | 0 | Rat | Binding | Ki | = | 194.98 | 6.71 | - | 1 | In vitro binding affinity for Luteinizing hormone releasing hormone receptor from rat pituitary cells, expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | 945.5 | 26 | 11 | 10 | 0.74 | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)CCc1c[nH]c2ccccc12 | https://dx.doi.org/10.1021/jm00130a019 | |
CHEMBL2369787 | 212146 | None | 0 | Rat | Binding | Ki | = | 1.41 | 8.85 | - | 1 | In vitro binding affinity for Luteinizing hormone releasing hormone receptor from rat pituitary cells, expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | - | - | - | - | - | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)/C=C\c1ccc(OC)cc1 | https://dx.doi.org/10.1021/jm00130a019 | |
CHEMBL2369788 | 212147 | None | 0 | Rat | Binding | Ki | = | 4.57 | 8.34 | - | 1 | In vitro binding affinity for Luteinizing hormone releasing hormone receptor from rat pituitary cells, expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | - | - | - | - | - | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)CCc1c[nH]c2ccccc12 | https://dx.doi.org/10.1021/jm00130a019 | |
CHEMBL2369789 | 89405 | None | 0 | Rat | Binding | Ki | = | 67.61 | 7.17 | - | 1 | In vitro binding affinity for Luteinizing hormone releasing hormone receptor from rat pituitary cells, expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | 942.5 | 25 | 10 | 10 | 1.02 | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)Cc1cccc2ccccc12 | https://dx.doi.org/10.1021/jm00130a019 | |
CHEMBL2369790 | 89407 | None | 0 | Rat | Binding | Ki | = | 1348.96 | 5.87 | - | 1 | In vitro binding affinity for Luteinizing hormone releasing hormone receptor from rat pituitary cells, expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | 931.5 | 25 | 11 | 10 | 0.35 | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)Cc1c[nH]c2ccccc12 | https://dx.doi.org/10.1021/jm00130a019 | |
CHEMBL2369791 | 89408 | None | 0 | Rat | Binding | Ki | = | 204.17 | 6.69 | - | 1 | In vitro binding affinity for Luteinizing hormone releasing hormone receptor from rat pituitary cells, expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | 917.5 | 24 | 11 | 10 | 0.42 | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)c1c[nH]c2ccccc12 | https://dx.doi.org/10.1021/jm00130a019 | |
CHEMBL2369793 | 212148 | None | 0 | Rat | Binding | Ki | = | 158.49 | 6.80 | - | 1 | In vitro binding affinity for Luteinizing hormone releasing hormone receptor from rat pituitary cells, expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | - | - | - | - | - | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)/C=C/c1ccc(OC)cc1 | https://dx.doi.org/10.1021/jm00130a019 | |
CHEMBL2369794 | 89409 | None | 0 | Rat | Binding | Ki | = | 85.11 | 7.07 | 10 | 2 | In vitro binding affinity for Luteinizing hormone releasing hormone receptor from rat pituitary cells, expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | 960.6 | 26 | 12 | 11 | -0.33 | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)Cc1c[nH]c2ccccc12 | https://dx.doi.org/10.1021/jm00130a019 | |
CHEMBL2369798 | 212149 | None | 0 | Rat | Binding | Ki | = | 3.71 | 8.43 | - | 1 | In vitro binding affinity for Luteinizing hormone releasing hormone receptor from rat pituitary cells, expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | - | - | - | - | - | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)Cc1ccc2ccccc2c1 | https://dx.doi.org/10.1021/jm00130a019 | |
CHEMBL2369799 | 89410 | None | 0 | Rat | Binding | Ki | = | 36.31 | 7.44 | - | 1 | In vitro binding affinity for Luteinizing hormone releasing hormone receptor from rat pituitary cells, expressed as negative logarithm of the equilibrium dissociation constant | ChEMBL | 982.6 | 25 | 10 | 10 | 1.94 | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC1CCCCC1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)Cc1cccc2ccccc12 | https://dx.doi.org/10.1021/jm00130a019 |
