Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| 2-methyl-3-phenethyl-3H-pyrimidin-4-one | 80 | None | 0 | Human | Binding | IC50 | = | 97.00 | 7.01 | - | 1 | Inhibitory concentration was evaluated for in vitro calcilytic activity against human calcium receptor | ChEMBL | 352.2 | 4 | 1 | 3 | 3.39 | CCC1=C(C)N/C(=C2/C=CC=CC2=O)N(CCc2ccccc2F)C1=O | https://dx.doi.org/10.1016/j.bmcl.2005.03.054 | |
| Ca2+ | 806 | None | 0 | Human | Binding | pKd | None | - | 2.40 | -1 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/7531693 | |
| Ca2+ | 806 | None | 0 | Mouse | Binding | pKd | None | - | 2.50 | 1 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/16199532 | |
| Ca2+ | 806 | None | 0 | Rat | Binding | pKd | None | - | 2.50 | -1 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/7816802 | |
| calindol | 784 | None | 4 | Human | Binding | pKd | = | - | 6.25 | - | 3 | Unclassified | Guide to Pharmacology | 300.2 | 4 | 2 | 1 | 5.17 | C[C@@H](NCc1cc2ccccc2[nH]1)c1cccc2ccccc12 | https://pubmed.ncbi.nlm.nih.gov/15149704 | |
| calindol | 784 | None | 4 | Human | Binding | pKd | = | - | 6.25 | - | 3 | Unclassified | Guide to Pharmacology | 300.2 | 4 | 2 | 1 | 5.17 | C[C@@H](NCc1cc2ccccc2[nH]1)c1cccc2ccccc12 | https://pubmed.ncbi.nlm.nih.gov/14976203 | |
| CHEMBL1083694 | 6728 | None | 0 | Human | Binding | IC50 | = | 97.00 | 7.01 | - | 1 | Inhibition of CaSR | ChEMBL | 402.2 | 5 | 1 | 4 | 5.02 | CCc1cc2c(=O)n(CCc3ccccc3F)c(-c3ccccc3O)nc2cc1C | https://dx.doi.org/10.1021/jm9018756 | |
| CHEMBL1084514 | 6952 | None | 14 | Human | Binding | IC50 | = | 520.00 | 6.28 | - | 1 | Inhibition of CaSR | ChEMBL | 464.3 | 12 | 2 | 6 | 3.97 | CCOC(=O)CCc1ccc(C#N)c(OC[C@H](O)CNC(C)(C)CC2Cc3ccccc3C2)c1 | https://dx.doi.org/10.1021/jm9018756 | |
| CHEMBL178442 | 62897 | None | 0 | Human | Binding | IC50 | = | 1600.00 | 5.80 | - | 1 | Inhibitory concentration against human calcium receptor expressed in HEK 293 cells | ChEMBL | 394.1 | 4 | 1 | 4 | 4.80 | O=c1c2ccc(Cl)cc2nc(-c2ccccc2O)n1CCc1cccc(F)c1 | https://dx.doi.org/10.1016/j.bmcl.2005.01.078 | |
| CHEMBL179333 | 63322 | None | 0 | Human | Binding | IC50 | = | 2800.00 | 5.55 | - | 1 | Inhibitory concentration against human calcium receptor expressed in HEK 293 cells | ChEMBL | 342.1 | 4 | 1 | 4 | 4.01 | O=c1c2ccccc2nc(-c2cccc(O)c2)n1CCc1ccccc1 | https://dx.doi.org/10.1016/j.bmcl.2005.01.078 | |
| CHEMBL179907 | 63504 | None | 0 | Human | Binding | IC50 | = | 700.00 | 6.16 | - | 1 | Inhibitory concentration against human calcium receptor expressed in HEK 293 cells | ChEMBL | 356.2 | 4 | 1 | 4 | 4.32 | Cc1cccc2c(=O)n(CCc3ccccc3)c(-c3ccccc3O)nc12 | https://dx.doi.org/10.1016/j.bmcl.2005.01.078 | |
| CHEMBL180030 | 63566 | None | 0 | Human | Binding | IC50 | = | 300.00 | 6.52 | - | 1 | Inhibitory concentration against human calcium receptor expressed in HEK 293 cells | ChEMBL | 342.1 | 4 | 1 | 4 | 4.01 | O=c1c2ccccc2nc(-c2ccccc2O)n1CCc1ccccc1 | https://dx.doi.org/10.1016/j.bmcl.2005.01.078 | |
| CHEMBL180030 | 63566 | None | 0 | Human | Binding | IC50 | = | 300.00 | 6.52 | - | 1 | Inhibition of CaSR | ChEMBL | 342.1 | 4 | 1 | 4 | 4.01 | O=c1c2ccccc2nc(-c2ccccc2O)n1CCc1ccccc1 | https://dx.doi.org/10.1021/jm9018756 | |
| CHEMBL180057 | 63575 | None | 0 | Human | Binding | IC50 | = | 520.00 | 6.28 | - | 1 | Inhibitory concentration against human calcium receptor expressed in HEK 293 cells | ChEMBL | 374.1 | 4 | 1 | 4 | 4.46 | Cc1ccc2nc(-c3ccccc3O)n(CCc3cccc(F)c3)c(=O)c2c1 | https://dx.doi.org/10.1016/j.bmcl.2005.01.078 | |
| CHEMBL180250 | 63852 | None | 0 | Human | Binding | IC50 | = | 800.00 | 6.10 | - | 1 | Inhibitory concentration against human calcium receptor expressed in HEK 293 cells | ChEMBL | 376.1 | 4 | 1 | 4 | 4.67 | O=c1c2ccccc2nc(-c2ccccc2O)n1CCc1cccc(Cl)c1 | https://dx.doi.org/10.1016/j.bmcl.2005.01.078 | |
| CHEMBL180336 | 63884 | None | 8 | Human | Binding | IC50 | = | 3500.00 | 5.46 | - | 1 | Inhibitory concentration against human calcium receptor expressed in HEK 293 cells | ChEMBL | 316.1 | 4 | 0 | 4 | 3.90 | O=c1c2ccccc2nc(-c2ccco2)n1CCc1ccccc1 | https://dx.doi.org/10.1016/j.bmcl.2005.01.078 | |
| CHEMBL180336 | 63884 | None | 8 | Human | Binding | IC50 | = | 3500.00 | 5.46 | - | 1 | Inhibitory concentration was evaluated for in vitro calcilytic activity against human calcium receptor | ChEMBL | 316.1 | 4 | 0 | 4 | 3.90 | O=c1c2ccccc2nc(-c2ccco2)n1CCc1ccccc1 | https://dx.doi.org/10.1016/j.bmcl.2005.03.054 | |
| CHEMBL180391 | 63899 | None | 7 | Human | Binding | IC50 | = | 14000.00 | 4.85 | - | 1 | Inhibitory concentration against human calcium receptor expressed in HEK 293 cells | ChEMBL | 326.1 | 4 | 0 | 3 | 4.31 | O=c1c2ccccc2nc(-c2ccccc2)n1CCc1ccccc1 | https://dx.doi.org/10.1016/j.bmcl.2005.01.078 | |
| CHEMBL180463 | 63914 | None | 0 | Human | Binding | IC50 | = | 190.00 | 6.72 | - | 1 | Inhibitory concentration against human calcium receptor expressed in HEK 293 cells | ChEMBL | 378.1 | 4 | 1 | 4 | 4.29 | O=c1c2cc(F)ccc2nc(-c2ccccc2O)n1CCc1cccc(F)c1 | https://dx.doi.org/10.1016/j.bmcl.2005.01.078 | |
| CHEMBL182107 | 64880 | None | 0 | Human | Binding | IC50 | = | 1600.00 | 5.80 | - | 1 | Inhibitory concentration against human calcium receptor expressed in HEK 293 cells | ChEMBL | 358.1 | 4 | 2 | 5 | 3.72 | O=c1c2ccccc2nc(-c2cc(O)ccc2O)n1CCc1ccccc1 | https://dx.doi.org/10.1016/j.bmcl.2005.01.078 | |
Showing 1 to 20 of 159 entries
| Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |