Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
(3-Ph-Pr6)His7,DAla11,DPro13,Psi13-14,Phe14-Bn(6-14) | 218583 | 125I-[DTyr6,BetaAla11,Phe13,Nle14]Bn(6-14) | 0 | Human | Binding | pKi | = | 6800.00 | 5.17 | - | 1 | - | PDSP KiDatabase | 304.0 | 7 | 4 | 9 | -10.52 | O=C(COP(=O)([O-])[O-])C(O)C(O)C(O)CO.[Na+].[Na+] | - | |
[D-Phe6,β-Ala11,Phe13,Nle14]bombesin-(6-14) | 1478 | None | 0 | Human | Binding | pKi | = | - | 8.21 | -6 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9325344 | |
[D-Phe6,β-Ala11,Phe13,Nle14]bombesin-(6-14) | 1478 | None | 0 | Mouse | Binding | pKi | = | - | 8.82 | -1 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10454496 | |
[D-Phe6,β-Ala11,Phe13,Nle14]bombesin-(6-14) | 1478 | None | 0 | Rat | Binding | pKi | = | - | 9.00 | 1 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10454496 | |
[D-Tyr6,(R)-APA11,Phe13,Nle14]bombesin-(6-14) | 1505 | None | 0 | Human | Binding | pKi | = | - | 8.39 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/11112777 | |
[D-Tyr6,Apa-4Cl11,Phe13,Nle14]bombesin-(6-14) | 1503 | None | 0 | Human | Binding | pKi | = | - | 8.10 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/15102928 | |
Alytesin | 218578 | 125I-[DTyr6,BetaAla11,Phe13,Nle14]Bn(6-14) | 0 | Human | Binding | pKi | = | 3600.00 | 5.44 | - | 1 | - | PDSP KiDatabase | 1534.8 | 47 | 21 | 20 | -6.14 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)CNC(=O)[C@@H]1CCC(=O)N1)[C@@H](C)O)C(C)C)C(N)=O | - | |
bag-1 | 569 | None | 23 | Human | Binding | IC50 | = | 18.00 | 7.75 | - | 5 | Displacement of [125I]D-Tyr6-betaAla11-Phe13-Nle14-bombesin from human BRS-3 expressed in NFAT-CHO cells after 2 hrs by scintillation counting | ChEMBL | 333.2 | 7 | 1 | 2 | 5.24 | CCC(C)(C)Cc1cnc(CCc2ccc(-c3ccccn3)cc2)[nH]1 | https://dx.doi.org/10.1016/j.bmcl.2010.02.076 | |
bag-1 | 569 | None | 23 | Mouse | Binding | IC50 | = | 6.90 | 8.16 | - | 5 | Displacement of [125I]D-Tyr6-betaAla11-Phe13-Nle14-bombesin from mouse BRS-3 expressed in NFAT-CHO cells after 2 hrs by scintillation counting | ChEMBL | 333.2 | 7 | 1 | 2 | 5.24 | CCC(C)(C)Cc1cnc(CCc2ccc(-c3ccccn3)cc2)[nH]1 | https://dx.doi.org/10.1016/j.bmcl.2010.02.076 | |
bag-1 | 569 | None | 23 | Rat | Binding | IC50 | = | 2.40 | 8.62 | - | 5 | Displacement of [125I]D-Tyr6-betaAla11-Phe13-Nle14-bombesin from rat BRS-3 expressed in NFAT-CHO cells after 2 hrs by scintillation counting | ChEMBL | 333.2 | 7 | 1 | 2 | 5.24 | CCC(C)(C)Cc1cnc(CCc2ccc(-c3ccccn3)cc2)[nH]1 | https://dx.doi.org/10.1016/j.bmcl.2010.02.076 | |
bag-2 | 570 | None | 12 | Mouse | Binding | pKd | = | - | 8.59 | - | 3 | Unclassified | Guide to Pharmacology | 374.2 | 7 | 2 | 2 | 5.29 | O=C(O)c1ccccc1-c1ccc(CCc2ncc(CC3CCCC3)[nH]2)cc1 | https://pubmed.ncbi.nlm.nih.gov/20096642 | |
Bombesin | 218575 | 125I-[D-Tyr6,Beta-Ala11,Phe13,Nle14]Bn(6-14) | 0 | Human | Binding | pKi | = | 10000.00 | 5.00 | - | 1 | - | PDSP KiDatabase | 1053.5 | 32 | 14 | 14 | -3.38 | CSCCC(NC(=O)C(CC(C)C)NC(=O)C(Cc1cnc[nH]1)NC(=O)CNC(=O)C(NC(=O)C(C)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCC(N)=O)NC(=O)C(N)CC(N)=O)C(C)C)C(N)=O | - | |
Bombesin | 218575 | 125I-[DTyr6,BetaAla11,Phe13,Nle14]Bn(6-14) | 0 | Human | Binding | pKi | = | 10000.00 | 5.00 | - | 1 | - | PDSP KiDatabase | 1053.5 | 32 | 14 | 14 | -3.38 | CSCCC(NC(=O)C(CC(C)C)NC(=O)C(Cc1cnc[nH]1)NC(=O)CNC(=O)C(NC(=O)C(C)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCC(N)=O)NC(=O)C(N)CC(N)=O)C(C)C)C(N)=O | - | |
Bombesin, SAP | 218582 | 125I-[DTyr6,BetaAla11,Phe13,Nle14]Bn(6-14) | 0 | Human | Binding | pKi | = | 7100.00 | 5.15 | - | 1 | - | PDSP KiDatabase | - | - | - | - | - | - | - | |
CHEMBL1079517 | 5893 | None | 0 | Human | Binding | IC50 | = | 3676.00 | 5.43 | - | 3 | Displacement of [125I]-[D-Tyr6,beta-Ala11,Phe13,Nle14]bombesin from human BRS3 expressed in NFAT-CHO cells after 2 hrs by liquid scintillation counting | ChEMBL | 406.2 | 11 | 3 | 3 | 5.22 | CCCCc1cnc(C(CCCO)Cc2ccc(-c3ccccc3C(=O)O)cc2)[nH]1 | https://dx.doi.org/10.1016/j.bmcl.2010.01.154 | |
CHEMBL1082471 | 6444 | None | 0 | Human | Binding | IC50 | = | 10.00 | 8.00 | - | 2 | Displacement of [125I]D-Tyr6-betaAla11-Phe13-Nle14-bombesin from human BRS-3 expressed in NFAT-CHO cells after 2 hrs by scintillation counting | ChEMBL | 339.2 | 7 | 1 | 3 | 5.30 | CCC(C)(C)Cc1c[nH]c(CCc2ccc(-c3cnsc3)cc2)n1 | https://dx.doi.org/10.1016/j.bmcl.2010.02.076 | |
CHEMBL1086672 | 7442 | None | 0 | Human | Binding | IC50 | = | 6.10 | 8.21 | - | 2 | Binding affinity to human BRS3 | ChEMBL | 461.2 | 10 | 3 | 4 | 6.20 | CCC(C)(C)Cc1c[nH]c(CCc2ccc(-c3ccccc3OCc3nc(=S)[nH][nH]3)cc2)n1 | https://dx.doi.org/10.1016/j.bmcl.2010.03.028 | |
CHEMBL1086673 | 7443 | None | 0 | Human | Binding | IC50 | = | 22.00 | 7.66 | - | 1 | Binding affinity to human BRS3 | ChEMBL | 429.3 | 10 | 2 | 4 | 5.54 | CCC(C)(C)Cc1c[nH]c(CCc2ccc(-c3ccccc3OCc3ncn[nH]3)cc2)n1 | https://dx.doi.org/10.1016/j.bmcl.2010.03.028 | |
CHEMBL1086674 | 7444 | None | 0 | Human | Binding | IC50 | = | 27.00 | 7.57 | - | 2 | Binding affinity to human BRS3 | ChEMBL | 444.3 | 10 | 3 | 5 | 5.12 | CCC(C)(C)Cc1c[nH]c(CCc2ccc(-c3ccccc3OCc3nc(N)n[nH]3)cc2)n1 | https://dx.doi.org/10.1016/j.bmcl.2010.03.028 | |
CHEMBL1086684 | 7445 | None | 0 | Human | Binding | IC50 | = | 31.00 | 7.51 | - | 1 | Binding affinity to human BRS3 | ChEMBL | 445.2 | 10 | 3 | 4 | 4.83 | CCC(C)(C)Cc1c[nH]c(CCc2ccc(-c3ccccc3OCc3nc(=O)[nH][nH]3)cc2)n1 | https://dx.doi.org/10.1016/j.bmcl.2010.03.028 |
Showing 1 to 20 of 319 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |