Ligand source activities (1 row/activity)
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
|
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
CHEMBL1627325 | 211270 | None | 0 | Human | Functional | pEC50 | = | 10.5 | 10.5 | 1 | 8 | Antagonist activity at human recombinant bradykinin 2 receptor expressed in CHO cells assessed as inhibition of bradykinin-induced intracellular calcium mobilizationAntagonist activity at human recombinant bradykinin 2 receptor expressed in CHO cells assessed as inhibition of bradykinin-induced intracellular calcium mobilization |
ChEMBL | None | None | None | CSCC[C@H](NC(=O)CNC(=O)[C@@H](NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CO)C(C)(C)C)C(C)C)[C@@H](C)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)O)[C@@H](C)O | 10.1021/jm900604g | ||||
3812 | 717 | None | 37 | Human | Functional | pEC50 | = | 10.3 | 10.3 | -1 | 3 | Antagonist activity at human recombinant bradykinin 2 receptor expressed in CHO cells assessed as inhibition of bradykinin-induced intracellular calcium mobilizationAntagonist activity at human recombinant bradykinin 2 receptor expressed in CHO cells assessed as inhibition of bradykinin-induced intracellular calcium mobilization |
ChEMBL | None | None | None | None | 10.1021/jm900604g | ||||
439201 | 717 | None | 37 | Human | Functional | pEC50 | = | 10.3 | 10.3 | -1 | 3 | Antagonist activity at human recombinant bradykinin 2 receptor expressed in CHO cells assessed as inhibition of bradykinin-induced intracellular calcium mobilizationAntagonist activity at human recombinant bradykinin 2 receptor expressed in CHO cells assessed as inhibition of bradykinin-induced intracellular calcium mobilization |
ChEMBL | None | None | None | None | 10.1021/jm900604g | ||||
649 | 717 | None | 37 | Human | Functional | pEC50 | = | 10.3 | 10.3 | -1 | 3 | Antagonist activity at human recombinant bradykinin 2 receptor expressed in CHO cells assessed as inhibition of bradykinin-induced intracellular calcium mobilizationAntagonist activity at human recombinant bradykinin 2 receptor expressed in CHO cells assessed as inhibition of bradykinin-induced intracellular calcium mobilization |
ChEMBL | None | None | None | None | 10.1021/jm900604g | ||||
CHEMBL406291 | 717 | None | 37 | Human | Functional | pEC50 | = | 10.3 | 10.3 | -1 | 3 | Antagonist activity at human recombinant bradykinin 2 receptor expressed in CHO cells assessed as inhibition of bradykinin-induced intracellular calcium mobilizationAntagonist activity at human recombinant bradykinin 2 receptor expressed in CHO cells assessed as inhibition of bradykinin-induced intracellular calcium mobilization |
ChEMBL | None | None | None | None | 10.1021/jm900604g | ||||
DB12126 | 717 | None | 37 | Human | Functional | pEC50 | = | 10.3 | 10.3 | -1 | 3 | Antagonist activity at human recombinant bradykinin 2 receptor expressed in CHO cells assessed as inhibition of bradykinin-induced intracellular calcium mobilizationAntagonist activity at human recombinant bradykinin 2 receptor expressed in CHO cells assessed as inhibition of bradykinin-induced intracellular calcium mobilization |
ChEMBL | None | None | None | None | 10.1021/jm900604g | ||||
9851817 | 9683 | None | 0 | Guinea pig | Functional | pEC50 | = | 7 | 7.0 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 607 | 8 | 1 | 5 | 7.3 | Cc1nc2c(OCc3c(Cl)ccc(N(C)C(=O)CNC(=O)/C=C/c4ccc(C(F)(F)F)cc4)c3Cl)cccc2s1 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL112991 | 9683 | None | 0 | Guinea pig | Functional | pEC50 | = | 7 | 7.0 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 607 | 8 | 1 | 5 | 7.3 | Cc1nc2c(OCc3c(Cl)ccc(N(C)C(=O)CNC(=O)/C=C/c4ccc(C(F)(F)F)cc4)c3Cl)cccc2s1 | 10.1016/s0960-894x(98)00736-7 | ||
44340964 | 9709 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.0 | 6.0 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 609 | 10 | 1 | 6 | 6.7 | COc1c(N(C)C(=O)CNC(=O)/C=C/c2ccc(C(F)(F)F)cc2)ccc(SC)c1COc1cccc2ccc(C)nc12 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL113176 | 9709 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.0 | 6.0 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 609 | 10 | 1 | 6 | 6.7 | COc1c(N(C)C(=O)CNC(=O)/C=C/c2ccc(C(F)(F)F)cc2)ccc(SC)c1COc1cccc2ccc(C)nc12 | 10.1016/s0960-894x(98)00736-7 | ||
44341039 | 9513 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.9 | 6.9 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 597 | 9 | 1 | 5 | 6.6 | COc1ccc(N(C)C(=O)CNC(=O)/C=C/c2ccc(C(F)(F)F)cc2)c(Cl)c1COc1cccc2ccc(C)nc12 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL112140 | 9513 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.9 | 6.9 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 597 | 9 | 1 | 5 | 6.6 | COc1ccc(N(C)C(=O)CNC(=O)/C=C/c2ccc(C(F)(F)F)cc2)c(Cl)c1COc1cccc2ccc(C)nc12 | 10.1016/s0960-894x(98)00736-7 | ||
44340818 | 110672 | None | 0 | Guinea pig | Functional | pEC50 | = | 5.9 | 5.9 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 539 | 8 | 1 | 5 | 6.3 | Cc1ccc(/C=C/C(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4scnc34)c2Cl)cc1 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL325624 | 110672 | None | 0 | Guinea pig | Functional | pEC50 | = | 5.9 | 5.9 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 539 | 8 | 1 | 5 | 6.3 | Cc1ccc(/C=C/C(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4scnc34)c2Cl)cc1 | 10.1016/s0960-894x(98)00736-7 | ||
18941161 | 9731 | None | 0 | Guinea pig | Functional | pEC50 | = | 4.7 | 4.7 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 615 | 9 | 1 | 5 | 8.0 | Cc1ccc(/C=C/C(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4sc(-c5ccccc5)nc34)c2Cl)cc1 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL113320 | 9731 | None | 0 | Guinea pig | Functional | pEC50 | = | 4.7 | 4.7 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 615 | 9 | 1 | 5 | 8.0 | Cc1ccc(/C=C/C(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4sc(-c5ccccc5)nc34)c2Cl)cc1 | 10.1016/s0960-894x(98)00736-7 | ||
44341214 | 110493 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.7 | 6.7 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 621 | 12 | 1 | 6 | 6.7 | CCCOc1c(N(C)C(=O)CNC(=O)/C=C/c2ccc(C(F)(F)F)cc2)ccc(OC)c1COc1cccc2ccc(C)nc12 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL324575 | 110493 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.7 | 6.7 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 621 | 12 | 1 | 6 | 6.7 | CCCOc1c(N(C)C(=O)CNC(=O)/C=C/c2ccc(C(F)(F)F)cc2)ccc(OC)c1COc1cccc2ccc(C)nc12 | 10.1016/s0960-894x(98)00736-7 | ||
18941160 | 9917 | None | 0 | Guinea pig | Functional | pEC50 | = | 7.6 | 7.6 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 553 | 8 | 1 | 5 | 6.6 | Cc1ccc(/C=C/C(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4sc(C)nc34)c2Cl)cc1 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL114401 | 9917 | None | 0 | Guinea pig | Functional | pEC50 | = | 7.6 | 7.6 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 553 | 8 | 1 | 5 | 6.6 | Cc1ccc(/C=C/C(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4sc(C)nc34)c2Cl)cc1 | 10.1016/s0960-894x(98)00736-7 | ||
44214279 | 9718 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.6 | 6.6 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 489 | 8 | 1 | 5 | 5.3 | C=C/C=C/C(=O)NCC(=O)N(C)c1ccc(Cl)c(COc2cccc3sc(C)nc23)c1Cl | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL113222 | 9718 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.6 | 6.6 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 489 | 8 | 1 | 5 | 5.3 | C=C/C=C/C(=O)NCC(=O)N(C)c1ccc(Cl)c(COc2cccc3sc(C)nc23)c1Cl | 10.1016/s0960-894x(98)00736-7 | ||
10895913 | 9871 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.5 | 6.5 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 465 | 7 | 2 | 5 | 3.9 | CCNC(=O)NCC(=O)N(C)c1ccc(Cl)c(COc2cccc3ccc(C)nc23)c1C#N | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL114180 | 9871 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.5 | 6.5 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 465 | 7 | 2 | 5 | 3.9 | CCNC(=O)NCC(=O)N(C)c1ccc(Cl)c(COc2cccc3ccc(C)nc23)c1C#N | 10.1016/s0960-894x(98)00736-7 | ||
9831859 | 9708 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.5 | 6.5 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 508 | 10 | 3 | 6 | 3.6 | Cc1ccc2cccc(OCc3c(Cl)ccc(N(C)C(=O)CNC(=O)NCCCCN)c3C#N)c2n1 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL113169 | 9708 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.5 | 6.5 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 508 | 10 | 3 | 6 | 3.6 | Cc1ccc2cccc(OCc3c(Cl)ccc(N(C)C(=O)CNC(=O)NCCCCN)c3C#N)c2n1 | 10.1016/s0960-894x(98)00736-7 | ||
10257108 | 9833 | None | 1 | Guinea pig | Functional | pEC50 | = | 8.4 | 8.4 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 554 | 9 | 1 | 6 | 5.4 | COc1cccc(/C=C/C(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4ccc(C)nc34)c2C#N)c1 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL113963 | 9833 | None | 1 | Guinea pig | Functional | pEC50 | = | 8.4 | 8.4 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 554 | 9 | 1 | 6 | 5.4 | COc1cccc(/C=C/C(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4ccc(C)nc34)c2C#N)c1 | 10.1016/s0960-894x(98)00736-7 | ||
44340760 | 110571 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.4 | 6.4 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 523 | 10 | 3 | 6 | 3.8 | Cc1ccc2cccc(OCc3c(Cl)ccc(N(C)C(=O)CNC(=O)NCCCC(=O)O)c3C#N)c2n1 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL324950 | 110571 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.4 | 6.4 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 523 | 10 | 3 | 6 | 3.8 | Cc1ccc2cccc(OCc3c(Cl)ccc(N(C)C(=O)CNC(=O)NCCCC(=O)O)c3C#N)c2n1 | 10.1016/s0960-894x(98)00736-7 | ||
22008916 | 9764 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.4 | 6.4 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 461 | 8 | 2 | 6 | 3.3 | CCNC(=O)NCC(=O)N(C)c1ccc(OC)c(COc2cccc3ccc(C)nc23)c1C#N | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL113502 | 9764 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.4 | 6.4 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 461 | 8 | 2 | 6 | 3.3 | CCNC(=O)NCC(=O)N(C)c1ccc(OC)c(COc2cccc3ccc(C)nc23)c1C#N | 10.1016/s0960-894x(98)00736-7 | ||
44214619 | 110668 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.3 | 6.3 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 553 | 13 | 1 | 8 | 4.7 | COC(=O)CCCCC(=O)NCC(=O)N(C)c1ccc(OC)c(COc2cccc3ccc(C)nc23)c1SC | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL325601 | 110668 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.3 | 6.3 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 553 | 13 | 1 | 8 | 4.7 | COC(=O)CCCCC(=O)NCC(=O)N(C)c1ccc(OC)c(COc2cccc3ccc(C)nc23)c1SC | 10.1016/s0960-894x(98)00736-7 | ||
18941145 | 9965 | None | 0 | Guinea pig | Functional | pEC50 | = | 7.3 | 7.3 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 569 | 9 | 1 | 6 | 6.3 | COc1cccc(/C=C/C(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4sc(C)nc34)c2Cl)c1 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL114732 | 9965 | None | 0 | Guinea pig | Functional | pEC50 | = | 7.3 | 7.3 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 569 | 9 | 1 | 6 | 6.3 | COc1cccc(/C=C/C(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4sc(C)nc34)c2Cl)c1 | 10.1016/s0960-894x(98)00736-7 | ||
