Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
(+)-MCPG | 2475 | None | 35 | Rat | Binding | pKi | None | - | 3.80 | -6 | 8 | Unclassified | Guide to Pharmacology | 209.1 | 3 | 3 | 3 | 0.64 | C[C@@](N)(C(=O)O)c1ccc(C(=O)O)cc1 | https://pubmed.ncbi.nlm.nih.gov/12695537 | |
(1R,2S)-PHENYLPROPANOLAMINE | 27120 | Functional | 13 | Rat | Binding | pKi | = | 10000.00 | 5.00 | -38 | 42 | - | PDSP KiDatabase | 151.1 | 2 | 2 | 2 | 1.07 | C[C@H](N)[C@H](O)c1ccccc1 | - | |
(1S,3R)-ACPD | 33 | None | 30 | Human | Binding | EC50 | = | 15000.00 | 4.82 | -26 | 15 | Compound was tested for the inhibition of Metabotropic glutamate receptor 1 | ChEMBL | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://dx.doi.org/10.1021/jm970719q | |
(1S,3R)-ACPD | 33 | None | 30 | Human | Binding | EC50 | = | 22000.00 | 4.66 | -26 | 15 | Effective concentration for half maximal stimulation of PI hydrolysis (mGluR1a) | ChEMBL | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://dx.doi.org/10.1021/jm9601718 | |
(1S,3R)-ACPD | 33 | None | 30 | Rat | Binding | pKi | None | - | 5.80 | 3 | 15 | Unclassified | Guide to Pharmacology | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://pubmed.ncbi.nlm.nih.gov/12695537 | |
(1S,3R)-ACPD | 33 | None | 30 | Rat | Binding | pKi | None | - | 5.80 | 3 | 15 | Unclassified | Guide to Pharmacology | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://pubmed.ncbi.nlm.nih.gov/7690672 | |
(1S,3R)-ACPD | 33 | None | 30 | Rat | Binding | pKi | None | - | 5.80 | 3 | 15 | Unclassified | Guide to Pharmacology | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://pubmed.ncbi.nlm.nih.gov/11080213 | |
(1S,3R)-ACPD | 33 | None | 30 | Rat | Binding | EC50 | = | 22000.00 | 4.66 | 3 | 15 | Concentration for half maximal activation of metabotropic glutamate mGluR1a in rat | ChEMBL | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://dx.doi.org/10.1021/jm00009a001 | |
(1S,3R)-ACPD | 33 | None | 30 | Rat | Binding | EC50 | = | 50000.00 | 4.30 | 3 | 15 | Concentration for half maximal activation of metabotropic glutamate mGluR1a in rat | ChEMBL | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://dx.doi.org/10.1021/jm00009a001 | |
(S)-(+)-CBPG | 3544 | None | 30 | Human | Binding | IC50 | = | 32000.00 | 4.50 | - | 3 | Inhibitory activity against mGluR1 receptor | ChEMBL | 185.1 | 3 | 3 | 3 | -0.35 | N[C@H](C(=O)O)C12CC(C(=O)O)(C1)C2 | https://dx.doi.org/10.1016/s0960-894x(98)00265-0 | |
(S)-(+)-CBPG | 3544 | None | 30 | Human | Binding | IC50 | = | 25000.00 | 4.60 | - | 3 | Inhibition of mGluR1a receptor | ChEMBL | 185.1 | 3 | 3 | 3 | -0.35 | N[C@H](C(=O)O)C12CC(C(=O)O)(C1)C2 | https://dx.doi.org/10.1021/jm1013693 | |
(S)-(+)-CBPG | 3544 | None | 30 | Human | Binding | IC50 | = | 25000.00 | 4.60 | - | 3 | Antagonist activity at mGluR1alpha (unknown origin) | ChEMBL | 185.1 | 3 | 3 | 3 | -0.35 | N[C@H](C(=O)O)C12CC(C(=O)O)(C1)C2 | https://dx.doi.org/10.1021/acs.jmedchem.1c01215 | |
(S)-(+)-CBPG | 3544 | None | 30 | Rat | Binding | IC50 | = | 25000.00 | 4.60 | - | 3 | Inhibitory activity against Metabotropic glutamate receptor 1 in the rat LLC-PK1/HEK 293 cells. | ChEMBL | 185.1 | 3 | 3 | 3 | -0.35 | N[C@H](C(=O)O)C12CC(C(=O)O)(C1)C2 | https://dx.doi.org/10.1021/jm980571q | |
(S)-3HPG | 2080 | None | 32 | Human | Binding | EC50 | = | 68000.00 | 4.17 | - | 3 | Effective concentration for half maximal stimulation of PI hydrolysis (mGluR1a) | ChEMBL | 167.1 | 2 | 3 | 3 | 0.48 | N[C@H](C(=O)O)c1cccc(O)c1 | https://dx.doi.org/10.1021/jm9601718 | |
(S)-4C3HPG | 2081 | None | 25 | Human | Binding | pKi | None | - | 5.90 | 12 | 5 | Unclassified | Guide to Pharmacology | 211.0 | 3 | 4 | 4 | 0.17 | N[C@H](C(=O)O)c1ccc(C(=O)O)c(O)c1 | https://pubmed.ncbi.nlm.nih.gov/12695537 | |
(S)-4C3HPG | 2081 | None | 25 | Human | Binding | pKi | None | - | 5.90 | 12 | 5 | Unclassified | Guide to Pharmacology | 211.0 | 3 | 4 | 4 | 0.17 | N[C@H](C(=O)O)c1ccc(C(=O)O)c(O)c1 | https://pubmed.ncbi.nlm.nih.gov/11080213 | |
(S)-4C3HPG | 2081 | None | 25 | Human | Binding | IC50 | = | 40000.00 | 4.40 | 12 | 5 | Inhibitory concentration for half maximal inhibition of PI hydrolysis (mGluR1a) | ChEMBL | 211.0 | 3 | 4 | 4 | 0.17 | N[C@H](C(=O)O)c1ccc(C(=O)O)c(O)c1 | https://dx.doi.org/10.1021/jm9601718 | |
(S)-4C3HPG | 2081 | None | 25 | Rat | Binding | IC50 | = | 40000.00 | 4.40 | - | 5 | Inhibitory activity against Metabotropic glutamate receptor 1 in the rat LLC-PK1/HEK 293 cells | ChEMBL | 211.0 | 3 | 4 | 4 | 0.17 | N[C@H](C(=O)O)c1ccc(C(=O)O)c(O)c1 | https://dx.doi.org/10.1021/jm980571q | |
(S)-4CPG | 3449 | None | 40 | Human | Binding | IC50 | = | 65000.00 | 4.19 | -21 | 3 | Inhibitory concentration for half maximal inhibition of PI hydrolysis (mGluR1a) | ChEMBL | 195.1 | 3 | 3 | 3 | 0.47 | N[C@H](C(=O)O)c1ccc(C(=O)O)cc1 | https://dx.doi.org/10.1021/jm9601718 | |
(S)-4CPG | 3449 | None | 40 | Human | Binding | IC50 | = | 65000.00 | 4.19 | -21 | 3 | Antagonist activity at mGluR1alpha (unknown origin) | ChEMBL | 195.1 | 3 | 3 | 3 | 0.47 | N[C@H](C(=O)O)c1ccc(C(=O)O)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.1c01215 |
Showing 1 to 20 of 466 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
(+)-MCPG | 2475 | None | 35 | Human | Functional | IC50 | = | 4300.00 | 5.37 | -1 | 8 | Antagonist activity at mGlu1 receptor | ChEMBL | 209.1 | 3 | 3 | 3 | 0.64 | C[C@@](N)(C(=O)O)c1ccc(C(=O)O)cc1 | https://dx.doi.org/10.1021/jm060950g | |
