Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 172447279 | 195129 | None | 0 | Human | Functional | pEC50 | = | 9.8 | 9.8 | - | 1 | Agonist activity at human BB1 in human HEK293T cells assessed as increase in intracellular calcium response and measured for 3 mins by FLIPR calcium 6 assayAgonist activity at human BB1 in human HEK293T cells assessed as increase in intracellular calcium response and measured for 3 mins by FLIPR calcium 6 assay |
ChEMBL | 1103 | 32 | 13 | 12 | -0.4 | CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccccc1)C(C)C)C(N)=O | 10.1021/acs.jmedchem.3c00323 | ||
| CHEMBL5397144 | 195129 | None | 0 | Human | Functional | pEC50 | = | 9.8 | 9.8 | - | 1 | Agonist activity at human BB1 in human HEK293T cells assessed as increase in intracellular calcium response and measured for 3 mins by FLIPR calcium 6 assayAgonist activity at human BB1 in human HEK293T cells assessed as increase in intracellular calcium response and measured for 3 mins by FLIPR calcium 6 assay |
ChEMBL | 1103 | 32 | 13 | 12 | -0.4 | CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccccc1)C(C)C)C(N)=O | 10.1021/acs.jmedchem.3c00323 | ||
| CHEMBL525577 | 218143 | None | 0 | Human | Functional | pEC50 | = | 9.3 | 9.3 | -9 | 3 | Agonist activity at recombinant neuromedin B receptor expressed in baculovirus-transduced HEK293 cells assessed as intracellular calcium mobilization by FLIPR assayAgonist activity at recombinant neuromedin B receptor expressed in baculovirus-transduced HEK293 cells assessed as intracellular calcium mobilization by FLIPR assay |
ChEMBL | None | None | None | CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H](C)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](N)Cc1ccccc1)C(C)C)C(N)=O | 10.1016/j.bmcl.2008.09.033 | ||||
| CHEMBL403317 | 214990 | None | 22 | Human | Functional | pEC50 | = | 6.9 | 6.9 | -169 | 4 | Effective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assayEffective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assay |
ChEMBL | None | None | None | CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(N)=O)NC(=O)CN)[C@@H](C)O)C(N)=O | 10.1021/jm0210921 | ||||
| 44333515 | 4747 | None | 0 | Human | Functional | pEC50 | = | 6.9 | 6.9 | - | 1 | Agonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphateAgonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphate |
ChEMBL | 635 | 9 | 4 | 4 | 7.9 | COc1cccc2[nH]c3c(c12)CC(NC(=O)Nc1c(C(C)C)cccc1C(C)C)(C(=O)NCC1(c2ccccn2)CCCCC1)CC3 | 10.1016/j.bmcl.2004.04.045 | ||
| CHEMBL103756 | 4747 | None | 0 | Human | Functional | pEC50 | = | 6.9 | 6.9 | - | 1 | Agonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphateAgonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphate |
ChEMBL | 635 | 9 | 4 | 4 | 7.9 | COc1cccc2[nH]c3c(c12)CC(NC(=O)Nc1c(C(C)C)cccc1C(C)C)(C(=O)NCC1(c2ccccn2)CCCCC1)CC3 | 10.1016/j.bmcl.2004.04.045 | ||
| 90663970 | 106847 | None | 0 | Human | Functional | pEC50 | = | 4.8 | 4.8 | -12 | 3 | Effective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assayEffective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assay |
ChEMBL | 553 | 14 | 5 | 4 | 2.5 | NC(=O)CC[C@H](NC(=O)Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1 | 10.1021/jm0210921 | ||
| CHEMBL3144503 | 106847 | None | 0 | Human | Functional | pEC50 | = | 4.8 | 4.8 | -12 | 3 | Effective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assayEffective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assay |
ChEMBL | 553 | 14 | 5 | 4 | 2.5 | NC(=O)CC[C@H](NC(=O)Cc1ccccc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1 | 10.1021/jm0210921 | ||
| 44333515 | 4747 | None | 0 | Human | Functional | pEC50 | = | 7.8 | 7.8 | - | 1 | Agonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphateAgonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphate |
ChEMBL | 635 | 9 | 4 | 4 | 7.9 | COc1cccc2[nH]c3c(c12)CC(NC(=O)Nc1c(C(C)C)cccc1C(C)C)(C(=O)NCC1(c2ccccn2)CCCCC1)CC3 | 10.1016/j.bmcl.2004.04.045 | ||
| CHEMBL103756 | 4747 | None | 0 | Human | Functional | pEC50 | = | 7.8 | 7.8 | - | 1 | Agonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphateAgonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphate |
ChEMBL | 635 | 9 | 4 | 4 | 7.9 | COc1cccc2[nH]c3c(c12)CC(NC(=O)Nc1c(C(C)C)cccc1C(C)C)(C(=O)NCC1(c2ccccn2)CCCCC1)CC3 | 10.1016/j.bmcl.2004.04.045 | ||
| 90663965 | 106842 | None | 0 | Human | Functional | pEC50 | = | 4.7 | 4.7 | -13 | 3 | Effective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assayEffective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assay |
ChEMBL | 587 | 14 | 5 | 4 | 3.2 | NC(=O)CC[C@H](NC(=O)Cc1ccc(Cl)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1 | 10.1021/jm0210921 | ||
| CHEMBL3144498 | 106842 | None | 0 | Human | Functional | pEC50 | = | 4.7 | 4.7 | -13 | 3 | Effective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assayEffective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assay |
ChEMBL | 587 | 14 | 5 | 4 | 3.2 | NC(=O)CC[C@H](NC(=O)Cc1ccc(Cl)cc1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCc1ccccc1 | 10.1021/jm0210921 | ||
| 44333515 | 4747 | None | 0 | Human | Functional | pEC50 | = | 5.7 | 5.7 | - | 1 | Agonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphateAgonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphate |
ChEMBL | 635 | 9 | 4 | 4 | 7.9 | COc1cccc2[nH]c3c(c12)CC(NC(=O)Nc1c(C(C)C)cccc1C(C)C)(C(=O)NCC1(c2ccccn2)CCCCC1)CC3 | 10.1016/j.bmcl.2004.04.045 | ||
| CHEMBL103756 | 4747 | None | 0 | Human | Functional | pEC50 | = | 5.7 | 5.7 | - | 1 | Agonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphateAgonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphate |
ChEMBL | 635 | 9 | 4 | 4 | 7.9 | COc1cccc2[nH]c3c(c12)CC(NC(=O)Nc1c(C(C)C)cccc1C(C)C)(C(=O)NCC1(c2ccccn2)CCCCC1)CC3 | 10.1016/j.bmcl.2004.04.045 | ||
| 44300286 | 96612 | None | 0 | Human | Functional | pEC50 | = | 6.5 | 6.5 | -3 | 3 | Effective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assayEffective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assay |
ChEMBL | 1106 | 31 | 11 | 12 | 2.1 | CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CCNC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)C(=O)O | 10.1021/jm0210921 | ||
| CHEMBL262992 | 96612 | None | 0 | Human | Functional | pEC50 | = | 6.5 | 6.5 | -3 | 3 | Effective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assayEffective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assay |
ChEMBL | 1106 | 31 | 11 | 12 | 2.1 | CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CCNC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](N)Cc1ccc(O)cc1)C(C)C)C(=O)O | 10.1021/jm0210921 | ||
| CHEMBL438926 | 216272 | None | 15 | Human | Functional | pEC50 | = | 5.5 | 5.5 | -93 | 3 | Effective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assayEffective concentration required against nueromedin B receptor (NMB-R) in CHO cells by using FLIPR assay |
ChEMBL | None | None | None | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CC(N)=O)NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)CNC(=O)[C@H](C)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(C)C)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)[C@@H](C)O)C(C)C)[C@@H](C)O)C(C)C)C(N)=O | 10.1021/jm0210921 | ||||
| 44334117 | 107551 | None | 0 | Human | Functional | pEC50 | = | 6.2 | 6.2 | - | 1 | Agonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphateAgonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphate |
ChEMBL | 605 | 8 | 4 | 3 | 7.9 | CC(C)c1cccc(C(C)C)c1NC(=O)NC1(C(=O)NCC2(c3ccccn3)CCCCC2)CCc2[nH]c3ccccc3c2C1 | 10.1016/j.bmcl.2004.04.045 | ||
| CHEMBL318548 | 107551 | None | 0 | Human | Functional | pEC50 | = | 6.2 | 6.2 | - | 1 | Agonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphateAgonistic activity was determined against human Neuromedin B receptor transfected in HEK293 cells as accumulation levels of inositol phosphate |
ChEMBL | 605 | 8 | 4 | 3 | 7.9 | CC(C)c1cccc(C(C)C)c1NC(=O)NC1(C(=O)NCC2(c3ccccn3)CCCCC2)CCc2[nH]c3ccccc3c2C1 | 10.1016/j.bmcl.2004.04.045 | ||
| 3622597 | 197871 | None | 14 | Human | Functional | pIC50 | = | 5.3 | 5.3 | - | 1 | Antagonist activity at human neuromedin B receptor transfected in HEK293 cells assessed as inhibition of 1 nM neuromedin B-induced myo-[3H]inositol phosphate accumulation after 60 mins by scintillation proximity assayAntagonist activity at human neuromedin B receptor transfected in HEK293 cells assessed as inhibition of 1 nM neuromedin B-induced myo-[3H]inositol phosphate accumulation after 60 mins by scintillation proximity assay |
ChEMBL | 384 | 1 | 2 | 3 | 6.0 | Cc1ccc2c(c1)NC(c1c(F)cccc1Cl)C1=C(CC(C)(C)CC1=O)N2 | 10.1016/j.bmcl.2009.05.124 | ||
| CHEMBL552189 | 197871 | None | 14 | Human | Functional | pIC50 | = | 5.3 | 5.3 | - | 1 | Antagonist activity at human neuromedin B receptor transfected in HEK293 cells assessed as inhibition of 1 nM neuromedin B-induced myo-[3H]inositol phosphate accumulation after 60 mins by scintillation proximity assayAntagonist activity at human neuromedin B receptor transfected in HEK293 cells assessed as inhibition of 1 nM neuromedin B-induced myo-[3H]inositol phosphate accumulation after 60 mins by scintillation proximity assay |
ChEMBL | 384 | 1 | 2 | 3 | 6.0 | Cc1ccc2c(c1)NC(c1c(F)cccc1Cl)C1=C(CC(C)(C)CC1=O)N2 | 10.1016/j.bmcl.2009.05.124 | ||
| 44250209 | 198943 | None | 0 | Human | Functional | pIC50 | = | 6.2 | 6.2 | - | 1 | Antagonist activity at human neuromedin B receptor transfected in HEK293 cells assessed as inhibition of 1 nM neuromedin B-induced myo-[3H]inositol phosphate accumulation after 60 mins by scintillation proximity assayAntagonist activity at human neuromedin B receptor transfected in HEK293 cells assessed as inhibition of 1 nM neuromedin B-induced myo-[3H]inositol phosphate accumulation after 60 mins by scintillation proximity assay |
ChEMBL | 426 | 1 | 2 | 3 | 6.8 | Cc1ccc2c(c1)NC(c1ccccc1C(F)(F)F)C1=C(CC3(CCCC3)CC1=O)N2 | 10.1016/j.bmcl.2009.05.124 | ||
| CHEMBL563374 | 198943 | None | 0 | Human | Functional | pIC50 | = | 6.2 | 6.2 | - | 1 | Antagonist activity at human neuromedin B receptor transfected in HEK293 cells assessed as inhibition of 1 nM neuromedin B-induced myo-[3H]inositol phosphate accumulation after 60 mins by scintillation proximity assayAntagonist activity at human neuromedin B receptor transfected in HEK293 cells assessed as inhibition of 1 nM neuromedin B-induced myo-[3H]inositol phosphate accumulation after 60 mins by scintillation proximity assay |
ChEMBL | 426 | 1 | 2 | 3 | 6.8 | Cc1ccc2c(c1)NC(c1ccccc1C(F)(F)F)C1=C(CC3(CCCC3)CC1=O)N2 | 10.1016/j.bmcl.2009.05.124 | ||
| CHEMBL403317 | 214990 | None | 22 | Human | Functional | pKi | = | 10.2 | 10.2 | -169 | 4 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | None | None | None | CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(N)=O)NC(=O)CN)[C@@H](C)O)C(N)=O | 10.1016/s0960-894x(98)00462-4 | ||||
| 621 | 3035 | None | 27 | Human | Functional | pKi | = | 9.8 | 9.8 | 117 | 6 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 554 | 9 | 4 | 5 | 5.6 | O=C(N[C@](C(=O)NCC1(CCCCC1)c1ccccn1)(Cc1c[nH]c2c1cccc2)C)Nc1ccc(cc1)[N+](=O)[O-] | 10.1016/s0960-894x(98)00462-4 | ||
| 9937534 | 3035 | None | 27 | Human | Functional | pKi | = | 9.8 | 9.8 | 117 | 6 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 554 | 9 | 4 | 5 | 5.6 | O=C(N[C@](C(=O)NCC1(CCCCC1)c1ccccn1)(Cc1c[nH]c2c1cccc2)C)Nc1ccc(cc1)[N+](=O)[O-] | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL329650 | 3035 | None | 27 | Human | Functional | pKi | = | 9.8 | 9.8 | 117 | 6 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 554 | 9 | 4 | 5 | 5.6 | O=C(N[C@](C(=O)NCC1(CCCCC1)c1ccccn1)(Cc1c[nH]c2c1cccc2)C)Nc1ccc(cc1)[N+](=O)[O-] | 10.1016/s0960-894x(98)00462-4 | ||
| 626 | 3036 | None | 31 | Human | Functional | pKi | = | 9.8 | 9.8 | 125 | 2 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 584 | 10 | 4 | 6 | 5.6 | COc1ccc(nc1)C1(CCCCC1)CNC(=O)[C@](Cc1c[nH]c2c1cccc2)(NC(=O)Nc1ccc(cc1)[N+](=O)[O-])C | 10.1016/s0960-894x(98)00462-4 | ||
| 9829828 | 3036 | None | 31 | Human | Functional | pKi | = | 9.8 | 9.8 | 125 | 2 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 584 | 10 | 4 | 6 | 5.6 | COc1ccc(nc1)C1(CCCCC1)CNC(=O)[C@](Cc1c[nH]c2c1cccc2)(NC(=O)Nc1ccc(cc1)[N+](=O)[O-])C | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL405908 | 3036 | None | 31 | Human | Functional | pKi | = | 9.8 | 9.8 | 125 | 2 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 584 | 10 | 4 | 6 | 5.6 | COc1ccc(nc1)C1(CCCCC1)CNC(=O)[C@](Cc1c[nH]c2c1cccc2)(NC(=O)Nc1ccc(cc1)[N+](=O)[O-])C | 10.1016/s0960-894x(98)00462-4 | ||
| 44321212 | 111491 | None | 0 | Human | Functional | pKi | = | 9.5 | 9.5 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 598 | 10 | 4 | 6 | 6.1 | C[C@@](Cc1c[nH]c2ccccc12)(NC(=O)Nc1ccc([N+](=O)[O-])cc1)C(=O)NCC1(c2ccc([N+](=O)[O-])cc2)CCCCC1 | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL327388 | 111491 | None | 0 | Human | Functional | pKi | = | 9.5 | 9.5 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 598 | 10 | 4 | 6 | 6.1 | C[C@@](Cc1c[nH]c2ccccc12)(NC(=O)Nc1ccc([N+](=O)[O-])cc1)C(=O)NCC1(c2ccc([N+](=O)[O-])cc2)CCCCC1 | 10.1016/s0960-894x(98)00462-4 | ||
| 44321034 | 111576 | None | 0 | Human | Functional | pKi | = | 9.5 | 9.5 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 534 | 8 | 4 | 4 | 5.6 | C[C@@](Cc1c[nH]c2ccccc12)(NC(=O)Nc1ccc(C#N)cc1)C(=O)NCC1(c2ccccn2)CCCCC1 | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL327840 | 111576 | None | 0 | Human | Functional | pKi | = | 9.5 | 9.5 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 534 | 8 | 4 | 4 | 5.6 | C[C@@](Cc1c[nH]c2ccccc12)(NC(=O)Nc1ccc(C#N)cc1)C(=O)NCC1(c2ccccn2)CCCCC1 | 10.1016/s0960-894x(98)00462-4 | ||
| 44321211 | 208637 | None | 0 | Human | Functional | pKi | = | 9.4 | 9.4 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 553 | 9 | 4 | 4 | 6.2 | C[C@@](Cc1c[nH]c2ccccc12)(NC(=O)Nc1ccc([N+](=O)[O-])cc1)C(=O)NCC1(c2ccccc2)CCCCC1 | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL86370 | 208637 | None | 0 | Human | Functional | pKi | = | 9.4 | 9.4 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 553 | 9 | 4 | 4 | 6.2 | C[C@@](Cc1c[nH]c2ccccc12)(NC(=O)Nc1ccc([N+](=O)[O-])cc1)C(=O)NCC1(c2ccccc2)CCCCC1 | 10.1016/s0960-894x(98)00462-4 | ||
| 44321244 | 208519 | None | 0 | Human | Functional | pKi | = | 9.4 | 9.4 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 613 | 11 | 4 | 6 | 6.2 | COc1ccc(C2(CNC(=O)[C@](C)(Cc3c[nH]c4ccccc34)NC(=O)Nc3ccc([N+](=O)[O-])cc3)CCCCC2)cc1OC | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL85400 | 208519 | None | 0 | Human | Functional | pKi | = | 9.4 | 9.4 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 613 | 11 | 4 | 6 | 6.2 | COc1ccc(C2(CNC(=O)[C@](C)(Cc3c[nH]c4ccccc34)NC(=O)Nc3ccc([N+](=O)[O-])cc3)CCCCC2)cc1OC | 10.1016/s0960-894x(98)00462-4 | ||
| 44321006 | 106007 | None | 0 | Human | Functional | pKi | = | 9.3 | 9.3 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 583 | 10 | 4 | 5 | 6.2 | COc1ccc(C2(CNC(=O)[C@](C)(Cc3c[nH]c4ccccc34)NC(=O)Nc3ccc([N+](=O)[O-])cc3)CCCCC2)cc1 | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL312926 | 106007 | None | 0 | Human | Functional | pKi | = | 9.3 | 9.3 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 583 | 10 | 4 | 5 | 6.2 | COc1ccc(C2(CNC(=O)[C@](C)(Cc3c[nH]c4ccccc34)NC(=O)Nc3ccc([N+](=O)[O-])cc3)CCCCC2)cc1 | 10.1016/s0960-894x(98)00462-4 | ||
| 44321039 | 168266 | None | 0 | Human | Functional | pKi | = | 9.3 | 9.3 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 596 | 10 | 4 | 5 | 6.3 | CN(C)c1ccc(C2(CNC(=O)[C@](C)(Cc3c[nH]c4ccccc34)NC(=O)Nc3ccc([N+](=O)[O-])cc3)CCCCC2)cc1 | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL433143 | 168266 | None | 0 | Human | Functional | pKi | = | 9.3 | 9.3 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 596 | 10 | 4 | 5 | 6.3 | CN(C)c1ccc(C2(CNC(=O)[C@](C)(Cc3c[nH]c4ccccc34)NC(=O)Nc3ccc([N+](=O)[O-])cc3)CCCCC2)cc1 | 10.1016/s0960-894x(98)00462-4 | ||
| 44321245 | 208510 | None | 0 | Human | Functional | pKi | = | 9.2 | 9.2 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 597 | 11 | 4 | 5 | 6.6 | CCOc1ccc(C2(CNC(=O)[C@](C)(Cc3c[nH]c4ccccc34)NC(=O)Nc3ccc([N+](=O)[O-])cc3)CCCCC2)cc1 | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL85291 | 208510 | None | 0 | Human | Functional | pKi | = | 9.2 | 9.2 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 597 | 11 | 4 | 5 | 6.6 | CCOc1ccc(C2(CNC(=O)[C@](C)(Cc3c[nH]c4ccccc34)NC(=O)Nc3ccc([N+](=O)[O-])cc3)CCCCC2)cc1 | 10.1016/s0960-894x(98)00462-4 | ||
| 44321158 | 208873 | None | 0 | Human | Functional | pKi | = | 9.2 | 9.2 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 569 | 9 | 5 | 5 | 5.9 | C[C@@](Cc1c[nH]c2ccccc12)(NC(=O)Nc1ccc([N+](=O)[O-])cc1)C(=O)NCC1(c2ccc(O)cc2)CCCCC1 | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL87846 | 208873 | None | 0 | Human | Functional | pKi | = | 9.2 | 9.2 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 569 | 9 | 5 | 5 | 5.9 | C[C@@](Cc1c[nH]c2ccccc12)(NC(=O)Nc1ccc([N+](=O)[O-])cc1)C(=O)NCC1(c2ccc(O)cc2)CCCCC1 | 10.1016/s0960-894x(98)00462-4 | ||
| 44321246 | 106122 | None | 0 | Human | Functional | pKi | = | 9.0 | 9.0 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 554 | 9 | 4 | 5 | 5.6 | C[C@@](Cc1c[nH]c2ccccc12)(NC(=O)Nc1cccc([N+](=O)[O-])c1)C(=O)NCC1(c2ccccn2)CCCCC1 | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL313346 | 106122 | None | 0 | Human | Functional | pKi | = | 9.0 | 9.0 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 554 | 9 | 4 | 5 | 5.6 | C[C@@](Cc1c[nH]c2ccccc12)(NC(=O)Nc1cccc([N+](=O)[O-])c1)C(=O)NCC1(c2ccccn2)CCCCC1 | 10.1016/s0960-894x(98)00462-4 | ||
| 44321117 | 106028 | None | 0 | Human | Functional | pKi | = | 8.8 | 8.8 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 595 | 10 | 4 | 4 | 7.3 | CC(C)c1ccc(C2(CNC(=O)[C@](C)(Cc3c[nH]c4ccccc34)NC(=O)Nc3ccc([N+](=O)[O-])cc3)CCCCC2)cc1 | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL313030 | 106028 | None | 0 | Human | Functional | pKi | = | 8.8 | 8.8 | - | 0 | Antagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cellsAntagonism of recombinant human bombesin receptor (bb1) labeled with [125I]- [Tyr] bombesin stably expressed in CHO cells |
ChEMBL | 595 | 10 | 4 | 4 | 7.3 | CC(C)c1ccc(C2(CNC(=O)[C@](C)(Cc3c[nH]c4ccccc34)NC(=O)Nc3ccc([N+](=O)[O-])cc3)CCCCC2)cc1 | 10.1016/s0960-894x(98)00462-4 | ||
Showing 1 to 50 of 131 entries
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 117745230 | 142619 | None | 0 | Rat | Binding | pIC50 | = | 10.2 | 10.2 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1523 | 40 | 17 | 21 | -3.0 | CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(C)C)NC(=O)c1ccc(NC(=O)CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)O)C(N)=O | nan | ||
| CHEMBL3890803 | 142619 | None | 0 | Rat | Binding | pIC50 | = | 10.2 | 10.2 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1523 | 40 | 17 | 21 | -3.0 | CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(C)C)NC(=O)c1ccc(NC(=O)CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)O)C(N)=O | nan | ||
| CHEMBL3944194 | 214934 | None | 0 | Rat | Binding | pIC50 | = | 9.8 | 9.8 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | None | None | None | CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(N)=O)NC(=O)CNC(=O)[C@@H](N)Cc1ccc(O)cc1)[C@@H](C)O)C(N)=O | nan | ||||
| 134145000 | 150376 | None | 0 | Rat | Binding | pIC50 | = | 9.7 | 9.7 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1501 | 43 | 16 | 22 | -3.6 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NCc1ccc(C(=O)C(=O)CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)C)C(N)=O | nan | ||
| CHEMBL3952732 | 150376 | None | 0 | Rat | Binding | pIC50 | = | 9.7 | 9.7 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1501 | 43 | 16 | 22 | -3.6 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NCc1ccc(C(=O)C(=O)CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)C)C(N)=O | nan | ||
| 134156977 | 154069 | None | 0 | Rat | Binding | pIC50 | = | 9.5 | 9.5 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1604 | 43 | 17 | 21 | -2.3 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1CC[C@H](CNC(=O)[C@H]2CC[C@H](CNC(=O)CN3CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC3)CC2)CC1)C(C)C)C(N)=O | nan | ||
| CHEMBL3983862 | 154069 | None | 0 | Rat | Binding | pIC50 | = | 9.5 | 9.5 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1604 | 43 | 17 | 21 | -2.3 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H]1CC[C@H](CNC(=O)[C@H]2CC[C@H](CNC(=O)CN3CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC3)CC2)CC1)C(C)C)C(N)=O | nan | ||
| 626 | 3036 | None | 31 | Human | Binding | pIC50 | = | 9.2 | 9.2 | 5 | 2 | Antagonistic activity against labelled Bombesin receptor bb1 binding sites in rat olfactory bulb by using [125I]- [Tyr] bombesin in presence of [D-Phe-6] bombesin(6-13)ethyl ester; 0.31-1.3Antagonistic activity against labelled Bombesin receptor bb1 binding sites in rat olfactory bulb by using [125I]- [Tyr] bombesin in presence of [D-Phe-6] bombesin(6-13)ethyl ester; 0.31-1.3 |
ChEMBL | 584 | 10 | 4 | 6 | 5.6 | COc1ccc(nc1)C1(CCCCC1)CNC(=O)[C@](Cc1c[nH]c2c1cccc2)(NC(=O)Nc1ccc(cc1)[N+](=O)[O-])C | 10.1016/s0960-894x(98)00462-4 | ||
| 9829828 | 3036 | None | 31 | Human | Binding | pIC50 | = | 9.2 | 9.2 | 5 | 2 | Antagonistic activity against labelled Bombesin receptor bb1 binding sites in rat olfactory bulb by using [125I]- [Tyr] bombesin in presence of [D-Phe-6] bombesin(6-13)ethyl ester; 0.31-1.3Antagonistic activity against labelled Bombesin receptor bb1 binding sites in rat olfactory bulb by using [125I]- [Tyr] bombesin in presence of [D-Phe-6] bombesin(6-13)ethyl ester; 0.31-1.3 |
ChEMBL | 584 | 10 | 4 | 6 | 5.6 | COc1ccc(nc1)C1(CCCCC1)CNC(=O)[C@](Cc1c[nH]c2c1cccc2)(NC(=O)Nc1ccc(cc1)[N+](=O)[O-])C | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL405908 | 3036 | None | 31 | Human | Binding | pIC50 | = | 9.2 | 9.2 | 5 | 2 | Antagonistic activity against labelled Bombesin receptor bb1 binding sites in rat olfactory bulb by using [125I]- [Tyr] bombesin in presence of [D-Phe-6] bombesin(6-13)ethyl ester; 0.31-1.3Antagonistic activity against labelled Bombesin receptor bb1 binding sites in rat olfactory bulb by using [125I]- [Tyr] bombesin in presence of [D-Phe-6] bombesin(6-13)ethyl ester; 0.31-1.3 |
ChEMBL | 584 | 10 | 4 | 6 | 5.6 | COc1ccc(nc1)C1(CCCCC1)CNC(=O)[C@](Cc1c[nH]c2c1cccc2)(NC(=O)Nc1ccc(cc1)[N+](=O)[O-])C | 10.1016/s0960-894x(98)00462-4 | ||
| CHEMBL403317 | 214990 | None | 22 | Rat | Binding | pIC50 | = | 9.2 | 9.2 | - | 2 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | None | None | None | CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(N)=O)NC(=O)CN)[C@@H](C)O)C(N)=O | nan | ||||
| 117745218 | 150213 | None | 0 | Rat | Binding | pIC50 | = | 9.1 | 9.1 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1536 | 41 | 17 | 21 | -3.1 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1ccc(NC(=O)CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c(Cl)c1)C(C)C)C(N)=O | nan | ||
| CHEMBL3951222 | 150213 | None | 0 | Rat | Binding | pIC50 | = | 9.1 | 9.1 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1536 | 41 | 17 | 21 | -3.1 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1ccc(NC(=O)CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c(Cl)c1)C(C)C)C(N)=O | nan | ||
| 117745209 | 152990 | None | 0 | Rat | Binding | pIC50 | = | 9.1 | 9.1 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1516 | 42 | 17 | 21 | -4.0 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1ccc(C(=O)NCCNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)C)C(N)=O | nan | ||
| CHEMBL3974709 | 152990 | None | 0 | Rat | Binding | pIC50 | = | 9.1 | 9.1 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1516 | 42 | 17 | 21 | -4.0 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1ccc(C(=O)NCCNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)C)C(N)=O | nan | ||
| 11389266 | 161899 | None | 0 | Human | Binding | pIC50 | = | 9.1 | 9.1 | - | 0 | Inhibition of tachykinin receptor 3 expressed in human ileal carcinoid cellsInhibition of tachykinin receptor 3 expressed in human ileal carcinoid cells |
ChEMBL | 1303 | 44 | 17 | 18 | -2.7 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)COCC(=O)Nc1ccc(CC(CNCCN)CNCCN)cc1)C(C)C)C(N)=O | 10.1021/jm049437y | ||
| CHEMBL414307 | 161899 | None | 0 | Human | Binding | pIC50 | = | 9.1 | 9.1 | - | 0 | Inhibition of tachykinin receptor 3 expressed in human ileal carcinoid cellsInhibition of tachykinin receptor 3 expressed in human ileal carcinoid cells |
ChEMBL | 1303 | 44 | 17 | 18 | -2.7 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)COCC(=O)Nc1ccc(CC(CNCCN)CNCCN)cc1)C(C)C)C(N)=O | 10.1021/jm049437y | ||
| CHEMBL413893 | 215559 | None | 0 | Human | Binding | pIC50 | = | 9.0 | 9.0 | - | 0 | Inhibition of tachykinin receptor 3 expressed in human ileal carcinoid cellsInhibition of tachykinin receptor 3 expressed in human ileal carcinoid cells |
ChEMBL | None | None | None | CCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(C)C)C(N)=O | 10.1021/jm049437y | ||||
| 117745205 | 150518 | None | 0 | Rat | Binding | pIC50 | = | 8.9 | 8.9 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1502 | 41 | 17 | 21 | -3.7 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)c1ccc(NC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)C)C(N)=O | nan | ||
| CHEMBL3953912 | 150518 | None | 0 | Rat | Binding | pIC50 | = | 8.9 | 8.9 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1502 | 41 | 17 | 21 | -3.7 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)c1ccc(NC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)C)C(N)=O | nan | ||
| 87217693 | 151362 | None | 0 | Rat | Binding | pIC50 | = | 8.9 | 8.9 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1489 | 41 | 16 | 21 | -3.2 | COc1cc(C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](Cc2cnc[nH]2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(N)=O)C(C)C)ccc1CNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 | nan | ||
| CHEMBL3960359 | 151362 | None | 0 | Rat | Binding | pIC50 | = | 8.9 | 8.9 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1489 | 41 | 16 | 21 | -3.2 | COc1cc(C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](Cc2cnc[nH]2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(N)=O)C(C)C)ccc1CNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 | nan | ||
| 134153902 | 152644 | None | 0 | Rat | Binding | pIC50 | = | 8.9 | 8.9 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1592 | 42 | 17 | 21 | -1.8 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1ccc(-c2ccc(NC(=O)CNC(=O)CN3CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC3)cc2C)cc1)C(C)C)C(N)=O | nan | ||
| CHEMBL3971676 | 152644 | None | 0 | Rat | Binding | pIC50 | = | 8.9 | 8.9 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1592 | 42 | 17 | 21 | -1.8 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1ccc(-c2ccc(NC(=O)CNC(=O)CN3CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC3)cc2C)cc1)C(C)C)C(N)=O | nan | ||
| 87217854 | 144334 | None | 0 | Rat | Binding | pIC50 | = | 8.8 | 8.8 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1516 | 41 | 16 | 21 | -3.7 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1ccc(N(C)C(=O)CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)C)C(N)=O | nan | ||
| CHEMBL3904706 | 144334 | None | 0 | Rat | Binding | pIC50 | = | 8.8 | 8.8 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1516 | 41 | 16 | 21 | -3.7 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1ccc(N(C)C(=O)CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)C)C(N)=O | nan | ||
| 16154477 | 150462 | None | 0 | Rat | Binding | pIC50 | = | 8.8 | 8.8 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1502 | 41 | 17 | 21 | -3.7 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1ccc(NC(=O)CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)C)C(N)=O | nan | ||
| CHEMBL3953323 | 150462 | None | 0 | Rat | Binding | pIC50 | = | 8.8 | 8.8 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1502 | 41 | 17 | 21 | -3.7 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1ccc(NC(=O)CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)C)C(N)=O | nan | ||
| 87217796 | 149035 | None | 0 | Rat | Binding | pIC50 | = | 8.8 | 8.8 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1502 | 41 | 17 | 21 | -3.7 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1cccc(NC(=O)CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c1)C(C)C)C(N)=O | nan | ||
| CHEMBL3941990 | 149035 | None | 0 | Rat | Binding | pIC50 | = | 8.8 | 8.8 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1502 | 41 | 17 | 21 | -3.7 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1cccc(NC(=O)CNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)c1)C(C)C)C(N)=O | nan | ||
| CHEMBL2371725 | 212577 | None | 0 | Human | Binding | pIC50 | = | 8.8 | 8.8 | - | 0 | Inhibition of tachykinin receptor 3 expressed in human ileal carcinoid cellsInhibition of tachykinin receptor 3 expressed in human ileal carcinoid cells |
ChEMBL | None | None | None | CSCCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)C(CNCCN)CNCCN)C(C)C)C(N)=O | 10.1021/jm049437y | ||||
| 134131431 | 142462 | None | 0 | Rat | Binding | pIC50 | = | 8.8 | 8.8 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1583 | 40 | 15 | 23 | -3.1 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)Cn1c(=O)n(C2CCN(C(=O)CN3CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC3)CC2)c2ccccc21)C(C)C)C(N)=O | nan | ||
| CHEMBL3889538 | 142462 | None | 0 | Rat | Binding | pIC50 | = | 8.8 | 8.8 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1583 | 40 | 15 | 23 | -3.1 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)Cn1c(=O)n(C2CCN(C(=O)CN3CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC3)CC2)c2ccccc21)C(C)C)C(N)=O | nan | ||
| 87217644 | 143804 | None | 0 | Rat | Binding | pIC50 | = | 8.7 | 8.7 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1489 | 42 | 16 | 21 | -3.3 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1ccc(OCCNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)C)C(N)=O | nan | ||
| CHEMBL3900523 | 143804 | None | 0 | Rat | Binding | pIC50 | = | 8.7 | 8.7 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1489 | 42 | 16 | 21 | -3.3 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)c1ccc(OCCNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)cc1)C(C)C)C(N)=O | nan | ||
| 134154031 | 152946 | None | 0 | Rat | Binding | pIC50 | = | 8.0 | 8.0 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1517 | 48 | 21 | 23 | -8.2 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CSCNC(C)=O)NC(=O)[C@H](CO)NC(=O)CN(C)C)C(C)C)C(N)=O | nan | ||
| CHEMBL3974250 | 152946 | None | 0 | Rat | Binding | pIC50 | = | 8.0 | 8.0 | - | 0 | Displacement of [125I]-NMB from NMB receptor in rat C6 cellsDisplacement of [125I]-NMB from NMB receptor in rat C6 cells |
ChEMBL | 1517 | 48 | 21 | 23 | -8.2 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CSCNC(C)=O)NC(=O)[C@H](CO)NC(=O)CN(C)C)C(C)C)C(N)=O | nan | ||
| 44333639 | 4729 | None | 0 | Human | Binding | pIC50 | = | 5 | 5.0 | - | 0 | Affinity of [125I][D-Tyr0]-NMB to human Neuromedin B receptor expressed in HEK293 cellsAffinity of [125I][D-Tyr0]-NMB to human Neuromedin B receptor expressed in HEK293 cells |
ChEMBL | 526 | 7 | 4 | 5 | 4.6 | CC(C)(CNC(=O)C1(NC(=O)Nc2ccc([N+](=O)[O-])cc2)CCc2[nH]c3ccccc3c2C1)c1ccccn1 | 10.1016/j.bmcl.2004.04.045 | ||
| CHEMBL103594 | 4729 | None | 0 | Human | Binding | pIC50 | = | 5 | 5.0 | - | 0 | Affinity of [125I][D-Tyr0]-NMB to human Neuromedin B receptor expressed in HEK293 cellsAffinity of [125I][D-Tyr0]-NMB to human Neuromedin B receptor expressed in HEK293 cells |
ChEMBL | 526 | 7 | 4 | 5 | 4.6 | CC(C)(CNC(=O)C1(NC(=O)Nc2ccc([N+](=O)[O-])cc2)CCc2[nH]c3ccccc3c2C1)c1ccccn1 | 10.1016/j.bmcl.2004.04.045 | ||
| 45271538 | 197768 | None | 0 | Human | Binding | pIC50 | = | 5 | 5.0 | - | 0 | Displacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cellsDisplacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cells |
ChEMBL | 398 | 1 | 1 | 3 | 6.0 | Cc1ccc2c(c1)NC(c1c(F)cccc1Cl)C1=C(CC(C)(C)CC1=O)N2C | 10.1016/j.bmcl.2009.05.124 | ||
| CHEMBL551511 | 197768 | None | 0 | Human | Binding | pIC50 | = | 5 | 5.0 | - | 0 | Displacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cellsDisplacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cells |
ChEMBL | 398 | 1 | 1 | 3 | 6.0 | Cc1ccc2c(c1)NC(c1c(F)cccc1Cl)C1=C(CC(C)(C)CC1=O)N2C | 10.1016/j.bmcl.2009.05.124 | ||
| 45273304 | 198361 | None | 0 | Human | Binding | pIC50 | = | 5 | 5.0 | - | 0 | Displacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cellsDisplacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cells |
ChEMBL | 386 | 1 | 3 | 4 | 5.4 | CC1(C)CC(=O)C2=C(C1)Nc1ccc(O)cc1NC2c1c(F)cccc1Cl | 10.1016/j.bmcl.2009.05.124 | ||
| CHEMBL559093 | 198361 | None | 0 | Human | Binding | pIC50 | = | 5 | 5.0 | - | 0 | Displacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cellsDisplacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cells |
ChEMBL | 386 | 1 | 3 | 4 | 5.4 | CC1(C)CC(=O)C2=C(C1)Nc1ccc(O)cc1NC2c1c(F)cccc1Cl | 10.1016/j.bmcl.2009.05.124 | ||
| 45273305 | 198933 | None | 0 | Human | Binding | pIC50 | = | 5 | 5.0 | - | 0 | Displacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cellsDisplacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cells |
ChEMBL | 413 | 2 | 3 | 4 | 4.8 | CC1(C)CC(=O)C2=C(C1)Nc1ccc(C(N)=O)cc1NC2c1c(F)cccc1Cl | 10.1016/j.bmcl.2009.05.124 | ||
| CHEMBL563295 | 198933 | None | 0 | Human | Binding | pIC50 | = | 5 | 5.0 | - | 0 | Displacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cellsDisplacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cells |
ChEMBL | 413 | 2 | 3 | 4 | 4.8 | CC1(C)CC(=O)C2=C(C1)Nc1ccc(C(N)=O)cc1NC2c1c(F)cccc1Cl | 10.1016/j.bmcl.2009.05.124 | ||
| 45272454 | 198971 | None | 0 | Human | Binding | pIC50 | = | 5 | 5.0 | - | 0 | Displacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cellsDisplacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cells |
ChEMBL | 342 | 1 | 2 | 3 | 5.0 | Cc1ccc2c(c1)NC(c1c(F)cccc1Cl)C1=C(CCC1=O)N2 | 10.1016/j.bmcl.2009.05.124 | ||
| CHEMBL563540 | 198971 | None | 0 | Human | Binding | pIC50 | = | 5 | 5.0 | - | 0 | Displacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cellsDisplacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cells |
ChEMBL | 342 | 1 | 2 | 3 | 5.0 | Cc1ccc2c(c1)NC(c1c(F)cccc1Cl)C1=C(CCC1=O)N2 | 10.1016/j.bmcl.2009.05.124 | ||
| 45267289 | 198984 | None | 0 | Human | Binding | pIC50 | = | 5 | 5.0 | - | 0 | Displacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cellsDisplacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cells |
ChEMBL | 414 | 2 | 3 | 4 | 5.4 | CC1(C)CC(=O)C2=C(C1)Nc1ccc(C(=O)O)cc1NC2c1c(F)cccc1Cl | 10.1016/j.bmcl.2009.05.124 | ||
| CHEMBL563633 | 198984 | None | 0 | Human | Binding | pIC50 | = | 5 | 5.0 | - | 0 | Displacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cellsDisplacement of [125I]-(D-Tyr0)NMB from human neuromedin B receptor transfected in HEK293 cells |
ChEMBL | 414 | 2 | 3 | 4 | 5.4 | CC1(C)CC(=O)C2=C(C1)Nc1ccc(C(=O)O)cc1NC2c1c(F)cccc1Cl | 10.1016/j.bmcl.2009.05.124 | ||
| 44333866 | 164395 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Affinity of [125I][D-Tyr0]-NMB to human Neuromedin B receptor expressed in HEK293 cellsAffinity of [125I][D-Tyr0]-NMB to human Neuromedin B receptor expressed in HEK293 cells |
ChEMBL | 641 | 8 | 4 | 3 | 8.5 | CC(C)c1cccc(C(C)C)c1NC(=O)NC1(C(=O)NCC2(c3ccccn3)CCCCC2)CCc2[nH]c3cc(F)ccc3c2C1F | 10.1016/j.bmcl.2004.04.045 | ||
Showing 1 to 50 of 383 entries