Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
α-methyl-5-HT | 364 | None | 24 | Human | Binding | pKi | None | - | 6.70 | -25 | 19 | Unclassified | Guide to Pharmacology | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
α-methyl-5-HT | 364 | 3H-5HT | 24 | Human | Binding | pKi | = | 184.00 | 6.74 | -25 | 19 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | - | |
α-methyl-5-HT | 364 | 3H-5HT | 24 | Human | Binding | pKi | = | 181.97 | 6.74 | -25 | 19 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | - | |
1-naphthylpiperazine | 35 | 3H-5HT | 37 | Human | Binding | pKi | = | 53.70 | 7.27 | -21 | 21 | - | PDSP KiDatabase | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | - | |
1-naphthylpiperazine | 35 | 3H-5HT | 37 | Human | Binding | pKi | = | 54.00 | 7.27 | -21 | 21 | - | PDSP KiDatabase | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | - | |
1-naphthylpiperazine | 35 | None | 37 | Human | Binding | pKi | None | - | 7.30 | -21 | 21 | Unclassified | Guide to Pharmacology | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
1-naphthylpiperazine | 35 | None | 37 | Human | Binding | pKi | None | - | 7.30 | -21 | 21 | Unclassified | Guide to Pharmacology | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | https://pubmed.ncbi.nlm.nih.gov/9225282 | |
2-methyl-5-HT | 81 | None | 43 | Human | Binding | pKi | None | - | 6.40 | -4 | 21 | Unclassified | Guide to Pharmacology | 190.1 | 2 | 3 | 2 | 1.68 | Cc1[nH]c2ccc(O)cc2c1CCN | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
2-methyl-5-HT | 81 | 3H-5HT | 43 | Human | Binding | pKi | = | 413.00 | 6.38 | -4 | 21 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.68 | Cc1[nH]c2ccc(O)cc2c1CCN | - | |
2-methyl-5-HT | 81 | 3H-5HT | 43 | Human | Binding | pKi | = | 416.86 | 6.38 | -4 | 21 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.68 | Cc1[nH]c2ccc(O)cc2c1CCN | - | |
5-BODMT | 129 | None | 0 | Human | Binding | pKi | = | - | 8.44 | 66 | 2 | Unclassified | Guide to Pharmacology | 272.2 | 7 | 1 | 2 | 3.18 | CCCC(=O)Cc1ccc2[nH]cc(CCN(C)C)c2c1 | https://pubmed.ncbi.nlm.nih.gov/21422162 | |
5-CT | 134 | None | 25 | Human | Binding | pKi | None | - | 6.10 | -8317 | 39 | Unclassified | Guide to Pharmacology | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
5-CT | 134 | None | 25 | Human | Binding | pKi | None | - | 6.10 | -8317 | 39 | Unclassified | Guide to Pharmacology | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | https://pubmed.ncbi.nlm.nih.gov/9225282 | |
5-CT | 134 | 3H-5HT | 25 | Human | Binding | pKi | = | 724.43 | 6.14 | -8317 | 39 | - | PDSP KiDatabase | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | - | |
5-CT | 134 | 3H-5HT | 25 | Human | Binding | pKi | = | 717.00 | 6.14 | -8317 | 39 | - | PDSP KiDatabase | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | - | |
5-CT | 134 | 125I-LSD | 25 | Mouse | Binding | pKi | = | 3162.27 | 5.50 | -34673 | 39 | - | PDSP KiDatabase | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | - | |
5-CT | 134 | 125I-LSD | 25 | Rat | Binding | pKi | = | 2454.70 | 5.61 | -26915 | 39 | - | PDSP KiDatabase | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | - | |
5-hydroxytryptamine | 139 | None | 45 | Human | Binding | pKi | None | - | 7.85 | -144 | 61 | Unclassified | Guide to Pharmacology | 176.1 | 2 | 3 | 2 | 1.38 | NCCc1c[nH]c2ccc(O)cc12 | https://pubmed.ncbi.nlm.nih.gov/15900510 | |
5-hydroxytryptamine | 139 | None | 45 | Human | Binding | pKi | None | - | 7.85 | -144 | 61 | Unclassified | Guide to Pharmacology | 176.1 | 2 | 3 | 2 | 1.38 | NCCc1c[nH]c2ccc(O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
5-hydroxytryptamine | 139 | None | 45 | Human | Binding | pKi | None | - | 7.85 | -144 | 61 | Unclassified | Guide to Pharmacology | 176.1 | 2 | 3 | 2 | 1.38 | NCCc1c[nH]c2ccc(O)cc12 | https://pubmed.ncbi.nlm.nih.gov/9225282 |
Showing 1 to 20 of 293 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
5-CT | 134 | None | 25 | Rat | Functional | pIC50 | None | - | 5.60 | -8912 | 39 | Unclassified | Guide to Pharmacology | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8384716 | |
5-hydroxytryptamine | 139 | None | 45 | Human | Functional | EC50 | = | 7.90 | 8.10 | -15 | 61 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor | ChEMBL | 176.1 | 2 | 3 | 2 | 1.38 | NCCc1c[nH]c2ccc(O)cc12 | https://dx.doi.org/10.1021/jm0155190 | |
5-hydroxytryptamine | 139 | None | 45 | Rat | Functional | pIC50 | None | - | 7.20 | -120 | 61 | Unclassified | Guide to Pharmacology | 176.1 | 2 | 3 | 2 | 1.38 | NCCc1c[nH]c2ccc(O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8384716 | |
CHEMBL102250 | 4524 | None | 0 | Human | Functional | EC50 | = | 11.00 | 7.96 | - | 4 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor | ChEMBL | 324.2 | 3 | 2 | 4 | 3.22 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccoc4)nc23)CC1 | https://dx.doi.org/10.1021/jm030020m | |
CHEMBL104720 | 4943 | None | 0 | Human | Functional | EC50 | = | 34.00 | 7.47 | - | 4 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor | ChEMBL | 298.2 | 3 | 2 | 3 | 2.72 | CN1CCC(c2c[nH]c3ccc(NC(=O)C4CC4)nc23)CC1 | https://dx.doi.org/10.1021/jm030020m | |
CHEMBL104753 | 4949 | None | 0 | Human | Functional | EC50 | = | 9.40 | 8.03 | - | 4 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor | ChEMBL | 340.1 | 3 | 2 | 4 | 3.69 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccsc4)nc23)CC1 | https://dx.doi.org/10.1021/jm030020m | |
CHEMBL105091 | 5018 | None | 0 | Human | Functional | EC50 | = | 11.00 | 7.96 | - | 4 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor | ChEMBL | 324.2 | 3 | 2 | 4 | 3.22 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccco4)nc23)CC1 | https://dx.doi.org/10.1021/jm030020m | |
CHEMBL105261 | 5049 | None | 0 | Human | Functional | EC50 | = | 32.00 | 7.50 | - | 9 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor | ChEMBL | 286.2 | 3 | 2 | 3 | 2.72 | CCC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 | https://dx.doi.org/10.1021/jm030020m | |
CHEMBL105722 | 5132 | None | 0 | Human | Functional | EC50 | = | 25.00 | 7.60 | - | 4 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor | ChEMBL | 335.2 | 3 | 2 | 4 | 3.02 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccccn4)nc23)CC1 | https://dx.doi.org/10.1021/jm030020m | |
CHEMBL105955 | 5170 | None | 0 | Human | Functional | EC50 | = | 13.00 | 7.89 | - | 1 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor | ChEMBL | 300.2 | 4 | 2 | 3 | 3.11 | CCCC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 | https://dx.doi.org/10.1021/jm030020m | |
