Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CHEMBL3262876 | 111106 | None | 14 | Human | Binding | IC50 | = | 5.30 | 8.28 | - | 2 | Antagonist activity at EBI2 receptor in human U937 cells assessed as inhibition of 7-alpha,25-OHC-induced cell migration after 3 hrs by flow cytometric analysis | ChEMBL | 388.2 | 5 | 0 | 3 | 3.13 | O=C(COc1ccc2ccccc2c1)N1CCN(C(=O)Cc2ccccc2)CC1 | https://dx.doi.org/10.1021/jm4019355 | |
| CHEMBL3262876 | 111106 | None | 14 | Human | Binding | IC50 | = | 4.90 | 8.31 | - | 2 | Antagonist activity at EBI2 receptor in human U937 cells assessed as inhibition of 7-alpha,25-OHC-induced cell migration after 3 hrs by flow cytometric analysis | ChEMBL | 388.2 | 5 | 0 | 3 | 3.13 | O=C(COc1ccc2ccccc2c1)N1CCN(C(=O)Cc2ccccc2)CC1 | https://dx.doi.org/10.1021/jm4019355 | |
| CHEMBL3262876 | 111106 | None | 14 | Human | Binding | IC50 | = | 83.00 | 7.08 | - | 2 | Displacement of [3H]-7-alpha,25-OHC from recombinant human EBI2 receptor expressed in CHO cells after 10 mins by scintillation counting analysis | ChEMBL | 388.2 | 5 | 0 | 3 | 3.13 | O=C(COc1ccc2ccccc2c1)N1CCN(C(=O)Cc2ccccc2)CC1 | https://dx.doi.org/10.1021/jm4019355 | |
| CHEMBL3262876 | 111106 | None | 14 | Human | Binding | IC50 | = | 74.13 | 7.13 | - | 2 | Displacement of [3H]-7-alpha,25-OHC from recombinant human EBI2 receptor expressed in CHO cells after 10 mins by scintillation counting analysis | ChEMBL | 388.2 | 5 | 0 | 3 | 3.13 | O=C(COc1ccc2ccccc2c1)N1CCN(C(=O)Cc2ccccc2)CC1 | https://dx.doi.org/10.1021/jm4019355 | |
| GSK682753A | 1885 | None | 0 | Human | Binding | pIC50 | = | - | 8.59 | - | 1 | Measuring inhibition of [35S]GTPγS binding to hGPR183 in cell membrane preparations | Guide to Pharmacology | 478.1 | 4 | 0 | 3 | 5.67 | O=C(/C=C/c1ccc(Cl)cc1)N1CCC2(CC1)CN(Cc1ccc(Cl)c(Cl)c1)C(=O)O2 | https://pubmed.ncbi.nlm.nih.gov/21673108 | |
| NIBR189 | 2820 | None | 48 | Human | Binding | IC50 | = | 0.22 | 9.65 | - | 2 | Antagonist activity at EBI2 receptor in human U937 cells assessed as inhibition of 7-alpha,25-OHC-induced cell migration after 3 hrs by flow cytometric analysis | ChEMBL | 428.1 | 4 | 0 | 3 | 3.46 | COc1ccc(C(=O)N2CCN(C(=O)/C=C/c3ccc(Br)cc3)CC2)cc1 | https://dx.doi.org/10.1021/jm4019355 | |
| NIBR189 | 2820 | None | 48 | Human | Binding | IC50 | = | 0.30 | 9.52 | - | 2 | Antagonist activity at EBI2 receptor in human U937 cells assessed as inhibition of 7-alpha,25-OHC-induced cell migration after 3 hrs by flow cytometric analysis | ChEMBL | 428.1 | 4 | 0 | 3 | 3.46 | COc1ccc(C(=O)N2CCN(C(=O)/C=C/c3ccc(Br)cc3)CC2)cc1 | https://dx.doi.org/10.1021/jm4019355 | |
Showing 1 to 7 of 7 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| 25-hydroxycholesterol | 50 | None | 0 | Human | Functional | pEC50 | = | - | 6.90 | - | 1 | Unclassified | Guide to Pharmacology | 402.4 | 5 | 2 | 2 | 6.50 | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C | https://pubmed.ncbi.nlm.nih.gov/21796211 | |
| 27-hydroxycholesterol | 51 | None | 0 | Human | Functional | pEC50 | = | - | 5.52 | - | 1 | Unclassified | Guide to Pharmacology | 402.4 | 6 | 2 | 2 | 6.36 | C[C@@H](CO)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C | https://pubmed.ncbi.nlm.nih.gov/21796211 | |