(1S,3R)-ACPD | 33 | None | 30 | Human | Functional | EC50 | = | 9300.00 | 5.03 | -4 | 15 | Agonist activity against Metabotropic glutamate receptor 1 expressed in HEK 293 cells was evaluated by measuring total inositol phosphate accumulation | ChEMBL | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://dx.doi.org/10.1021/jm970207b | |
(1S,3R)-ACPD | 33 | None | 30 | Human | Functional | Ki | = | 42000.00 | 4.38 | -4 | 15 | Agonist potency against cloned human metabotropic glutamate receptor 1 | ChEMBL | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://dx.doi.org/10.1021/jm000007r | |
(1S,3R)-ACPD | 33 | None | 30 | Rat | Functional | EC50 | = | 42000.00 | 4.38 | -8 | 15 | Tested for the agonistic activity against Metabotropic glutamate receptor 1 | ChEMBL | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://dx.doi.org/10.1016/S0960-894X(97)00068-1 | |
(1S,3R)-ACPD | 33 | None | 30 | Rat | Functional | EC50 | = | 15000.00 | 4.82 | -8 | 15 | Activity tested at cloned rat Metabotropic glutamate receptor 1 expressed in Chinese Hamster Ovary (CHO) cells | ChEMBL | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://dx.doi.org/10.1021/jm0308085 | |
(2R,3R)-APDC | 73 | None | 32 | Rat | Functional | EC50 | = | 100000.00 | 4.00 | -323 | 5 | Tested for the agonistic activity against Metabotropic glutamate receptor 1 | ChEMBL | 174.1 | 2 | 4 | 4 | -1.78 | N[C@@]1(C(=O)O)CN[C@@H](C(=O)O)C1 | https://dx.doi.org/10.1016/S0960-894X(97)00068-1 | |
(S)-(+)-CBPG | 3544 | None | 30 | Human | Functional | Ki | = | 25000.00 | 4.60 | 1 | 3 | Agonist potency against cloned human metabotropic glutamate receptor 1 | ChEMBL | 185.1 | 3 | 3 | 3 | -0.35 | N[C@H](C(=O)O)C12CC(C(=O)O)(C1)C2 | https://dx.doi.org/10.1021/jm000007r | |
(S)-(+)-CBPG | 3544 | None | 30 | Human | Functional | IC50 | = | 25000.00 | 4.60 | 1 | 3 | The compound was tested for inhibitory effect on second messenger formation in BHK cells expressing mGluR1a | ChEMBL | 185.1 | 3 | 3 | 3 | -0.35 | N[C@H](C(=O)O)C12CC(C(=O)O)(C1)C2 | https://dx.doi.org/10.1021/jm960254o | |
(S)-(+)-CBPG | 3544 | None | 30 | Human | Functional | IC50 | = | 25000.00 | 4.60 | 1 | 3 | Antagonist activity at mGlu1 receptor | ChEMBL | 185.1 | 3 | 3 | 3 | -0.35 | N[C@H](C(=O)O)C12CC(C(=O)O)(C1)C2 | https://dx.doi.org/10.1021/jm060950g | |
(S)-(+)-CBPG | 3544 | None | 30 | Rat | Functional | pIC50 | = | - | 4.20 | -1 | 3 | Unclassified | Guide to Pharmacology | 185.1 | 3 | 3 | 3 | -0.35 | N[C@H](C(=O)O)C12CC(C(=O)O)(C1)C2 | https://pubmed.ncbi.nlm.nih.gov/10428410 | |