CHEMBL105958 | 5171 | None | 0 | Human | Functional | EC50 | = | 11.00 | 7.96 | - | 4 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor | ChEMBL | 335.2 | 3 | 2 | 4 | 3.02 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4ccncc4)nc23)CC1 | https://dx.doi.org/10.1021/jm030020m | |
CHEMBL173949 | 60139 | None | 0 | Human | Functional | EC50 | = | 91.70 | 7.04 | - | 1 | Concentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptor | ChEMBL | 389.1 | 3 | 1 | 4 | 4.31 | CN1CCC(c2coc3ccc(NC(=O)c4c(F)cc(F)cc4F)nc23)CC1 | https://dx.doi.org/10.1016/j.bmcl.2003.09.091 | |
CHEMBL177238 | 61793 | None | 0 | Human | Functional | EC50 | = | 277.00 | 6.56 | - | 1 | Concentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptor | ChEMBL | 387.1 | 3 | 1 | 4 | 4.68 | CN1CCC(c2coc3ccc(NC(=O)c4ccc(F)cc4Cl)nc23)CC1 | https://dx.doi.org/10.1016/j.bmcl.2003.09.091 | |
CHEMBL177258 | 61795 | None | 0 | Human | Functional | EC50 | = | 66.00 | 7.18 | - | 1 | Concentration required for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-1) cells expressing the human 5-hydroxytryptamine 1F receptor | ChEMBL | 353.2 | 3 | 1 | 4 | 4.03 | CN1CCC(c2coc3ccc(NC(=O)c4ccc(F)cc4)nc23)CC1 | https://dx.doi.org/10.1016/j.bmcl.2003.09.091 | |
CHEMBL186662 | 66969 | None | 0 | Human | Functional | EC50 | = | 470.00 | 6.33 | - | 1 | Stimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cells | ChEMBL | 371.1 | 3 | 1 | 4 | 4.17 | CN1CCC(c2noc3ccc(NC(=O)c4ccc(F)cc4F)cc23)CC1 | https://dx.doi.org/10.1016/j.bmcl.2004.09.079 | |
CHEMBL186951 | 67030 | None | 0 | Human | Functional | EC50 | = | 63.00 | 7.20 | - | 1 | Stimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cells | ChEMBL | 388.1 | 3 | 2 | 4 | 4.01 | CN1CCC(N2CNc3ccc(NC(=O)c4ccc(F)cc4Cl)cc32)CC1 | https://dx.doi.org/10.1016/j.bmcl.2004.09.079 | |
CHEMBL187308 | 67108 | None | 0 | Human | Functional | EC50 | = | 140.00 | 6.85 | - | 1 | Stimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cells | ChEMBL | 387.1 | 3 | 1 | 4 | 4.68 | CN1CCC(c2noc3ccc(NC(=O)c4ccc(F)cc4Cl)cc23)CC1 | https://dx.doi.org/10.1016/j.bmcl.2004.09.079 | |
CHEMBL187581 | 67168 | None | 0 | Human | Functional | EC50 | = | 50.00 | 7.30 | - | 1 | Stimulation of [35S]GTP-gamma-S, binding to cloned human 5-hydroxytryptamine 1F receptor expressed in Mouse LM(tk-) cells | ChEMBL | 390.2 | 3 | 2 | 4 | 3.64 | CN1CCC(N2CNc3ccc(NC(=O)c4c(F)cc(F)cc4F)cc32)CC1 | https://dx.doi.org/10.1016/j.bmcl.2004.09.079 | |
CHEMBL321080 | 108949 | None | 0 | Human | Functional | EC50 | = | 15.00 | 7.82 | - | 4 | In vitro effective concentration for stimulation of [35S]GTP-gamma-S, binding in mouse LM(tk-)cells expressing the human 5-hydroxytryptamine 1F receptor | ChEMBL | 340.1 | 3 | 2 | 4 | 3.69 | CN1CCC(c2c[nH]c3ccc(NC(=O)c4cccs4)nc23)CC1 | https://dx.doi.org/10.1021/jm030020m | |
CHEMBL339980 | 117551 | None | 0 | Human | Functional | EC50 | = | 6.00 | 8.22 | - | 12 | In vitro effective concentration for inhibition of skolin-stimulated adenylate cyclase in cell line expressing human 5-hydroxytryptamine 1F receptor | ChEMBL | 339.2 | 5 | 2 | 2 | 3.97 | Cc1[nH]c2cccc(NC(=O)c3ccc(F)cc3)c2c1CCN(C)C | https://dx.doi.org/10.1021/jm0155190 |
Showing 1 to 20 of 46 entries