Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
α-methyl-5-HT | 364 | None | 24 | Human | Binding | pKi | None | - | 6.70 | -25 | 19 | Unclassified | Guide to Pharmacology | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
α-methyl-5-HT | 364 | 3H-5HT | 24 | Human | Binding | pKi | = | 184.00 | 6.74 | -25 | 19 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | - | |
α-methyl-5-HT | 364 | 3H-5HT | 24 | Human | Binding | pKi | = | 181.97 | 6.74 | -25 | 19 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | - | |
1-naphthylpiperazine | 35 | 3H-5HT | 37 | Human | Binding | pKi | = | 53.70 | 7.27 | -21 | 21 | - | PDSP KiDatabase | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | - | |
1-naphthylpiperazine | 35 | 3H-5HT | 37 | Human | Binding | pKi | = | 54.00 | 7.27 | -21 | 21 | - | PDSP KiDatabase | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | - | |
1-naphthylpiperazine | 35 | None | 37 | Human | Binding | pKi | None | - | 7.30 | -21 | 21 | Unclassified | Guide to Pharmacology | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
1-naphthylpiperazine | 35 | None | 37 | Human | Binding | pKi | None | - | 7.30 | -21 | 21 | Unclassified | Guide to Pharmacology | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | https://pubmed.ncbi.nlm.nih.gov/9225282 | |
2-methyl-5-HT | 81 | None | 43 | Human | Binding | pKi | None | - | 6.40 | -4 | 21 | Unclassified | Guide to Pharmacology | 190.1 | 2 | 3 | 2 | 1.68 | Cc1[nH]c2ccc(O)cc2c1CCN | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
2-methyl-5-HT | 81 | 3H-5HT | 43 | Human | Binding | pKi | = | 413.00 | 6.38 | -4 | 21 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.68 | Cc1[nH]c2ccc(O)cc2c1CCN | - | |
2-methyl-5-HT | 81 | 3H-5HT | 43 | Human | Binding | pKi | = | 416.86 | 6.38 | -4 | 21 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.68 | Cc1[nH]c2ccc(O)cc2c1CCN | - | |
5-BODMT | 129 | None | 0 | Human | Binding | pKi | = | - | 8.44 | 66 | 2 | Unclassified | Guide to Pharmacology | 272.2 | 7 | 1 | 2 | 3.18 | CCCC(=O)Cc1ccc2[nH]cc(CCN(C)C)c2c1 | https://pubmed.ncbi.nlm.nih.gov/21422162 | |
5-CT | 134 | None | 25 | Human | Binding | pKi | None | - | 6.10 | -8317 | 39 | Unclassified | Guide to Pharmacology | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
5-CT | 134 | None | 25 | Human | Binding | pKi | None | - | 6.10 | -8317 | 39 | Unclassified | Guide to Pharmacology | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | https://pubmed.ncbi.nlm.nih.gov/9225282 | |
5-CT | 134 | 3H-5HT | 25 | Human | Binding | pKi | = | 724.43 | 6.14 | -8317 | 39 | - | PDSP KiDatabase | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | - | |
5-CT | 134 | 3H-5HT | 25 | Human | Binding | pKi | = | 717.00 | 6.14 | -8317 | 39 | - | PDSP KiDatabase | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | - | |
5-CT | 134 | 125I-LSD | 25 | Mouse | Binding | pKi | = | 3162.27 | 5.50 | -34673 | 39 | - | PDSP KiDatabase | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | - | |
5-CT | 134 | 125I-LSD | 25 | Rat | Binding | pKi | = | 2454.70 | 5.61 | -26915 | 39 | - | PDSP KiDatabase | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | - | |
5-hydroxytryptamine | 139 | None | 45 | Human | Binding | pKi | None | - | 7.85 | -144 | 61 | Unclassified | Guide to Pharmacology | 176.1 | 2 | 3 | 2 | 1.38 | NCCc1c[nH]c2ccc(O)cc12 | https://pubmed.ncbi.nlm.nih.gov/15900510 | |
5-hydroxytryptamine | 139 | None | 45 | Human | Binding | pKi | None | - | 7.85 | -144 | 61 | Unclassified | Guide to Pharmacology | 176.1 | 2 | 3 | 2 | 1.38 | NCCc1c[nH]c2ccc(O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
5-hydroxytryptamine | 139 | None | 45 | Human | Binding | pKi | None | - | 7.85 | -144 | 61 | Unclassified | Guide to Pharmacology | 176.1 | 2 | 3 | 2 | 1.38 | NCCc1c[nH]c2ccc(O)cc12 | https://pubmed.ncbi.nlm.nih.gov/9225282 |
Showing 1 to 20 of 293 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |