Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
ATP | 520 | None | 42 | Human | Binding | pKd | = | - | 6.20 | 257 | 10 | Unclassified | Guide to Pharmacology | 507.0 | 8 | 7 | 14 | -1.63 | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O | https://pubmed.ncbi.nlm.nih.gov/10779375 | |
ATP | 520 | None | 42 | Human | Binding | pKi | = | 6.20 | 8.21 | 257 | 10 | GRAC: human P2Y4 selective antagonist | Drug Central | 507.0 | 8 | 7 | 14 | -1.63 | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O | - | |
ATP | 520 | None | 42 | Human | Binding | EC50 | = | 6200.00 | 5.21 | 257 | 10 | Antagonist activity at human P2Y4 | ChEMBL | 507.0 | 8 | 7 | 14 | -1.63 | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O | https://dx.doi.org/10.1021/acs.jmedchem.5b01972 | |
ATP | 520 | None | 42 | Rat | Binding | EC50 | = | 1170.00 | 5.93 | - | 10 | Antagonist activity at rat P2Y4 | ChEMBL | 507.0 | 8 | 7 | 14 | -1.63 | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O | https://dx.doi.org/10.1021/acs.jmedchem.5b01972 | |
CHEMBL3261379 | 110981 | None | 0 | Human | Binding | EC50 | = | 93.00 | 7.03 | - | 3 | Agonist activity at human P2Y4 receptor expressed in human 1321N1 cells by functional assay | ChEMBL | 923.1 | 19 | 10 | 22 | -2.08 | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cc/c(=N/OCCCc5ccccc5)[nH]c4=O)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)c(=O)[nH]1 | https://dx.doi.org/10.1021/jm500367e | |
CHEMBL3261380 | 110982 | None | 0 | Human | Binding | EC50 | = | 1330.00 | 5.88 | - | 1 | Agonist activity at human P2Y4 receptor expressed in human 1321N1 cells by functional assay | ChEMBL | 1056.2 | 24 | 10 | 23 | 0.02 | O=c1[nH]/c(=N\OCCCc2ccccc2)ccn1[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cc/c(=N/OCCCc4ccccc4)[nH]c3=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@H]1O | https://dx.doi.org/10.1021/jm500367e | |
reactive blue-2 | 3296 | None | 17 | Rat | Binding | EC50 | = | 6430.00 | 5.19 | - | 10 | Antagonist activity at rat P2Y4 transfected in xenopus oocyte cell | ChEMBL | 773.0 | 9 | 7 | 15 | 3.85 | Nc1c(S(=O)(=O)O)cc(Nc2ccc(Nc3nc(Cl)nc(Nc4cccc(S(=O)(=O)O)c4)n3)c(S(=O)(=O)O)c2)c2c1C(=O)c1ccccc1C2=O | https://dx.doi.org/10.1021/acs.jmedchem.5b01972 | |
UTP | 3966 | None | 29 | Human | Binding | EC50 | = | 550.00 | 6.26 | - | 9 | Agonist activity at human P2Y4 transfected in human 1321N1 cells | ChEMBL | 484.0 | 8 | 7 | 12 | -2.50 | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)[nH]1 | https://dx.doi.org/10.1021/acs.jmedchem.5b01972 |
Showing 1 to 8 of 8 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |