Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
β-phenylethylamine | 620 | 3H-Histamine | 48 | Human | Binding | pKi | = | 10000.00 | 5.00 | -3 | 7 | - | PDSP KiDatabase | 121.1 | 2 | 1 | 1 | 1.19 | NCCc1ccccc1 | - | |
β-phenylethylamine | 620 | 3H-MEPYRAMINE | 48 | Human | Binding | pKi | = | 158489.32 | 3.80 | -3 | 7 | - | PDSP KiDatabase | 121.1 | 2 | 1 | 1 | 1.19 | NCCc1ccccc1 | - | |
(±)-cis-H2-PAT | 3141 | None | 0 | Human | Binding | pKi | None | - | 8.15 | - | 1 | Unclassified | Guide to Pharmacology | 251.2 | 2 | 0 | 1 | 3.69 | CN(C)[C@@H]1Cc2ccccc2[C@H](c2ccccc2)C1 | https://pubmed.ncbi.nlm.nih.gov/12065734 | |
(±)-cis-H2-PAT | 3141 | None | 0 | Human | Binding | pKi | None | - | 7.85 | - | 1 | Unclassified | Guide to Pharmacology | 251.2 | 2 | 0 | 1 | 3.69 | CN(C)[C@@H]1Cc2ccccc2[C@H](c2ccccc2)C1 | https://pubmed.ncbi.nlm.nih.gov/12065734 | |
(+)-butaclamol | 746 | 3H-MEPYRAMINE | 9 | Human | Binding | pKi | = | 405.00 | 6.39 | -1174 | 25 | - | PDSP KiDatabase | 361.2 | 0 | 1 | 2 | 4.84 | CC(C)(C)[C@]1(O)CCN2C[C@H]3c4ccccc4CCc4cccc(c43)[C@@H]2C1 | - | |
(+)-butaclamol | 746 | 3H-MEPYRAMINE | 9 | Human | Binding | pKi | = | 2100.00 | 5.68 | -1174 | 25 | - | PDSP KiDatabase | 361.2 | 0 | 1 | 2 | 4.84 | CC(C)(C)[C@]1(O)CCN2C[C@H]3c4ccccc4CCc4cccc(c43)[C@@H]2C1 | - | |
(+)-butaclamol | 746 | 3H-MEPYRAMINE | 9 | Human | Binding | pKi | = | 147.00 | 6.83 | -1174 | 25 | - | PDSP KiDatabase | 361.2 | 0 | 1 | 2 | 4.84 | CC(C)(C)[C@]1(O)CCN2C[C@H]3c4ccccc4CCc4cccc(c43)[C@@H]2C1 | - | |
(+)-butaclamol | 746 | 3H-MEPYRAMINE | 9 | Guinea pig | Binding | pKi | = | 3100.00 | 5.51 | -7244 | 25 | - | PDSP KiDatabase | 361.2 | 0 | 1 | 2 | 4.84 | CC(C)(C)[C@]1(O)CCN2C[C@H]3c4ccccc4CCc4cccc(c43)[C@@H]2C1 | - | |
(+)-butaclamol | 746 | 3H-MEPYRAMINE | 9 | Rat | Binding | pKi | = | 1300.00 | 5.89 | -3019 | 25 | - | PDSP KiDatabase | 361.2 | 0 | 1 | 2 | 4.84 | CC(C)(C)[C@]1(O)CCN2C[C@H]3c4ccccc4CCc4cccc(c43)[C@@H]2C1 | - | |
(+)-butaclamol | 746 | 3H-MEPYRAMINE | 9 | Rat | Binding | pKi | = | 1300.00 | 5.89 | -3019 | 25 | - | PDSP KiDatabase | 361.2 | 0 | 1 | 2 | 4.84 | CC(C)(C)[C@]1(O)CCN2C[C@H]3c4ccccc4CCc4cccc(c43)[C@@H]2C1 | - | |
(+)-chlorpheniramine | 918 | None | 42 | Human | Binding | pKi | = | - | 8.15 | -20 | 27 | Unclassified | Guide to Pharmacology | 274.1 | 5 | 0 | 2 | 3.82 | CN(C)CC[C@@H](c1ccc(Cl)cc1)c1ccccn1 | https://pubmed.ncbi.nlm.nih.gov/21381763 | |