22008929 | 9752 | None | 0 | Guinea pig | Functional | pEC50 | = | 7.3 | 7.3 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 597 | 9 | 1 | 5 | 6.6 | COc1c(N(C)C(=O)CNC(=O)/C=C/c2ccc(C(F)(F)F)cc2)ccc(Cl)c1COc1cccc2ccc(C)nc12 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL113465 | 9752 | None | 0 | Guinea pig | Functional | pEC50 | = | 7.3 | 7.3 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 597 | 9 | 1 | 5 | 6.6 | COc1c(N(C)C(=O)CNC(=O)/C=C/c2ccc(C(F)(F)F)cc2)ccc(Cl)c1COc1cccc2ccc(C)nc12 | 10.1016/s0960-894x(98)00736-7 | ||
22008895 | 110621 | None | 0 | Guinea pig | Functional | pEC50 | = | 7.3 | 7.3 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 592 | 8 | 1 | 5 | 6.5 | Cc1ccc2cccc(OCc3c(Cl)ccc(N(C)C(=O)CNC(=O)/C=C/c4ccc(C(F)(F)F)cc4)c3C#N)c2n1 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL325255 | 110621 | None | 0 | Guinea pig | Functional | pEC50 | = | 7.3 | 7.3 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 592 | 8 | 1 | 5 | 6.5 | Cc1ccc2cccc(OCc3c(Cl)ccc(N(C)C(=O)CNC(=O)/C=C/c4ccc(C(F)(F)F)cc4)c3C#N)c2n1 | 10.1016/s0960-894x(98)00736-7 | ||
44340859 | 10045 | None | 0 | Guinea pig | Functional | pEC50 | = | 7.2 | 7.2 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 599 | 11 | 2 | 8 | 5.0 | COc1ccc(N(C)C(=O)CNC(=O)/C=C/c2ccc(NC(C)=O)nc2)c(SC)c1COc1cccc2ccc(C)nc12 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL115163 | 10045 | None | 0 | Guinea pig | Functional | pEC50 | = | 7.2 | 7.2 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 599 | 11 | 2 | 8 | 5.0 | COc1ccc(N(C)C(=O)CNC(=O)/C=C/c2ccc(NC(C)=O)nc2)c(SC)c1COc1cccc2ccc(C)nc12 | 10.1016/s0960-894x(98)00736-7 | ||
44340951 | 10004 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.2 | 6.2 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 587 | 11 | 1 | 7 | 6.4 | COc1ccc(/C=C/C(=O)NCC(=O)N(C)c2ccc(SC)c(COc3cccc4ccc(C)nc34)c2SC)cc1 | 10.1016/s0960-894x(98)00736-7 | ||
CHEMBL114915 | 10004 | None | 0 | Guinea pig | Functional | pEC50 | = | 6.2 | 6.2 | - | 1 | Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI)Inhibition of BK-induced (4x10E-8M) contraction of isolated guinea pig ileum (GPI) |
ChEMBL | 587 | 11 | 1 | 7 | 6.4 | COc1ccc(/C=C/C(=O)NCC(=O)N(C)c2ccc(SC)c(COc3cccc4ccc(C)nc34)c2SC)cc1 | 10.1016/s0960-894x(98)00736-7 | ||
3812 | 717 | None | 37 | Human | Functional | pED50 | = | 8.8 | 8.8 | -1 | 3 | In vitro 50 % Maximal response in jugular vein expressing B2 receptorIn vitro 50 % Maximal response in jugular vein expressing B2 receptor |
ChEMBL | None | None | None | None | 10.1021/jm00144a008 | ||||
439201 | 717 | None | 37 | Human | Functional | pED50 | = | 8.8 | 8.8 | -1 | 3 | In vitro 50 % Maximal response in jugular vein expressing B2 receptorIn vitro 50 % Maximal response in jugular vein expressing B2 receptor |
ChEMBL | None | None | None | None | 10.1021/jm00144a008 | ||||
649 | 717 | None | 37 | Human | Functional | pED50 | = | 8.8 | 8.8 | -1 | 3 | In vitro 50 % Maximal response in jugular vein expressing B2 receptorIn vitro 50 % Maximal response in jugular vein expressing B2 receptor |
ChEMBL | None | None | None | None | 10.1021/jm00144a008 | ||||
CHEMBL406291 | 717 | None | 37 | Human | Functional | pED50 | = | 8.8 | 8.8 | -1 | 3 | In vitro 50 % Maximal response in jugular vein expressing B2 receptorIn vitro 50 % Maximal response in jugular vein expressing B2 receptor |
ChEMBL | None | None | None | None | 10.1021/jm00144a008 | ||||
DB12126 | 717 | None | 37 | Human | Functional | pED50 | = | 8.8 | 8.8 | -1 | 3 | In vitro 50 % Maximal response in jugular vein expressing B2 receptorIn vitro 50 % Maximal response in jugular vein expressing B2 receptor |
ChEMBL | None | None | None | None | 10.1021/jm00144a008 | ||||
CHEMBL2372138 | 212648 | None | 0 | Human | Functional | pED50 | = | 8 | 8.0 | - | 1 | In vitro 50 % Maximal response in jugular vein expressing B2 receptorIn vitro 50 % Maximal response in jugular vein expressing B2 receptor |
ChEMBL | None | None | None | [N-]=[N+]=Nc1ccc(C[C@H](NC(=O)CNC(=O)[C@@H]2CCCN2C(=O)[C@@H]2CCCN2C(=O)[C@@H](N)CCCNC(=N)N)C(=O)N[C@@H](CO)C(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)cc1 | 10.1021/jm00144a008 |
Showing 1 to 50 of 551 entries
Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
|
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
11980903 | 14498 | None | 13 | Human | Binding | pAC50 | = | 4.9 | 4.9 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 382 | 4 | 0 | 2 | 5.3 | Cc1cc(/C=C/c2ccc3cc(N(C)C)ccc3[n+]2C)c(C)n1-c1ccccc1 | 10.1038/s41467-023-40064-9 | ||
22526 | 14498 | None | 13 | Human | Binding | pAC50 | = | 4.9 | 4.9 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 382 | 4 | 0 | 2 | 5.3 | Cc1cc(/C=C/c2ccc3cc(N(C)C)ccc3[n+]2C)c(C)n1-c1ccccc1 | 10.1038/s41467-023-40064-9 | ||
5281035 | 14498 | None | 13 | Human | Binding | pAC50 | = | 4.9 | 4.9 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 382 | 4 | 0 | 2 | 5.3 | Cc1cc(/C=C/c2ccc3cc(N(C)C)ccc3[n+]2C)c(C)n1-c1ccccc1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL1201303 | 14498 | None | 13 | Human | Binding | pAC50 | = | 4.9 | 4.9 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 382 | 4 | 0 | 2 | 5.3 | Cc1cc(/C=C/c2ccc3cc(N(C)C)ccc3[n+]2C)c(C)n1-c1ccccc1 | 10.1038/s41467-023-40064-9 | ||
137 | 370 | None | 37 | Human | Binding | pAC50 | = | 4.9 | 4.9 | - | 11 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 249 | 8 | 2 | 3 | 2.2 | C=CCc1ccccc1OCC(CNC(C)C)O | 10.1038/s41467-023-40064-9 | ||
2119 | 370 | None | 37 | Human | Binding | pAC50 | = | 4.9 | 4.9 | - | 11 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 249 | 8 | 2 | 3 | 2.2 | C=CCc1ccccc1OCC(CNC(C)C)O | 10.1038/s41467-023-40064-9 | ||
563 | 370 | None | 37 | Human | Binding | pAC50 | = | 4.9 | 4.9 | - | 11 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 249 | 8 | 2 | 3 | 2.2 | C=CCc1ccccc1OCC(CNC(C)C)O | 10.1038/s41467-023-40064-9 | ||
66368 | 370 | None | 37 | Human | Binding | pAC50 | = | 4.9 | 4.9 | - | 11 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 249 | 8 | 2 | 3 | 2.2 | C=CCc1ccccc1OCC(CNC(C)C)O | 10.1038/s41467-023-40064-9 | ||
CHEMBL266195 | 370 | None | 37 | Human | Binding | pAC50 | = | 4.9 | 4.9 | - | 11 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 249 | 8 | 2 | 3 | 2.2 | C=CCc1ccccc1OCC(CNC(C)C)O | 10.1038/s41467-023-40064-9 | ||
DB00866 | 370 | None | 37 | Human | Binding | pAC50 | = | 4.9 | 4.9 | - | 11 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 249 | 8 | 2 | 3 | 2.2 | C=CCc1ccccc1OCC(CNC(C)C)O | 10.1038/s41467-023-40064-9 | ||
6436173 | 55132 | None | 30 | Human | Binding | pAC50 | = | 4.8 | 4.8 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 785 | 2 | 5 | 13 | 6.2 | CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(c5c(nc6cc(C)ccn65)c4c3C2=O)NC(=O)/C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C | 10.1038/s41467-023-40064-9 | ||
CHEMBL1617 | 55132 | None | 30 | Human | Binding | pAC50 | = | 4.8 | 4.8 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 785 | 2 | 5 | 13 | 6.2 | CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(c5c(nc6cc(C)ccn65)c4c3C2=O)NC(=O)/C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C | 10.1038/s41467-023-40064-9 | ||
135398735 | 137055 | None | 20 | Human | Binding | pAC50 | = | 4.7 | 4.7 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 822 | 4 | 6 | 15 | 4.3 | CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(c(/C=N/N5CCN(C)CC5)c(O)c4c3C2=O)NC(=O)/C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C | 10.1038/s41467-023-40064-9 | ||
136262914 | 137055 | None | 20 | Human | Binding | pAC50 | = | 4.7 | 4.7 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 822 | 4 | 6 | 15 | 4.3 | CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(c(/C=N/N5CCN(C)CC5)c(O)c4c3C2=O)NC(=O)/C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C | 10.1038/s41467-023-40064-9 | ||
CHEMBL374478 | 137055 | None | 20 | Human | Binding | pAC50 | = | 4.7 | 4.7 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 822 | 4 | 6 | 15 | 4.3 | CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(c(/C=N/N5CCN(C)CC5)c(O)c4c3C2=O)NC(=O)/C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C | 10.1038/s41467-023-40064-9 | ||
4495 | 198991 | None | 63 | Human | Binding | pAC50 | = | 4.7 | 4.7 | - | 30 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 308 | 5 | 1 | 5 | 2.8 | CS(=O)(=O)Nc1ccc([N+](=O)[O-])cc1Oc1ccccc1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL56367 | 198991 | None | 63 | Human | Binding | pAC50 | = | 4.7 | 4.7 | - | 30 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 308 | 5 | 1 | 5 | 2.8 | CS(=O)(=O)Nc1ccc([N+](=O)[O-])cc1Oc1ccccc1 | 10.1038/s41467-023-40064-9 | ||
5329102 | 194838 | None | 50 | Human | Binding | pAC50 | = | 5.6 | 5.6 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 398 | 7 | 3 | 3 | 3.3 | CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c1C | 10.1038/s41467-023-40064-9 | ||
CHEMBL535 | 194838 | None | 50 | Human | Binding | pAC50 | = | 5.6 | 5.6 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 398 | 7 | 3 | 3 | 3.3 | CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c1C | 10.1038/s41467-023-40064-9 | ||
135564886 | 14499 | None | 5 | Human | Binding | pAC50 | = | 4.6 | 4.6 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 752 | 14 | 1 | 6 | 8.7 | CC1(C)C(/C=C/C=C/C=C/C=C2\N(CCCCS(=O)(=O)O)c3ccc4ccccc4c3C2(C)C)=[N+](CCCCS(=O)(=O)[O-])c2ccc3ccccc3c21 | 10.1038/s41467-023-40064-9 | ||
135673376 | 14499 | None | 5 | Human | Binding | pAC50 | = | 4.6 | 4.6 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 752 | 14 | 1 | 6 | 8.7 | CC1(C)C(/C=C/C=C/C=C/C=C2\N(CCCCS(=O)(=O)O)c3ccc4ccccc4c3C2(C)C)=[N+](CCCCS(=O)(=O)[O-])c2ccc3ccccc3c21 | 10.1038/s41467-023-40064-9 | ||
137157436 | 14499 | None | 5 | Human | Binding | pAC50 | = | 4.6 | 4.6 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 752 | 14 | 1 | 6 | 8.7 | CC1(C)C(/C=C/C=C/C=C/C=C2\N(CCCCS(=O)(=O)O)c3ccc4ccccc4c3C2(C)C)=[N+](CCCCS(=O)(=O)[O-])c2ccc3ccccc3c21 | 10.1038/s41467-023-40064-9 | ||
145948239 | 14499 | None | 5 | Human | Binding | pAC50 | = | 4.6 | 4.6 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 752 | 14 | 1 | 6 | 8.7 | CC1(C)C(/C=C/C=C/C=C/C=C2\N(CCCCS(=O)(=O)O)c3ccc4ccccc4c3C2(C)C)=[N+](CCCCS(=O)(=O)[O-])c2ccc3ccccc3c21 | 10.1038/s41467-023-40064-9 | ||
71587099 | 14499 | None | 5 | Human | Binding | pAC50 | = | 4.6 | 4.6 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 752 | 14 | 1 | 6 | 8.7 | CC1(C)C(/C=C/C=C/C=C/C=C2\N(CCCCS(=O)(=O)O)c3ccc4ccccc4c3C2(C)C)=[N+](CCCCS(=O)(=O)[O-])c2ccc3ccccc3c21 | 10.1038/s41467-023-40064-9 | ||
CHEMBL1201304 | 14499 | None | 5 | Human | Binding | pAC50 | = | 4.6 | 4.6 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 752 | 14 | 1 | 6 | 8.7 | CC1(C)C(/C=C/C=C/C=C/C=C2\N(CCCCS(=O)(=O)O)c3ccc4ccccc4c3C2(C)C)=[N+](CCCCS(=O)(=O)[O-])c2ccc3ccccc3c21 | 10.1038/s41467-023-40064-9 | ||
26248 | 161633 | None | 72 | Human | Binding | pAC50 | = | 4.6 | 4.6 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 368 | 3 | 1 | 7 | 2.0 | CC(=O)Oc1cccc2c1C(=O)c1c(OC(C)=O)cc(C(=O)O)cc1C2=O | 10.1038/s41467-023-40064-9 | ||
CHEMBL41286 | 161633 | None | 72 | Human | Binding | pAC50 | = | 4.6 | 4.6 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 368 | 3 | 1 | 7 | 2.0 | CC(=O)Oc1cccc2c1C(=O)c1c(OC(C)=O)cc(C(=O)O)cc1C2=O | 10.1038/s41467-023-40064-9 | ||
2335 | 11852 | None | 18 | Human | Binding | pAC50 | = | 4.5 | 4.5 | - | 12 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 412 | 11 | 0 | 2 | 6.1 | CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(C)Cc2ccccc2)cc1 | 10.1038/s41467-023-40064-9 | ||
8478 | 11852 | None | 18 | Human | Binding | pAC50 | = | 4.5 | 4.5 | - | 12 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 412 | 11 | 0 | 2 | 6.1 | CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(C)Cc2ccccc2)cc1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL1182210 | 11852 | None | 18 | Human | Binding | pAC50 | = | 4.5 | 4.5 | - | 12 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 412 | 11 | 0 | 2 | 6.1 | CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(C)Cc2ccccc2)cc1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL221753 | 11852 | None | 18 | Human | Binding | pAC50 | = | 4.5 | 4.5 | - | 12 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 412 | 11 | 0 | 2 | 6.1 | CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(C)Cc2ccccc2)cc1 | 10.1038/s41467-023-40064-9 | ||
41684 | 31229 | None | 62 | Human | Binding | pAC50 | = | 5.3 | 5.3 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 307 | 4 | 1 | 7 | 2.2 | CC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1 | 10.1038/s41467-023-40064-9 | ||
CHEMBL1401 | 31229 | None | 62 | Human | Binding | pAC50 | = | 5.3 | 5.3 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 307 | 4 | 1 | 7 | 2.2 | CC(=O)Oc1ccccc1C(=O)Nc1ncc([N+](=O)[O-])s1 | 10.1038/s41467-023-40064-9 | ||
2179 | 167616 | None | 49 | Human | Binding | pAC50 | = | 5.1 | 5.1 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 393 | 5 | 2 | 5 | 4.5 | COc1cc(NS(C)(=O)=O)ccc1Nc1c2ccccc2nc2ccccc12 | 10.1038/s41467-023-40064-9 | ||
CHEMBL1256655 | 167616 | None | 49 | Human | Binding | pAC50 | = | 5.1 | 5.1 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 393 | 5 | 2 | 5 | 4.5 | COc1cc(NS(C)(=O)=O)ccc1Nc1c2ccccc2nc2ccccc12 | 10.1038/s41467-023-40064-9 | ||
CHEMBL43 | 167616 | None | 49 | Human | Binding | pAC50 | = | 5.1 | 5.1 | - | 0 | Binding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assayBinding affinity towards human BDKRB2 in an in vitro assay with cellular components measured by scintillation proximity assay |
ChEMBL | 393 | 5 | 2 | 5 | 4.5 | COc1cc(NS(C)(=O)=O)ccc1Nc1c2ccccc2nc2ccccc12 | 10.1038/s41467-023-40064-9 | ||
11498853 | 83220 | None | 14 | Human | Binding | pIC50 | = | 10.3 | 10.3 | - | 1 | Displacement of [3H]bradykinin from human recombinant B2 receptor expressed in HEK293 cellsDisplacement of [3H]bradykinin from human recombinant B2 receptor expressed in HEK293 cells |
ChEMBL | 763 | 12 | 2 | 8 | 4.0 | Cc1cc(C)c2cccc(OCc3c(Cl)ccc(S(=O)(=O)NC4(C(=O)N5CCN(C(=O)[C@@H](N)CCC[N+](C)(C)C)CC5)CCOCC4)c3Cl)c2n1 | 10.1021/jm9002445 | ||
CHEMBL218427 | 83220 | None | 14 | Human | Binding | pIC50 | = | 10.3 | 10.3 | - | 1 | Displacement of [3H]bradykinin from human recombinant B2 receptor expressed in HEK293 cellsDisplacement of [3H]bradykinin from human recombinant B2 receptor expressed in HEK293 cells |
ChEMBL | 763 | 12 | 2 | 8 | 4.0 | Cc1cc(C)c2cccc(OCc3c(Cl)ccc(S(=O)(=O)NC4(C(=O)N5CCN(C(=O)[C@@H](N)CCC[N+](C)(C)C)CC5)CCOCC4)c3Cl)c2n1 | 10.1021/jm9002445 | ||
CHEMBL541758 | 83220 | None | 14 | Human | Binding | pIC50 | = | 10.3 | 10.3 | - | 1 | Displacement of [3H]bradykinin from human recombinant B2 receptor expressed in HEK293 cellsDisplacement of [3H]bradykinin from human recombinant B2 receptor expressed in HEK293 cells |
ChEMBL | 763 | 12 | 2 | 8 | 4.0 | Cc1cc(C)c2cccc(OCc3c(Cl)ccc(S(=O)(=O)NC4(C(=O)N5CCN(C(=O)[C@@H](N)CCC[N+](C)(C)C)CC5)CCOCC4)c3Cl)c2n1 | 10.1021/jm9002445 | ||
667 | 1973 | None | 29 | Guinea pig | Binding | pIC50 | = | 10.1 | 10.1 | 1 | 6 | Concentration required to inhibit specific binding of [ 3H]BK (0.06 nM) to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%.Concentration required to inhibit specific binding of [ 3H]BK (0.06 nM) to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%. |
ChEMBL | None | None | None | None | 10.1021/jm980300f | ||||
71364 | 1973 | None | 29 | Guinea pig | Binding | pIC50 | = | 10.1 | 10.1 | 1 | 6 | Concentration required to inhibit specific binding of [ 3H]BK (0.06 nM) to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%.Concentration required to inhibit specific binding of [ 3H]BK (0.06 nM) to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%. |
ChEMBL | None | None | None | None | 10.1021/jm980300f | ||||
CHEMBL2028850 | 1973 | None | 29 | Guinea pig | Binding | pIC50 | = | 10.1 | 10.1 | 1 | 6 | Concentration required to inhibit specific binding of [ 3H]BK (0.06 nM) to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%.Concentration required to inhibit specific binding of [ 3H]BK (0.06 nM) to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%. |
ChEMBL | None | None | None | None | 10.1021/jm980300f | ||||
DB06196 | 1973 | None | 29 | Guinea pig | Binding | pIC50 | = | 10.1 | 10.1 | 1 | 6 | Concentration required to inhibit specific binding of [ 3H]BK (0.06 nM) to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%.Concentration required to inhibit specific binding of [ 3H]BK (0.06 nM) to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%. |
ChEMBL | None | None | None | None | 10.1021/jm980300f | ||||
667 | 1973 | None | 29 | Guinea pig | Binding | pIC50 | = | 10.1 | 10.1 | 1 | 6 | Concentration required to inhibit specific binding of [3H]BK at 0.06 nM to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%.Concentration required to inhibit specific binding of [3H]BK at 0.06 nM to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%. |
ChEMBL | None | None | None | None | 10.1021/jm980214f | ||||
71364 | 1973 | None | 29 | Guinea pig | Binding | pIC50 | = | 10.1 | 10.1 | 1 | 6 | Concentration required to inhibit specific binding of [3H]BK at 0.06 nM to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%.Concentration required to inhibit specific binding of [3H]BK at 0.06 nM to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%. |
ChEMBL | None | None | None | None | 10.1021/jm980214f | ||||
CHEMBL2028850 | 1973 | None | 29 | Guinea pig | Binding | pIC50 | = | 10.1 | 10.1 | 1 | 6 | Concentration required to inhibit specific binding of [3H]BK at 0.06 nM to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%.Concentration required to inhibit specific binding of [3H]BK at 0.06 nM to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%. |
ChEMBL | None | None | None | None | 10.1021/jm980214f | ||||
DB06196 | 1973 | None | 29 | Guinea pig | Binding | pIC50 | = | 10.1 | 10.1 | 1 | 6 | Concentration required to inhibit specific binding of [3H]BK at 0.06 nM to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%.Concentration required to inhibit specific binding of [3H]BK at 0.06 nM to Bradykinin receptor B2 in guinea pig ileum membrane preparations by 50%. |
ChEMBL | None | None | None | None | 10.1021/jm980214f | ||||
667 | 1973 | None | 29 | Guinea pig | Binding | pIC50 | = | 10.1 | 10.1 | 1 | 6 | In vitro inhibitory activity towards bradykinin receptor B2 using [3H]BK (0.06 nM) as a radioligand in guinea pig ileum membrane preparationIn vitro inhibitory activity towards bradykinin receptor B2 using [3H]BK (0.06 nM) as a radioligand in guinea pig ileum membrane preparation |
ChEMBL | None | None | None | None | 10.1021/jm030159x | ||||
71364 | 1973 | None | 29 | Guinea pig | Binding | pIC50 | = | 10.1 | 10.1 | 1 | 6 | In vitro inhibitory activity towards bradykinin receptor B2 using [3H]BK (0.06 nM) as a radioligand in guinea pig ileum membrane preparationIn vitro inhibitory activity towards bradykinin receptor B2 using [3H]BK (0.06 nM) as a radioligand in guinea pig ileum membrane preparation |
ChEMBL | None | None | None | None | 10.1021/jm030159x | ||||
CHEMBL2028850 | 1973 | None | 29 | Guinea pig | Binding | pIC50 | = | 10.1 | 10.1 | 1 | 6 | In vitro inhibitory activity towards bradykinin receptor B2 using [3H]BK (0.06 nM) as a radioligand in guinea pig ileum membrane preparationIn vitro inhibitory activity towards bradykinin receptor B2 using [3H]BK (0.06 nM) as a radioligand in guinea pig ileum membrane preparation |
ChEMBL | None | None | None | None | 10.1021/jm030159x |
Showing 1 to 50 of 2,445 entries