Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
[Ac-Tyr1, D-Arg2]GHRH-(1-29)-NH2 (human) | 281 | None | 0 | Rat | Binding | pKi | None | - | 8.40 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9892695 | |
[Ac-Tyr1, D-Arg2]GHRH-(1-29)-NH2 (human) | 281 | None | 0 | Rat | Binding | pKi | None | - | 8.40 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/14755056 | |
[Ac-Tyr1, D-Arg2]GHRH-(1-29)-NH2 (human) | 281 | None | 0 | Rat | Binding | pKi | None | - | 8.40 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/7991622 | |
[Ac-Tyr1, D-Arg2]GHRH-(1-29)-NH2 (human) | 281 | None | 0 | Rat | Binding | pKi | None | - | 8.40 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9145431 | |
CHEMBL216479 | 81926 | None | 0 | Rat | Binding | IC50 | = | 6.60 | 8.18 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | 3468.9 | 121 | 50 | 48 | -14.30 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL262536 | 212999 | None | 0 | Rat | Binding | IC50 | = | 45.20 | 7.34 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL262750 | 96574 | None | 0 | Rat | Binding | IC50 | = | 13.70 | 7.86 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | 3440.9 | 119 | 50 | 48 | -15.08 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL264522 | 213083 | None | 0 | Rat | Binding | IC50 | = | 120.00 | 6.92 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL265167 | 213099 | None | 15 | Rat | Binding | IC50 | = | 9.80 | 8.01 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1c[nH]cn1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL266658 | 213150 | None | 0 | Rat | Binding | IC50 | = | 9.50 | 8.02 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL269041 | 213235 | None | 0 | Rat | Binding | IC50 | = | 217.00 | 6.66 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL269263 | 213242 | None | 0 | Rat | Binding | IC50 | = | 1000.00 | 6.00 | - | 1 | Compound was tested to Inhibit [125I]GRF in rat adenopituitary homogenates | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL385308 | 214808 | None | 0 | Rat | Binding | IC50 | = | 1.90 | 8.72 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]cn1)NC(C)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)[C@@H](C)CC)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL386366 | 141913 | None | 0 | Rat | Binding | IC50 | = | 0.73 | 9.14 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | 3353.8 | 116 | 47 | 46 | -12.44 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)CC(=O)CCc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL411913 | 161337 | None | 0 | Rat | Binding | IC50 | = | 130.00 | 6.89 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | 3135.8 | 108 | 44 | 42 | -11.15 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)CC(=O)CCc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL412221 | 215437 | None | 0 | Rat | Binding | IC50 | = | 1000.00 | 6.00 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL412558 | 215463 | None | 0 | Rat | Binding | IC50 | = | 95.00 | 7.02 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL413014 | 215504 | None | 0 | Rat | Binding | IC50 | = | 17.60 | 7.75 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(C)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL414943 | 215623 | None | 0 | Rat | Binding | IC50 | = | 20.20 | 7.70 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 | |
CHEMBL415373 | 215646 | None | 0 | Rat | Binding | IC50 | = | 836.00 | 6.08 | - | 1 | Compound was tested to Inhibit [125I]-Growth hormone-releasing factor in rat adenopituitary homogenates | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O)[C@@H](C)CC)C(C)C)[C@@H](C)O | https://dx.doi.org/10.1021/jm00088a023 |
Showing 1 to 20 of 54 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL1189066 | 12918 | None | 0 | Rat | Functional | EC50 | = | 1.30 | 8.89 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 547.3 | 11 | 2 | 5 | 4.62 | CCOC(=O)CCC1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1189070 | 12919 | None | 0 | Rat | Functional | EC50 | = | 1.00 | 9.00 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 533.3 | 10 | 2 | 5 | 4.23 | CCOC(=O)C[C@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1190394 | 13113 | None | 0 | Rat | Functional | EC50 | = | 2.50 | 8.60 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 519.3 | 10 | 3 | 4 | 4.14 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)CC(CCC(=O)O)c1ccccc12 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1190399 | 13114 | None | 0 | Rat | Functional | EC50 | = | 2.30 | 8.64 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 505.3 | 9 | 3 | 4 | 3.75 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@H](CC(=O)O)c1ccccc12 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1193173 | 13468 | None | 0 | Rat | Functional | EC50 | = | 2.90 | 8.54 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 521.3 | 9 | 2 | 6 | 3.04 | CCOC(=O)[C@H]1CC2(CCN(C(=O)[C@@H](COCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1193375 | 13496 | None | 0 | Rat | Functional | EC50 | = | 2.00 | 8.70 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 519.3 | 9 | 2 | 5 | 3.84 | CCOC(=O)[C@@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1193573 | 13515 | None | 0 | Rat | Functional | EC50 | = | 0.80 | 9.10 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 533.3 | 10 | 2 | 5 | 4.23 | CCOC(=O)C[C@@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1193574 | 13516 | None | 0 | Rat | Functional | EC50 | = | 4.40 | 8.36 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 493.3 | 8 | 3 | 5 | 2.56 | CC(C)(N)C(=O)N[C@H](COCc1ccccc1)C(=O)N1CCC2(CC1)C[C@H](C(=O)O)c1ccccc12 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1194179 | 13609 | None | 0 | Rat | Functional | EC50 | = | 2.10 | 8.68 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 491.3 | 8 | 3 | 4 | 3.36 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@H](C(=O)O)c1ccccc12 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1194442 | 13643 | None | 0 | Rat | Functional | EC50 | = | 7.00 | 8.15 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 544.3 | 8 | 3 | 5 | 3.93 | CCOC(=O)C[C@@H]1CC2(CCN(C(=O)[C@@H](Cc3c[nH]c4ccccc34)NC(=O)C(C)(C)N)CC2)c2ccccc21 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1194592 | 13663 | None | 0 | Rat | Functional | EC50 | = | 6.60 | 8.18 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 521.3 | 9 | 2 | 6 | 3.04 | CCOC(=O)[C@@H]1CC2(CCN(C(=O)[C@@H](COCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1194776 | 13689 | None | 0 | Rat | Functional | EC50 | = | 2.50 | 8.60 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 491.3 | 8 | 3 | 4 | 3.36 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@@H](C(=O)O)c1ccccc12 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1194874 | 13703 | None | 0 | Rat | Functional | EC50 | = | 1.90 | 8.72 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 505.3 | 9 | 3 | 4 | 3.75 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CC1)C[C@@H](CC(=O)O)c1ccccc12 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1194891 | 13705 | None | 0 | Rat | Functional | EC50 | = | 6.00 | 8.22 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 530.3 | 7 | 3 | 5 | 3.54 | CCOC(=O)[C@H]1CC2(CCN(C(=O)[C@@H](Cc3c[nH]c4ccccc34)NC(=O)C(C)(C)N)CC2)c2ccccc21 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1195548 | 13799 | None | 0 | Rat | Functional | EC50 | = | 28.00 | 7.55 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 544.3 | 8 | 3 | 5 | 3.93 | CCOC(=O)C[C@H]1CC2(CCN(C(=O)[C@@H](Cc3c[nH]c4ccccc34)NC(=O)C(C)(C)N)CC2)c2ccccc21 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1196053 | 13878 | None | 0 | Rat | Functional | EC50 | = | 8.30 | 8.08 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 530.3 | 7 | 3 | 5 | 3.54 | CCOC(=O)[C@@H]1CC2(CCN(C(=O)[C@@H](Cc3c[nH]c4ccccc34)NC(=O)C(C)(C)N)CC2)c2ccccc21 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL1196866 | 13983 | None | 0 | Rat | Functional | EC50 | = | 5.80 | 8.24 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 516.3 | 7 | 4 | 4 | 3.46 | CC(C)(N)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N1CCC2(CC1)C[C@@H](CC(=O)O)c1ccccc12 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL294923 | 101142 | None | 0 | Rat | Functional | EC50 | = | 10.00 | 8.00 | -1 | 2 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 447.3 | 7 | 2 | 3 | 3.74 | CC(C)(N)C(=O)N[C@H](CCCc1ccccc1)C(=O)N1CCC2(CCc3ccccc32)CC1 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL319460 | 108082 | None | 0 | Rat | Functional | EC50 | = | 1.00 | 9.00 | - | 1 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 519.3 | 9 | 2 | 5 | 3.84 | CCOC(=O)[C@H]1CC2(CCN(C(=O)[C@@H](CCCc3ccccc3)NC(=O)C(C)(C)N)CC2)c2ccccc21 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 | |
CHEMBL417182 | 162864 | None | 0 | Rat | Functional | EC50 | = | 17.00 | 7.77 | -1 | 2 | Ability to release growth hormone in a rat pituitary cell assay | ChEMBL | 449.3 | 7 | 2 | 4 | 2.93 | CC(C)(N)C(=O)N[C@H](COCc1ccccc1)C(=O)N1CCC2(CCc3ccccc32)CC1 | https://dx.doi.org/10.1016/S0960-894X(97)00421-6 |
Showing 1 to 20 of 29 entries