(S)-3,4-DCPG | 2079 | None | 36 | Rat | Functional | EC50 | = | 32000.00 | 4.50 | -1023 | 8 | Metabotropic glutamate receptor 1 agonist activity as basal [3H]- IP formation in rat | ChEMBL | 239.0 | 4 | 4 | 4 | 0.17 | N[C@H](C(=O)O)c1ccc(C(=O)O)c(C(=O)O)c1 | https://dx.doi.org/10.1021/jm030967o | |
(S)-3HPG | 2080 | None | 32 | Rat | Functional | pIC50 | None | - | 4.90 | -1 | 3 | Unclassified | Guide to Pharmacology | 167.1 | 2 | 3 | 3 | 0.48 | N[C@H](C(=O)O)c1cccc(O)c1 | https://pubmed.ncbi.nlm.nih.gov/11080213 | |
(S)-4C3HPG | 2081 | None | 25 | Human | Functional | IC50 | = | 40000.00 | 4.40 | -15 | 5 | Antagonist activity at mGlu1 receptor | ChEMBL | 211.0 | 3 | 4 | 4 | 0.17 | N[C@H](C(=O)O)c1ccc(C(=O)O)c(O)c1 | https://dx.doi.org/10.1021/jm060950g | |
(S)-4CPG | 3449 | None | 40 | Human | Functional | IC50 | = | 58000.00 | 4.24 | -1 | 3 | Compound was tested for functional response of human metabotropic glutamate receptor mGluR1-alpha expressed in AV-12 cells by measuring inhibitory concentration towards quisqualate induced PI hydrolysis | ChEMBL | 195.1 | 3 | 3 | 3 | 0.47 | N[C@H](C(=O)O)c1ccc(C(=O)O)cc1 | https://dx.doi.org/10.1016/S0960-894X(97)10071-3 | |
(S)-4CPG | 3449 | None | 40 | Human | Functional | Ki | = | 84000.00 | 4.08 | -1 | 3 | Agonist potency against cloned human metabotropic glutamate receptor 1 | ChEMBL | 195.1 | 3 | 3 | 3 | 0.47 | N[C@H](C(=O)O)c1ccc(C(=O)O)cc1 | https://dx.doi.org/10.1021/jm000007r | |
(S)-4CPG | 3449 | None | 40 | Human | Functional | IC50 | = | 10000.00 | 5.00 | -1 | 3 | Antagonist activity at mGlu1 receptor | ChEMBL | 195.1 | 3 | 3 | 3 | 0.47 | N[C@H](C(=O)O)c1ccc(C(=O)O)cc1 | https://dx.doi.org/10.1021/jm060950g | |
(S)-TBPG | 3690 | None | 7 | Rat | Functional | pIC50 | = | - | 4.20 | 1 | 2 | Unclassified | Guide to Pharmacology | 209.1 | 3 | 3 | 5 | -0.97 | N[C@H](C(=O)O)C12CC(c3nn[nH]n3)(C1)C2 | https://pubmed.ncbi.nlm.nih.gov/11249114 | |
3,5-dimethyl PPP | 95 | None | 7 | Rat | Functional | pIC50 | = | - | 7.80 | - | 1 | Unclassified | Guide to Pharmacology | 309.2 | 5 | 1 | 4 | 3.79 | CCCOC(=O)c1[nH]c(C)c(C(=O)OC(C)C(C)(C)C)c1C | https://pubmed.ncbi.nlm.nih.gov/12470711 | |
3-MATIDA | 105 | None | 0 | Rat | Functional | pIC50 | = | - | 5.20 | - | 1 | Unclassified | Guide to Pharmacology | 215.0 | 3 | 3 | 4 | 0.84 | Cc1cc(C(=O)O)sc1C(N)C(=O)O | https://pubmed.ncbi.nlm.nih.gov/12015200 | |
A-794278 | 209 | None | 10 | Human | Functional | pIC50 | = | - | 8.00 | -3 | 3 | Unclassified | Guide to Pharmacology | 342.2 | 2 | 0 | 6 | 3.97 | CN(C)c1ccnc2sc3c(=O)n(C4CCCCCC4)cnc3c12 | https://pubmed.ncbi.nlm.nih.gov/16279797 |
Showing 1 to 20 of 1,329 entries