Showing 1 to 20 of 71 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
BAY-899 | 171240 | None | 17 | Human | Functional | IC50 | = | 185.00 | 6.73 | -4 | 4 | Antagonist activity at human luteinizing hormone receptor assessed as reduction in agonist-induced cAMP production preincubated for 20 mins followed by agonist solution addition after 60 mins by cell based TR-FRET assay | ChEMBL | 459.2 | 4 | 1 | 5 | 5.12 | O=C(Nc1cnc(Oc2ccc(F)cc2)nc1)N1CCc2ncccc2[C@@H]1c1ccc(F)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.9b01382 | |
BAY-899 | 171240 | None | 17 | Rat | Functional | IC50 | = | 46.00 | 7.34 | 4 | 4 | Antagonist activity at rat luteinizing hormone receptor expressed in rat ovary granulosa GLHR15 cell suspension assessed as reduction in agonist-induced cAMP production preincubated for 30 mins followed by agonist solution addition after 30 mins by cell based TR-FRET assay | ChEMBL | 459.2 | 4 | 1 | 5 | 5.12 | O=C(Nc1cnc(Oc2ccc(F)cc2)nc1)N1CCc2ncccc2[C@@H]1c1ccc(F)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.9b01382 | |
CHEMBL1651721 | 57382 | None | 0 | Human | Functional | EC50 | = | 1.00 | 9.00 | 125 | 2 | Agonist activity at human LH receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 482.2 | 7 | 4 | 8 | 3.35 | C#CCNC(=O)CNc1cccc(-c2nc(SC)nc3sc(C(=O)NC(C)(C)C)c(N)c23)c1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651723 | 57384 | None | 0 | Human | Functional | EC50 | = | 10.00 | 8.00 | - | 1 | Agonist activity at human LH receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 1136.5 | 18 | 5 | 17 | 10.14 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCn4cc(COc5ccc([C@@]6(C)CC(C)(C)N(C(C)=O)c7ccc(NC(=O)c8ccc(-c9ccccc9)cc8)cc76)cc5)nn4)nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651821 | 57393 | None | 0 | Human | Functional | EC50 | = | 75.00 | 7.12 | - | 1 | Agonist activity at human LH receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 1224.5 | 24 | 5 | 19 | 10.18 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCn4cc(COc5ccc([C@]6(C)CC(C)(C)N(C(C)=O)c7ccc(NC(=O)c8ccc(-c9ccccc9)cc8)cc76)cc5)nn4)nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651822 | 57394 | None | 0 | Human | Functional | EC50 | = | 57.00 | 7.24 | - | 1 | Agonist activity at human LH receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 1268.5 | 27 | 5 | 20 | 10.19 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCOCCn4cc(COc5ccc([C@]6(C)CC(C)(C)N(C(C)=O)c7ccc(NC(=O)c8ccc(-c9ccccc9)cc8)cc76)cc5)nn4)nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651823 | 57395 | None | 0 | Human | Functional | EC50 | = | 27.00 | 7.57 | - | 1 | Agonist activity at human LH receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 1180.5 | 21 | 5 | 18 | 10.16 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCn4cc(COc5ccc([C@@]6(C)CC(C)(C)N(C(C)=O)c7ccc(NC(=O)c8ccc(-c9ccccc9)cc8)cc76)cc5)nn4)nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651824 | 57396 | None | 0 | Human | Functional | EC50 | = | 43.00 | 7.37 | 21 | 2 | Agonist activity at human LH receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 1224.5 | 24 | 5 | 19 | 10.18 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCn4cc(COc5ccc([C@@]6(C)CC(C)(C)N(C(C)=O)c7ccc(NC(=O)c8ccc(-c9ccccc9)cc8)cc76)cc5)nn4)nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651825 | 57397 | None | 0 | Human | Functional | EC50 | = | 61.00 | 7.21 | 26 | 2 | Agonist activity at human LH receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 1268.5 | 27 | 5 | 20 | 10.19 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCOCCn4cc(COc5ccc([C@@]6(C)CC(C)(C)N(C(C)=O)c7ccc(NC(=O)c8ccc(-c9ccccc9)cc8)cc76)cc5)nn4)nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651826 | 57398 | None | 0 | Human | Functional | EC50 | = | 55.00 | 7.26 | 18 | 2 | Agonist activity at human LH receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 1312.6 | 30 | 5 | 21 | 10.21 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCOCCOCCn4cc(COc5ccc([C@@]6(C)CC(C)(C)N(C(C)=O)c7ccc(NC(=O)c8ccc(-c9ccccc9)cc8)cc76)cc5)nn4)nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651828 | 57400 | None | 0 | Human | Functional | EC50 | = | 5.00 | 8.30 | 79 | 2 | Agonist activity at human LH receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 682.3 | 17 | 4 | 14 | 3.85 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCN=[N+]=[N-])nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651829 | 57401 | None | 0 | Human | Functional | EC50 | = | 24.00 | 7.62 | - | 1 | Agonist activity at human LH receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 1136.5 | 18 | 5 | 17 | 10.14 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCn4cc(COc5ccc([C@]6(C)CC(C)(C)N(C(C)=O)c7ccc(NC(=O)c8ccc(-c9ccccc9)cc8)cc76)cc5)nn4)nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651830 | 57403 | None | 0 | Human | Functional | EC50 | = | 80.00 | 7.10 | - | 1 | Agonist activity at human LH receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 1180.5 | 21 | 5 | 18 | 10.16 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCn4cc(COc5ccc([C@]6(C)CC(C)(C)N(C(C)=O)c7ccc(NC(=O)c8ccc(-c9ccccc9)cc8)cc76)cc5)nn4)nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651831 | 57404 | None | 0 | Human | Functional | EC50 | = | 39.00 | 7.41 | - | 1 | Agonist activity at human LH receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 1312.6 | 30 | 5 | 21 | 10.21 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCOCCOCCn4cc(COc5ccc([C@]6(C)CC(C)(C)N(C(C)=O)c7ccc(NC(=O)c8ccc(-c9ccccc9)cc8)cc76)cc5)nn4)nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL2032175 | 74979 | None | 0 | Human | Functional | IC50 | = | 95.00 | 7.02 | - | 1 | Antagonist activity at human luteinizing hormone receptor assessed as reduction in agonist-induced cAMP production preincubated for 20 mins followed by agonist solution addition after 60 mins by cell based TR-FRET assay | ChEMBL | 368.1 | 2 | 1 | 2 | 5.58 | O=C(Nc1ccccc1)N1CCc2sccc2C1c1ccc(Cl)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.9b01382 | |
CHEMBL211129 | 78447 | None | 0 | Human | Functional | EC50 | = | 1500.00 | 5.82 | - | 1 | Agonist activity at LHCGR expressed in HEK293 EM cells measured by intracellular cAMP accumulation | ChEMBL | 420.1 | 4 | 2 | 7 | 4.34 | COc1cccc(-c2nc(SC)nc3sc(C(=O)NC(C)(C)C)c(N)c23)c1F | https://dx.doi.org/10.1021/jm060247s | |
CHEMBL211405 | 79562 | None | 27 | Human | Functional | EC50 | = | 300.00 | 6.52 | 27 | 2 | Agonist activity at LHCGR expressed in HEK293 EM cells measured by intracellular cAMP accumulation | ChEMBL | 402.1 | 4 | 2 | 7 | 4.20 | COc1cccc(-c2nc(SC)nc3sc(C(=O)NC(C)(C)C)c(N)c23)c1 | https://dx.doi.org/10.1021/jm060247s | |
CHEMBL211871 | 79810 | None | 0 | Human | Functional | EC50 | = | 1100.00 | 5.96 | - | 1 | Agonist activity at LHCGR expressed in HEK293 EM cells measured by intracellular cAMP accumulation | ChEMBL | 403.1 | 4 | 1 | 8 | 4.63 | COc1cccc(-c2nc(SC)nc3sc(C(=O)OC(C)(C)C)c(N)c23)c1 | https://dx.doi.org/10.1021/jm060247s | |
CHEMBL212815 | 80039 | None | 0 | Human | Functional | EC50 | = | 1200.00 | 5.92 | - | 1 | Agonist activity at LHCGR expressed in HEK293 EM cells measured by intracellular cAMP accumulation | ChEMBL | 390.1 | 3 | 2 | 6 | 4.33 | CSc1nc(-c2cccc(F)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/jm060247s | |
CHEMBL216617 | 82146 | None | 0 | Rat | Functional | Kd | = | 0.56 | 9.25 | - | 1 | Luteinizing hormone inhibiting potency in rats is expressed as negative logarithm of the concentration (antagonist) | ChEMBL | 1040.5 | 26 | 10 | 10 | 2.76 | CCNC(=O)C1CCCN1C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc1ccc2ccccc2c1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)CCc1cccc2ccccc12 | https://dx.doi.org/10.1021/jm00130a019 |
Showing 1 to 20 of 91 entries