| 7α,25-dihydroxycholesterol | 166 | None | 27 | Human | Functional | pEC50 | = | - | 8.97 | 1 | 2 | Unclassified | Guide to Pharmacology | 418.3 | 5 | 3 | 3 | 5.47 | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C | https://pubmed.ncbi.nlm.nih.gov/21796211 | |
| 7α,25-dihydroxycholesterol | 166 | None | 27 | Human | Functional | pEC50 | = | - | 8.97 | 1 | 2 | Unclassified | Guide to Pharmacology | 418.3 | 5 | 3 | 3 | 5.47 | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C | https://pubmed.ncbi.nlm.nih.gov/21796212 | |
| 7α,25-dihydroxycholesterol | 166 | None | 27 | Human | Functional | EC50 | = | 0.14 | 9.85 | 1 | 2 | Agonist activity at Go2-q-coupled EBI2 (unknown origin) expressed in COS7 cell membranes assessed as stimulation of [35S]GTPgammaS binding preincubated for 20 mins followed by [35S]GTPgammaS addition and measured after 1 hr by scintillation counting analysis | ChEMBL | 418.3 | 5 | 3 | 3 | 5.47 | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C | https://dx.doi.org/10.1016/j.bmcl.2016.09.029 | |
| 7α,25-dihydroxycholesterol | 166 | None | 27 | Human | Functional | EC50 | = | 0.03 | 10.49 | 1 | 2 | Agonist activity at Go2-q-coupled human EBI2 expressed in COS7 cell membranes assessed as stimulation of [35S]GTPgammaS binding preincubated for 20 mins followed by [35S]GTPgammaS addition and measured after 1 hr by scintillation counting analysis | ChEMBL | 418.3 | 5 | 3 | 3 | 5.47 | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C | https://dx.doi.org/10.1016/j.bmcl.2016.09.029 | |
| 7α,25-dihydroxycholesterol | 166 | None | 27 | Human | Functional | pIC50 | = | - | 8.38 | 1 | 2 | Unclassified | Guide to Pharmacology | 418.3 | 5 | 3 | 3 | 5.47 | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C | https://pubmed.ncbi.nlm.nih.gov/21796211 | |
| 7α,25-dihydroxycholesterol | 166 | None | 27 | Human | Functional | pIC50 | = | - | 8.38 | 1 | 2 | Unclassified | Guide to Pharmacology | 418.3 | 5 | 3 | 3 | 5.47 | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C | https://pubmed.ncbi.nlm.nih.gov/21796212 | |
| 7α,25-dihydroxycholesterol | 166 | None | 27 | Mouse | Functional | EC50 | = | 0.70 | 9.15 | -1 | 2 | Agonist activity at Go2-q-coupled mouse EBI2 expressed in COS7 cell membranes assessed as stimulation of [35S]GTPgammaS binding preincubated for 20 mins followed by [35S]GTPgammaS addition and measured after 1 hr by scintillation counting analysis | ChEMBL | 418.3 | 5 | 3 | 3 | 5.47 | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C | https://dx.doi.org/10.1016/j.bmcl.2016.09.029 | |
| 7α,27-dihydroxycholesterol | 167 | None | 0 | Human | Functional | pEC50 | = | - | 8.89 | - | 1 | Unclassified | Guide to Pharmacology | 418.3 | 6 | 3 | 3 | 5.33 | C[C@@H](CO)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C | https://pubmed.ncbi.nlm.nih.gov/21796211 | |
| 7α-hydroxycholesterol | 170 | None | 32 | Human | Functional | pEC50 | = | - | 7.09 | - | 1 | Unclassified | Guide to Pharmacology | 402.4 | 5 | 2 | 2 | 6.36 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C | https://pubmed.ncbi.nlm.nih.gov/21796211 | |
| 7α-hydroxycholesterol | 170 | None | 32 | Human | Functional | EC50 | = | 104.88 | 6.98 | - | 1 | GPCR PRESTO-Tango dose-response in agonist mode with target: GPR183 | ChEMBL | 402.4 | 5 | 2 | 2 | 6.36 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| 7β, 25-dihydroxycholesterol | 177 | None | 13 | Human | Functional | EC50 | = | 2.10 | 8.68 | - | 1 | Agonist activity at Go2-q-coupled EBI2 (unknown origin) expressed in COS7 cell membranes assessed as stimulation of [35S]GTPgammaS binding preincubated for 20 mins followed by [35S]GTPgammaS addition and measured after 1 hr by scintillation counting analysis | ChEMBL | 418.3 | 5 | 3 | 3 | 5.47 | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@@]21C)[C@@]1(C)CC[C@H](O)CC1=C[C@@H]3O | https://dx.doi.org/10.1016/j.bmcl.2016.09.029 | |
| 7β, 25-dihydroxycholesterol | 177 | None | 13 | Human | Functional | pEC50 | = | - | 8.68 | - | 1 | Unclassified | Guide to Pharmacology | 418.3 | 5 | 3 | 3 | 5.47 | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@@]21C)[C@@]1(C)CC[C@H](O)CC1=C[C@@H]3O | https://pubmed.ncbi.nlm.nih.gov/21796211 | |
| 7β, 27-dihydroxycholesterol | 178 | None | 0 | Human | Functional | pEC50 | = | - | 7.29 | - | 1 | Unclassified | Guide to Pharmacology | 418.3 | 6 | 3 | 3 | 5.33 | C[C@@H](CO)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@@]21C)[C@@]1(C)CC[C@H](O)CC1=C[C@@H]3O | https://pubmed.ncbi.nlm.nih.gov/21796211 | |
| 7β-hydroxycholesterol | 179 | None | 0 | Human | Functional | pEC50 | = | - | 5.75 | - | 1 | Unclassified | Guide to Pharmacology | 402.4 | 5 | 2 | 2 | 6.36 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@@]21C)[C@@]1(C)CC[C@H](O)CC1=C[C@@H]3O | https://pubmed.ncbi.nlm.nih.gov/21796211 | |
| A77636 | 208 | None | 8 | Human | Functional | IC50 | = | 3174.45 | 5.50 | -1047 | 27 | GPCR PRESTO-Tango dose-response in antagonist mode with target: GPR183 | ChEMBL | 329.2 | 2 | 3 | 4 | 3.25 | NC[C@@H]1O[C@H](C23CC4CC(CC(C4)C2)C3)Cc2c1ccc(O)c2O | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| aprepitant | 448 | None | 58 | Human | Functional | IC50 | = | 4512.74 | 5.35 | -19054 | 8 | GPCR PRESTO-Tango dose-response in antagonist mode with target: GPR183 | ChEMBL | 534.1 | 6 | 2 | 5 | 4.95 | C[C@@H](O[C@H]1OCCN(Cc2nc(=O)[nH][nH]2)[C@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| BAY-593074 | 584 | None | 43 | Human | Functional | IC50 | = | 3060.70 | 5.51 | - | 4 | GPCR PRESTO-Tango dose-response in antagonist mode with target: GPR183 | ChEMBL | 453.0 | 7 | 0 | 5 | 5.42 | N#Cc1c(Oc2cccc(OS(=O)(=O)CCCC(F)(F)F)c2)cccc1C(F)(F)F | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| biphenylindanone A | 664 | None | 44 | Human | Functional | IC50 | = | 4460.53 | 5.35 | -70 | 4 | GPCR PRESTO-Tango dose-response in antagonist mode with target: GPR183 | ChEMBL | 454.2 | 6 | 1 | 3 | 6.79 | Cc1c(OCc2cccc(-c3ccc(C(=O)O)cc3)c2)cc2c(c1C)C(=O)C(C1CCCC1)C2 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
Showing 1 to 20 of 290 entries