(+)-chlorpheniramine | 918 | None | 42 | Human | Binding | IC50 | = | 66.00 | 7.18 | -20 | 27 | Displacement of [3H]pyrilamine from human histamine receptor subtype 1 expressed in CHO cells | ChEMBL | 274.1 | 5 | 0 | 2 | 3.82 | CN(C)CC[C@@H](c1ccc(Cl)cc1)c1ccccn1 | https://dx.doi.org/10.1128/aac.00669-07 | |
(+)-chlorpheniramine | 918 | None | 42 | Human | Binding | Ki | = | 7.00 | 8.15 | -20 | 27 | Binding affinity to histamine H1 receptor | ChEMBL | 274.1 | 5 | 0 | 2 | 3.82 | CN(C)CC[C@@H](c1ccc(Cl)cc1)c1ccccn1 | https://dx.doi.org/10.1021/jm1013874 | |
(+)-chlorpheniramine | 918 | None | 42 | Human | Binding | Ki | = | 0.73 | 9.14 | -20 | 27 | DRUGMATRIX: Histamine H1, Central radioligand binding (ligand: [3H] Pyrilamine) | ChEMBL | 274.1 | 5 | 0 | 2 | 3.82 | CN(C)CC[C@@H](c1ccc(Cl)cc1)c1ccccn1 | - | |
(+)-chlorpheniramine | 918 | None | 42 | Human | Binding | IC50 | = | 6.29 | 8.20 | -20 | 27 | DRUGMATRIX: Histamine H1, Central radioligand binding (ligand: [3H] Pyrilamine) | ChEMBL | 274.1 | 5 | 0 | 2 | 3.82 | CN(C)CC[C@@H](c1ccc(Cl)cc1)c1ccccn1 | - | |
(+)-chlorpheniramine | 918 | None | 42 | Human | Binding | Ki | = | 0.92 | 9.04 | -20 | 27 | Displacement of [3H]Pyrilamine from histamine H1 receptor (unknown origin) | ChEMBL | 274.1 | 5 | 0 | 2 | 3.82 | CN(C)CC[C@@H](c1ccc(Cl)cc1)c1ccccn1 | https://dx.doi.org/10.1016/j.bmcl.2013.12.024 | |
(+)-chlorpheniramine | 918 | None | 42 | Human | Binding | AC50 | = | 33.00 | 7.48 | -20 | 27 | Binding affinity towards human HRH1 in an in vitro assay measured by filtration | ChEMBL | 274.1 | 5 | 0 | 2 | 3.82 | CN(C)CC[C@@H](c1ccc(Cl)cc1)c1ccccn1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
(+)-chlorpheniramine | 918 | None | 42 | Human | Binding | AC50 | = | 20.00 | 7.70 | -20 | 27 | Binding affinity towards human HRH1 in an in vitro assay measured by filtration | ChEMBL | 274.1 | 5 | 0 | 2 | 3.82 | CN(C)CC[C@@H](c1ccc(Cl)cc1)c1ccccn1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
(+)-chlorpheniramine | 918 | 3H-MEPYRAMINE | 42 | Human | Binding | pKi | = | 2.51 | 8.60 | -20 | 27 | - | PDSP KiDatabase | 274.1 | 5 | 0 | 2 | 3.82 | CN(C)CC[C@@H](c1ccc(Cl)cc1)c1ccccn1 | - | |
(+)-chlorpheniramine | 918 | 3H-MEPYRAMINE | 42 | Human | Binding | pKi | = | 3.00 | 8.52 | -20 | 27 | - | PDSP KiDatabase | 274.1 | 5 | 0 | 2 | 3.82 | CN(C)CC[C@@H](c1ccc(Cl)cc1)c1ccccn1 | - |
Showing 1 to 20 of 3,491 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |